Cyfroteka.pl

klikaj i czytaj online

Cyfro
Czytomierz
00338 010939 7475438 na godz. na dobę w sumie
Metodologia pracy w SPP - ebook/pdf
Metodologia pracy w SPP - ebook/pdf
Autor: Liczba stron: 761
Wydawca: C. H. Beck Język publikacji: polski
ISBN: 978-83-255-1111-1 Data wydania:
Lektor:
Kategoria: ebooki >> prawo i podatki
Porównaj ceny (książka, ebook, audiobook).

W Państwa rękach znajduje się kolejne opracowanie w serii Biblioteka Studenckich Poradni Prawnych Wydawnictwa C.H. Beck. Tym razem w jednej publikacji zebrane zostały doświadczenia poradni prawnych działających w całej Polsce.

Redakcji pięciu odrębnych części podjęli się opiekunowie poradni prawnych z różnych ośrodków akademickich w Polsce. Część Prawo Cywilne powstała pod redakcją dr Marleny Pecyny z Wydziału Prawa i Administracji Uniwersytetu Jagiellońskiego i obejmuje zagadnienia dotyczące m.in. zmiany płci, darowizny, zadośćuczynienia za gwałt, mediacji w sprawach cywilnych czy kosztów sądowych w sprawach cywilnych w świetle działalności SPP. Część Prawo Karne – pod redakcją dr Barbary Namysłowskiej-Gabrysiak z Uniwersytetu Warszawskiego podejmuje m.in. problematykę przemocy w rodzinie, zatrzymania przez funkcjonariusza policji, wypadku drogowego, posiadania konopi czy przewlekłości postępowania karnego. Część Prawo Pracy – pod redakcją dr. Krzysztofa Stefańskiego z Uniwersytetu Łódzkiego, zawiera opracowania m.in. z zakresu prawa do otrzymania akcji pracowniczych, odpowiedzialności materialnej pracowników, statusu osoby bezrobotnej czy sytuacji prawnej dyrektora generalnego urzędu. W części Prawo Administracyjne – pod redakcją dr. Roberta Suwaja z Wyższej Szkoły Administracji Publicznej w Białymstoku, znajdują się teksty opisujące m.in. becikowe, ugodę administracyjną, uciążliwe sąsiedztwo, dług celny przy mieniu przesiedleńczym oraz administracyjno-prawne aspekty transseksualizmu.

Część piąta, pod wspólnym hasłem „Varia”, powstała pod moją redakcją i stanowi kompilację wybranych zagadnień z innych dziedzin, takich jak prawa człowieka (w tym status uchodźcy), prawa autorskie, prawo rodzinne, podatkowe czy prawo UE.

Każda część podzielona jest na trzy rozdziały. W pierwszym scharakteryzowana została metodologia pracy ze studentami w każdej z sekcji, odpowiadająca potrzebom i specyfice poszczególnych działów prawa. Na rozdział drugi składają się analizy wybranych, najciekawszych spraw jakie rzeczywiście trafiły do studenckich poradni prawnych i z jakimi zmierzyć się musieli studenci pod czujnym okiem opiekunów. Artykuły stanowiące zawartość rozdziału trzeciego potwierdzają różnorodność problematyki prawnej, jaka jest przedmiotem udzielanych porad prawnych.

Publikacja ta jest kolejnym dowodem na szerokie spektrum prawne działalności studenckich poradni prawnych w Polsce oraz na różnorodność i nierzadko wysoki stopień skomplikowania problemów jakie próbują rozwiązać przyszli prawnicy. Mam nadzieję, że lektura okaże się przydatna tak dla prawidłowego funkcjonowania poradni, jak i w ramach wymiany doświadczeń pomiędzy zaprzyjaźnionymi sekcjami.

Warszawa, 1.10.2009 r. dr Izabela Kraśnicka

Znajdź podobne książki

Darmowy fragment publikacji:

(cid:275)(cid:295) (cid:295) (cid:275) (cid:307) ł (cid:295) (cid:275) (cid:270) (cid:285) (cid:270) (cid:270) (cid:275) (cid:275) ł (cid:295) (cid:285) (cid:307) (cid:270) (cid:295)(cid:260) (cid:270) (cid:260) (cid:270) (cid:295) (cid:275) (cid:307) Studencka Poradnia Prawna Metodologia pracy w SPP (cid:295) (cid:270) (cid:270) (cid:275) (cid:270) (cid:270) Pod redakcj(cid:270) Izabeli Kra(cid:295)nickiej Wydawnictwo C. H. BECK METODOLOGIA PRACY W SPP Polecamy nasze publikacje z serii: Testy Aplikacyjne autorstwa Mariusza Stepaniuka PRAWO SPÓŁDZIELCZE I MIESZKANIOWE. TESTY, PYTANIA I ODPOWIEDZI. Tom 14 PRAWO OCHRONY KONSUMENTA. Tom 13 PRAWO MIĘDZYNARODOWE PUBLICZNE I PRYWATNE ORAZ PRAWO WSPÓLNOTOWE. TESTY, PYTANIA I ