Cyfroteka.pl

klikaj i czytaj online

Cyfro
Czytomierz
00782 010725 7473001 na godz. na dobę w sumie
Konstytucja III RP w tezach orzeczniczych Trybunału Konstytucyjnego i wybranych sądów - ebook/pdf
Konstytucja III RP w tezach orzeczniczych Trybunału Konstytucyjnego i wybranych sądów - ebook/pdf
Autor: Liczba stron: 1014
Wydawca: C. H. Beck Język publikacji: polski
ISBN: 978-83-255-2697-9 Data wydania:
Lektor:
Kategoria: ebooki >> prawo i podatki
Porównaj ceny (książka, ebook, audiobook).

„Książka, którą oddajemy do rąk czytelników, jest efektem pracy grupy byłych oraz obecnych studentów Wydziału Prawa i Administracji
Uniwersytetu Warszawskiego. Postawili sobie za cel zaprezentowanie wypowiedzi organów władzy sądowniczej dotyczących Konstytucji
z 2 kwietnia 1997 r. Dało to możliwość przedstawienia rzeczywistej treści, jakiej nabrały jej przepisy w ciągu dziesięciu lat swojego obowiązywania.

W książce zestawiono wybrane tezy z uzasadnień do orzeczeń przede wszystkim Trybunału Konstytucyjnego oraz, choć rzadziej, Sądu Najwyższego,Naczelnego Sądu Administracyjnego czy innych sądów.
Nie ma ona charakteru tradycyjnie rozumianego komentarza. Przede wszystkim pokazuje sposób rozumienia przepisów ustawy zasadniczej przez organy władzy sądowniczej”.
Z wprowadzenia prof. dr. hab. Marka Zubika

Znajdź podobne książki

Darmowy fragment publikacji:

Zbiory Orzecznictwa Becka Konstytucja III RP w tezach orzeczniczych Trybuna³u Konstytucyjnego i wybranych s¹dów Redakcja i wprowadzenie Prof. Marek Zubik 2. wydanie C.H. Beck POSZCZEGÓLNE CZĘŚCI ZBIORU OPRACOWALI: Bogdanowicz Piotr: Przepisy Konsty- tucji w relacji do prawa wspólnotowego; Artykuł 55, 125, 188, 193–194, 197, 219, 221, 225, 227; Borysiak Witold: Artykuł 14, 17, 19, 27, 38–40, 76, 213–215; Borysiak Witold i Brach Michał: Arty- kuł 77; Brach Michał: Artykuł 41–46, 78, 173–174, 176–178, 180, 183–184, 186, 202–207; Czura Maciej: Artykuł 9, 20–24, 64, 83–85, 216–217, 228, 232, 233–234; Kaleta Krzysztof: Artykuł 7–8, 65–70, 74–75, 87–88, 90–91, 93–94; Kaleta Krzysztof i Wi(cid:261)cek Marcin: Artykuł 31, 92; Ko(cid:296)mi(cid:276)ski Krzysztof: Artykuł 12, 26, 30, 57–60, 127, 139, 144–146, 153, 156; Królikowska Katarzyna: Artykuł 6, 25, 32, 35–37, 52–54, 198–201, 235–237, 239, 241, 243; Królikowski Jakub: Wst(cid:266)p do Konsty- tucji; Artykuł 3–5, 15–16, 29, 47, 49–51, 163–172, 191; Paprocka Ada: Zasada kadencyjno(cid:286)ci organów władzy publicznej; Artykuł 10–11, 13, 33, 61–63, 80, 95–96, 98, 101, 103–107, 110–112, 208–212, Wykaz cyto- wanych orzecze(cid:276); Wi(cid:261)cek Marcin: Zasada demokratycz- nego pa(cid:276)stwa prawnego; Artykuł 1–2, 18, 48, 71–72, 79, 81, 118–124, 190; Zołotar Anna: Zasada proporcjonalno(cid:286)ci; Zasada równo(cid:286)ci; Zasady wydawania roz- porz(cid:261)dze(cid:276). Wył(cid:261)czno(cid:286)ć ustawy. Spis tre(cid:287)ci XIX XLIII Przedmowa do drugiego wydania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Przedmowa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXI Wykaz skrótów . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXIII Zasada demokratycznego pa(cid:276)stwa prawnego . . . . . . . . . . . . . . . . . . . . . XXIX Zasada proporcjonalno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXXI Zasada równo(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXXIV Zasady wydawania rozporz(cid:261)dze(cid:276). Wył(cid:261)czno(cid:286)ć ustawy . . . . . . . . . . . . . . XXXVII Zasada kadencyjno(cid:286)ci organów władzy publicznej . . . . . . . . . . . . . . . . . XL Przepisy Konstytucji w relacji do prawa Unii Europejskiej . . . . . . . . . . Konstytucja Rzeczypospolitej Polskiej z dnia 2 kwietnia 1997 r. . . . . . . Preambuła . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Suwerenno(cid:286)ć Narodu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Zasada pomocniczo(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Zasada solidaryzmu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Zasada rzetelno(cid:286)ci funkcjonowania instytucji publicznych . . . . . . . . . 5. Stosunek do przeszło(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6. Zasada współdziałania władz . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział I. RZECZPOSPOLITA . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 1 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 2 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Zasada ochrony zaufania do pa(cid:276)stwa i stanowionego przez nie prawa A. Zasada ochrony praw słusznie nabytych . . . . . . . . . . . . . . . . . . . . . B. Zasada niedziałania prawa wstecz – lex retro non agit . . . . . . . . . . C. Zasada ochrony interesów w toku . . . . . . . . . . . . . . . . . . . . . . . . . . 10 1 1 2 5 8 16 3 4 4 19 8 16 23 26 27 D. Nakaz zachowania odpowiedniej vacatio legis . . . . . . . . . . . . . . . . E. Zasada okre(cid:286)lono(cid:286)ci przepisów prawa . . . . . . . . . . . . . . . . . . . . . . . F. Zasady techniki prawodawczej . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Zasada sprawiedliwo(cid:286)ci społecznej . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 28 32 36 38 39 VII Spis tre(cid:286)ci Artykuł 3 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 4 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 5 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 6 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 7 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Zasada legalizmu jako wzorzec kontroli konstytucyjno(cid:286)ci . . . . . . . . . 3. Wymóg istnienia gwarancji instytucjonalnych i proceduralnych dla realizacji zasady legalizmu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Prawo a etyka . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 8 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Bezpo(cid:286)rednie stosowanie Konstytucji . . . . . . . . . . . . . . . . . . . . . . . . . 2. Wykładnia ustaw w zgodzie z Konstytucj(cid:261) . . . . . . . . . . . . . . . . . . . . . 3. Nadrz(cid:266)dno(cid:286)ć Konstytucji a model prawa europejskiego . . . . . . . . . . . 4. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 9 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 10 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Zasada podziału władzy – uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . 2. Relacje mi(cid:266)dzy władz(cid:261) ustawodawcz(cid:261) a wykonawcz(cid:261) . . . . . . . . . . . . 3. Odr(cid:266)bno(cid:286)ć władzy s(cid:261)downiczej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Zasada podziału władzy a samorz(cid:261)d terytorialny . . . . . . . . . . . . . . . . 5. Zasada podziału władzy a Unia Europejska . . . . . . . . . . . . . . . . . . . . Artykuł 11 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 12 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 13 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 14 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 15 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 16 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 17 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 18 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 19 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 20 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 21 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Własno(cid:286)ć . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Dziedziczenie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Wywłaszczenie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 22 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 23 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 24 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 25 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . VIII 45 45 51 52 53 53 58 59 60 61 61 67 68 70 72 74 74 76 77 79 80 81 90 94 95 98 101 103 114 126 128 134 134 135 136 140 148 150 150 1. Zasada równouprawnienia ko(cid:286)ciołów i zwi(cid:261)zków wyznaniowych . . . 1a. Zasada bezstronno(cid:286)ci (cid:286)wiatopogl(cid:261)dowej władz publicznych . . . . . . 2. Status ko(cid:286)ciołów i zwi(cid:261)zków wyznaniowych . . . . . . . . . . . . . . . . . . . 3. Artykuł 25 a zasada równo(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Stosunki mi(cid:266)dzy RP a ko(cid:286)ciołami i zwi(cid:261)zkami wyznaniowymi . . . . . 5. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 26 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 27 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 29 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział II. WOLNO(cid:285)CI, PRAWA I OBOWI(cid:260)ZKI CZŁOWIEKA I OBYWATELA . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Zasady ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 30 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 31 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Zasada wolno(cid:286)ci człowieka (art. 31 ust. 1 i 2) . . . . . . . . . . . . . . . . . . . A. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . B. Zasada swobody umów . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Warunki dopuszczalno(cid:286)ci ograniczenia konstytucyjnych wolno(cid:286)ci i praw (art. 31 ust. 3 Konstytucji) . . . . . . . . . . . . . . . . . . . . . . . . . . . . A. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . B. Wył(cid:261)czno(cid:286)ć ustawy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . C. Zasada proporcjonalno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . D. Zakaz naruszania „istoty” prawa lub wolno(cid:286)ci . . . . . . . . . . . . . . . . E. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 32 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Tre(cid:286)ć zasady równo(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . A. Zakres podmiotowy zasady równo(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . B. Zasada równo(cid:286)ci a zasada sprawiedliwo(cid:286)ci społecznej . . . . . . . . . . C. Artykuł 32 a inne przepisy Konstytucji nakazuj(cid:261)ce poszanowanie zasady równo(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . D. Charakter ustrojowy zasady równo(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . 2. Odst(cid:266)pstwa od zasady równo(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Zasada równo(cid:286)ci na tle konkretnych rozwi(cid:261)za(cid:276) ustawodawczych . . . Artykuł 33 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 35 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 36 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 37 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Wolno(cid:286)ci i prawa osobiste . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 38 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 39 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Spis tre(cid:286)ci 151 153 154 155 155 157 159 162 164 165 166 166 173 174 174 174 177 177 179 181 185 185 190 190 192 193 193 194 195 198 204 213 214 215 217 217 221 IX Spis tre(cid:286)ci Artykuł 40 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 41 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 42 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Nullum crimen sine lege. Lex retro non agit w prawie karnym . . . . . . 3. Prawo do obrony . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Zasada domniemania niewinno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5. Przedawnienie w sprawach karnych . . . . . . . . . . . . . . . . . . . . . . . . . . 6. Kary administracyjne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 43 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 44 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 45 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Prawo dost(cid:266)pu do s(cid:261)du . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Poj(cid:266)cie „sprawy” . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Prawo do sprawiedliwej i jawnej procedury s(cid:261)dowej . . . . . . . . . . . . . 5. Prawo do odpowiedniego ukształtowania ustroju i pozycji organów rozpoznaj(cid:261)cych sprawy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6. Prawo do s(cid:261)du wła(cid:286)ciwego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 7. Prawo do rozpatrzenia sprawy bez nieuzasadnionej zwłoki . . . . . . . . Artykuł 46 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 47 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 48 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 49 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 50 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 51 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 52 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Wolno(cid:286)ć poruszania si(cid:266) po terytorium RP . . . . . . . . . . . . . . . . . . . . . . 2. Wolno(cid:286)ć wyboru miejsca zamieszkania i pobytu . . . . . . . . . . . . . . . . 3. Wolno(cid:286)ć swobodnego opuszczenia terytorium RP . . . . . . . . . . . . . . . 4. Prawo osiedlenia si(cid:266) na terytorium RP na stałe osoby, której pochodzenie polskie zostało stwierdzone zgodnie z ustaw(cid:261) . . . . . . . Artykuł 53 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 54 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Wolno(cid:286)ć wyra(cid:298)ania swoich pogl(cid:261)dów (wolno(cid:286)ć słowa) . . . . . . . . . . . 2. Zwi(cid:261)zek z art. 14 Konstytucji . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2a. Zwi(cid:261)zek z art. 61 Konstytucji . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Wolno(cid:286)ć słowa a działalno(cid:286)ć gospodarcza . . . . . . . . . . . . . . . . . . . . . . 4. Ograniczenia wolno(cid:286)ci słowa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5. Zakaz cenzury prewencyjnej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . X 221 222 229 229 233 236 241 246 251 254 254 255 255 259 265 270 277 278 279 281 284 287 289 290 291 294 295 296 297 298 300 303 304 309 311 311 312 316 Artykuł 55 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Ekstradycja a europejski nakaz aresztowania . . . . . . . . . . . . . . . . . . . 3. Zakaz ekstradycji w powi(cid:261)zaniu z innymi przepisami . . . . . . . . . . . . Wolno(cid:286)ci i prawa polityczne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 57 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 58 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 59 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 60 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 61 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 62 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Prawa wyborcze – zakres i mo(cid:298)liwo(cid:286)ć ograniczenia . . . . . . . . . . . . . . 2. Prawa wyborcze a zasada kadencyjno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . 3. Rejestr wyborców . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Konsekwencje członkostwa Polski w Unii Europejskiej dla praw wyborczych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 63 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Wolno(cid:286)ci i prawa ekonomiczne, socjalne i kulturalne. . . . . . . . . . . . . . . . . . Artykuł 64 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Własno(cid:286)ć . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Inne prawa maj(cid:261)tkowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . A. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . B. Najem . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . C. Prawo zaliczenia mienia zabu(cid:298)a(cid:276)skiego . . . . . . . . . . . . . . . . . . . . . D. Prawa spółdzielcze . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Prawo dziedziczenia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Ochrona praw maj(cid:261)tkowych a obowi(cid:261)zek podatkowy . . . . . . . . . . . . Artykuł 65 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 66 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 67 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 68 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 69 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 70 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 71 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 72 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 73 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 74 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 75 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 76 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:285)rodki ochrony wolno(cid:286)ci i praw . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Spis tre(cid:286)ci 316 317 317 320 321 321 328 330 334 337 356 356 358 361 362 363 364 364 364 370 370 374 375 376 379 386 387 394 397 405 412 413 422 426 428 429 430 435 439 XI Spis tre(cid:286)ci Artykuł 77 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Odpowiedzialno(cid:286)ć odszkodowawcza władzy publicznej (art. 77 ust. 1) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . A. Charakter odpowiedzialno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . B. Przesłanki odpowiedzialno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . C. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Zakaz zamykania drogi s(cid:261)dowej (art. 77 ust. 2) . . . . . . . . . . . . . . . . . Artykuł 78 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 79 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Podmiot legitymowany do wniesienia skargi . . . . . . . . . . . . . . . . . . . 3. Przedmiot kontroli . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . A. Skarga na akty stosowania prawa . . . . . . . . . . . . . . . . . . . . . . . . . . B. Skarga na zaniechanie prawodawcze . . . . . . . . . . . . . . . . . . . . . . . C. Skarga na akt prawa miejscowego . . . . . . . . . . . . . . . . . . . . . . . . . D. Skarga na umow(cid:266) mi(cid:266)dzynarodow(cid:261) . . . . . . . . . . . . . . . . . . . . . . . . 4. Wzorzec kontroli . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . A. Powołanie jako wzorca art. 2 Konstytucji . . . . . . . . . . . . . . . . . . . . B. Powołanie jako wzorca art. 31 ust. 3 Konstytucji . . . . . . . . . . . . . . C. Powołanie jako wzorca art. 32 Konstytucji . . . . . . . . . . . . . . . . . . . D. Powołanie jako wzorca przepisu umowy mi(cid:266)dzynarodowej . . . . . E. Powołanie jako wzorca innych przepisów . . . . . . . . . . . . . . . . . . . . 5. Przesłanka „ostatecznego orzeczenia” . . . . . . . . . . . . . . . . . . . . . . . . . 6. Skutki uwzgl(cid:266)dnienia skargi . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 7. Wył(cid:261)czenie skutków odroczenia wej(cid:286)cia w (cid:298)ycie wyroku TK wobec autora skargi . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8. Przymus fachowego sporz(cid:261)dzenia skargi . . . . . . . . . . . . . . . . . . . . . . 9. Termin do wniesienia skargi . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 80 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 81 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Obowi(cid:261)zki . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 83 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 84 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 85 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział III. (cid:295)RÓDŁA PRAWA . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 87 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Charakterystyka systemu (cid:296)ródeł prawa powszechnie obowi(cid:261)zuj(cid:261)cego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Poj(cid:266)cie aktu normatywnego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XII 439 440 440 443 451 453 455 460 460 463 467 472 473 473 473 474 476 477 478 479 479 482 489 490 493 494 494 495 496 496 497 501 503 503 504 511 514 Artykuł 88 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 90 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Zakres przekazania kompetencji organizacji mi(cid:266)dzynarodowej w kontek(cid:286)cie akcesji do Unii Europejskiej . . . . . . . . . . . . . . . . . . . . . 3. Tryb wyra(cid:298)enia zgody na ratyfikacj(cid:266) umowy mi(cid:266)dzynarodowej przekazuj(cid:261)cej kompetencje organów władzy pa(cid:276)stwowej w niektórych sprawach . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 91 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Zasada wykładni przyjaznej integracji europejskiej . . . . . . . . . . . . . . 2. Prawo europejskie a polski system prawny . . . . . . . . . . . . . . . . . . . . . 3. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 92 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Rozporz(cid:261)dzenie jako akt wykonawczy . . . . . . . . . . . . . . . . . . . . . . . . 2. Rozdzielenie tre(cid:286)ci mi(cid:266)dzy rozporz(cid:261)dzenie a ustaw(cid:266) . . . . . . . . . . . . . 3. Szczegółowo(cid:286)ć ustawowego upowa(cid:298)nienia do wydania rozporz(cid:261)dzenia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . A. Szczegółowo(cid:286)ć podmiotowa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . B. Szczegółowo(cid:286)ć przedmiotowa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . C. Szczegółowo(cid:286)ć tre(cid:286)ciowa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Zakaz subdelegacji . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5. Tryb wydania rozporz(cid:261)dzenia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6. Upowa(cid:298)nienie ustawowe a wej(cid:286)cie w (cid:298)ycie Konstytucji z 1997 r. . . . 7. Wpływ uchylenia upowa(cid:298)nienia ustawowego na obowi(cid:261)zywanie rozporz(cid:261)dzenia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8. Rozporz(cid:261)dzenie a konsekwencje przyst(cid:261)pienia Polski do UE . . . . . . . 9. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 93 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Otwarty system (cid:296)ródeł prawa wewn(cid:266)trznego . . . . . . . . . . . . . . . . . . . 3. Rozumienie „podległo(cid:286)ci” w kontek(cid:286)cie aktów prawa wewn(cid:266)trznego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 94 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział IV. SEJM I SENAT . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 95 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Nierównorz(cid:266)dno(cid:286)ć izb parlamentu w realizacji funkcji Spis tre(cid:286)ci 515 516 517 518 522 525 526 528 532 533 533 535 537 537 538 539 542 543 545 547 550 550 551 551 553 555 559 559 564 564 ustawodawczej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 564 2. Funkcja ustawodawcza parlamentu po wej(cid:286)ciu Polski do Unii Europejskiej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 566 XIII Spis tre(cid:286)ci 3. Funkcja kontrolna Sejmu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Wybory i kadencja . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 96 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 98 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 99 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 100 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 101 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 103 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Posłowie i senatorowie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 104 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 105 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 106 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 107 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Organizacja i działanie. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 110 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 111 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 112 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 118 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Inicjatywa ustawodawcza . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Obowi(cid:261)zek przedstawienia skutków finansowych ustawy wnoszonej do Sejmu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Udział innych podmiotów w procesie ustawodawczym . . . . . . . . . . . Artykuł 119 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Zasada trzech czyta(cid:276) ustawy w Sejmie . . . . . . . . . . . . . . . . . . . . . . . . 3. Wnoszenie poprawek do projektu ustawy . . . . . . . . . . . . . . . . . . . . . . Artykuł 120 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 121 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Wnoszenie przez Senat poprawek do ustawy uchwalonej przez Sejm Artykuł 122 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 123 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 124 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Referendum . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 125 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział V. PREZYDENT RZECZYPOSPOLITEJ POLSKIEJ . . . . . Artykuł 126 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 127 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 133 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 134 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XIV 568 570 570 574 576 577 577 578 581 581 583 590 591 593 593 595 601 605 605 608 608 613 614 615 616 622 622 623 623 631 640 644 644 644 646 646 648 649 652 Artykuł 139 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 144 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 145 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział VI. RADA MINISTRÓW I ADMINISTRACJA RZ(cid:260)DOWA Artykuł 146 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 148 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 152 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 153 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 156 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział VII. SAMORZ(cid:260)D TERYTORIALNY . . . . . . . . . . . . . . . . . . . Artykuł 163 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 164 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 165 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 166 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 167 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 168 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 169 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Organy stanowi(cid:261)ce i wykonawcze j.s.t. (art. 169 ust. 1) . . . . . . . . . . . 2. Wybory do organów stanowi(cid:261)cych j.s.t. (art. 169 ust. 2 i 3) . . . . . . . . 3. Ustrój wewn(cid:266)trzny j.s.t. (art. 169 ust. 4) . . . . . . . . . . . . . . . . . . . . . . . Artykuł 170 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 171 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 172 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział VIII. S(cid:260)DY I TRYBUNAŁY . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 173 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 174 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . S(cid:261)dy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 175 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 176 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 177 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 178 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Bezstronno(cid:286)ć i niezawisło(cid:286)ć s(cid:266)dziowska; niezale(cid:298)no(cid:286)ć s(cid:261)downictwa 2. Godno(cid:286)ć s(cid:266)dziowska, system wynagrodze(cid:276) s(cid:266)dziowskich . . . . . . . . . Artykuł 179 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 180 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 181 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 183 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 184 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 186 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 187 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Spis tre(cid:286)ci 653 653 655 657 657 662 663 664 666 668 668 669 671 675 678 681 683 683 684 690 690 694 698 699 699 702 703 703 705 710 711 711 719 724 727 731 733 734 737 740 XV Spis tre(cid:286)ci Trybunał Konstytucyjny . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 188 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Zakres kompetencji TK – uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . 2. „Akt normatywny” jako przedmiot kontroli TK . . . . . . . . . . . . . . . . . A. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . B. Uchwała Sejmu jako przedmiot kontroli TK . . . . . . . . . . . . . . . . . . 3. Kontrola konstytucyjno(cid:286)ci umów mi(cid:266)dzynarodowych . . . . . . . . . . . . 4. Kontrola konstytucyjno(cid:286)ci celów lub działalno(cid:286)ci partii politycznych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5. Kontrola konstytucyjno(cid:286)ci zaniecha(cid:276) prawodawczych . . . . . . . . . . . . 6. Kontrola konstytucyjno(cid:286)ci aktów prawa miejscowego . . . . . . . . . . . . 7. Kontrola konstytucyjno(cid:286)ci trybu uchwalenia ustawy . . . . . . . . . . . . . 8. Zakres kompetencji TK a członkostwo Polski w Unii Europejskiej . . 9. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 189 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 190 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Wyroki interpretacyjne i zakresowe . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Ne bis in idem i res iudicata w post(cid:266)powaniu przed TK . . . . . . . . . . . 3. Odroczenie utraty mocy obowi(cid:261)zuj(cid:261)cej niekonstytucyjnego przepisu 4. Prawo do „wznowienia post(cid:266)powania” po wyroku TK . . . . . . . . . . . . 5. Rozstrzyganie przez TK o skutkach swojego orzeczenia . . . . . . . . . . 6. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 191 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Legitymacja szczególna . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . A. Krajowa Rada S(cid:261)downictwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . B. Organy stanowi(cid:261)ce jednostek samorz(cid:261)du terytorialnego . . . . . . . . C. Zwi(cid:261)zki zawodowe, organizacje pracodawców, organizacje zawodowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . D. Ko(cid:286)cioły i inne zwi(cid:261)zki wyznaniowe . . . . . . . . . . . . . . . . . . . . . . . Artykuł 192 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 193 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 194 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 195 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 197 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Wznowienie post(cid:266)powania przed TK . . . . . . . . . . . . . . . . . . . . . . . . . 2. Wył(cid:261)czenie s(cid:266)dziego TK . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Interwencja uboczna w post(cid:266)powaniu przed TK . . . . . . . . . . . . . . . . . 4. Zabezpieczenie roszczenia w post(cid:266)powaniu przed TK . . . . . . . . . . . . 5. Postanowienie tymczasowe w post(cid:266)powaniu przed TK . . . . . . . . . . . XVI 743 743 744 751 751 753 754 755 758 760 761 761 765 770 772 773 776 778 785 790 797 803 803 804 805 806 808 809 810 810 819 820 820 820 821 823 824 824 6. Dopuszczalno(cid:286)ć modyfikacji przez Rzecznika Praw Obywatelskich zarzutów skargi konstytucyjnej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Trybunał Stanu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 198 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 199 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 200 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 201 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Poj(cid:266)cie deliktu konstytucyjnego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Odpowiedzialno(cid:286)ć Prezydenta i członków Rady Ministrów przed Trybunałem Stanu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Pozycja Trybunału Stanu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Kadencyjno(cid:286)ć Trybunału Stanu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział IX. ORGANY KONTROLI PA(cid:275)STWOWEJ I OCHRONY PRAWA . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Najwy(cid:298)sza Izba Kontroli . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 202 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 203 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 204 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 205 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 206 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 207 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Zrzeszanie si(cid:266) pracowników NIK . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rzecznik Praw Obywatelskich . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 208 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 209 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 210 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 211 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 212 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Krajowa Rada Radiofonii i Telewizji. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 213 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 214 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 215 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Pozycja i uprawnienia Krajowej Rady Radiofonii i Telewizji . . . . . . . 2. Skład Krajowej Rady Radiofonii i Telewizji . . . . . . . . . . . . . . . . . . . . 3. Inne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział X. FINANSE PUBLICZNE . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 216 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 217 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Spis tre(cid:286)ci 825 828 828 828 828 829 829 830 832 834 834 834 834 834 835 835 835 835 836 838 839 840 840 840 840 840 840 844 844 844 844 844 848 853 853 853 854 XVII Spis tre(cid:286)ci Artykuł 218 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 219 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 220 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 221 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 225 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 227 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział XI. STANY NADZWYCZAJNE . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 228 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 232 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 233 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 234 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział XII. ZMIANA KONSTYTUCJI . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 235 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział XIII. PRZEPISY PRZEJ(cid:285)CIOWE I KO(cid:275)COWE . . . . . . . . . Artykuł 236 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 237 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 239 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 241 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Artykuł 243 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Wykaz cytowanych orzecze(cid:276) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 860 860 866 866 867 867 874 874 876 877 878 878 878 880 880 882 883 884 889 893 XVIII Przedmowa do drugiego wydania Oddajemy do r(cid:261)k Czytelników drugie wydanie zbioru orzecznictwa, w którym organy władzy s(cid:261)downiczej ustalały tre(cid:286)ć przepisów Konstytucji RP z 2.4.1997 r. Pierwsze wy- danie, które ukazało si(cid:266) w 2008 r., obejmowało stan prawny i orzecznictwo na koniec roku 2006. Obecne wydanie – poza zmianami, uzupełnieniami i poprawkami dotychczasowego – rozszerza zbiór o wypowiedzi z orzecze(cid:276) zapadłych do ko(cid:276)ca 2010 r. Od tamtej pory Konstytucja została po raz kolejny znowelizowana1. Ponadto w praktyce władzy s(cid:263)downiczej pojawiło si(cid:277) wiele nowych i nieznanych wcze(cid:331)niej problemów, które wymagały rozstrzygni(cid:277)cia na podstawie ustawy zasadniczej. Wymusiło to na organach stosuj(cid:263)cych Konstytucj(cid:277) podj(cid:277)cie próby wywiedzenia z jej przepisów nowych tre(cid:331)ci, które nie były znane dotychczasowemu orzecznictwu, a niekiedy równie(cid:359) pi(cid:331)miennictwu. Nato- miast wcze(cid:331)niejsze tezy wynikaj(cid:263)ce z rozstrzygni(cid:277)ć s(cid:263)dów czy Trybunału Konstytucyjnego nie straciły na swojej aktualno(cid:331)ci. Prace nad nowym wydaniem wymagały przede wszystkim uzupełnienia zbioru o nowe tezy orzecznicze. W drugim wydaniu znalazły si(cid:277) ponadto wypowiedzi dotycz(cid:263)ce przepisów Konstytucji, które przed pi(cid:277)cioma laty nie miały swojego s(cid:263)dowego zastosowania. Zakres prac zmieniaj(cid:263)cych pierwotny kształt zbioru zrodził konieczno(cid:331)ć dokonania pewnych niezb(cid:277)dnych skrótów. W celu zachowania przejrzysto(cid:331)ci i spójno(cid:331)ci tekstu, a tak(cid:359)e dotychczasowej formuły opracowania nowe pogl(cid:263)dy orzecznicze nie zostały wyodr(cid:277)bnione w osobnym fragmencie ksi(cid:263)(cid:359)ki, lecz s(cid:263) wkomponowane w dotychczasow(cid:263) tre(cid:331)ć. Jednocze(cid:331)nie zachowano poprzedni(cid:263) numeracj(cid:277) tez i podrozdziałów. Nowe tezy oraz podrozdziały zostały natomiast wyró(cid:359)nione za pomoc(cid:263) kolejnych liter alfabetu, co powinno ułatwić Czytelnikowi zlokalizowanie elementów dodanych. Uzupełniony został równie(cid:359) wykaz, który jest zamieszczony na ko(cid:312)cu opracowania. Zdecydowali(cid:331)my si(cid:277) na dokonanie pewnych skrótów w porównaniu do pierwszego wydania. Zasadniczemu ograniczeniu uległy tezy dotycz(cid:263)ce rozdziału XIII Konstytucji, zatytułowanego „Przepisy przej(cid:331)ciowe i ko(cid:312)cowe”. Wynikało to z zało(cid:359)enia, i(cid:359) po 14 latach od wej(cid:331)cia w (cid:359)ycie Konstytucji problemy, których dotycz(cid:263) regulacje zawarte w wy- mienionym rozdziale, co do zasady nie pojawiaj(cid:263) si(cid:277) ju(cid:359) w praktyce. Usuni(cid:277)to równie(cid:359) opracowanie odnosz(cid:263)ce si(cid:277) do organizacji i kompetencji s(cid:263)dów konstytucyjnych innych pa(cid:312)stw europejskich. Na koniec pragniemy podzi(cid:277)kować Pani mgr Adzie Paprockiej oraz Panu dr. Piotrowi Bogdanowiczowi za pomoc w przygotowaniu drugiego wydania ksi(cid:263)(cid:359)ki. 1 Artykuł 1 ustawy z 7.5.2009 r. o zmianie Konstytucji Rzeczypospolitej Polskiej (Dz.U. Nr 114, poz. 946) dodano do art. 99 Konstytucji kolejny, trzeci ust(cid:266)p. Zmiana ta weszła w (cid:298)ycie 21.10.2009 r. XIX
Pobierz darmowy fragment (pdf)

Gdzie kupić całą publikację:

Konstytucja III RP w tezach orzeczniczych Trybunału Konstytucyjnego i wybranych sądów
Autor:

Opinie na temat publikacji:


Inne popularne pozycje z tej kategorii:


Czytaj również:


Prowadzisz stronę lub blog? Wstaw link do fragmentu tej książki i współpracuj z Cyfroteką: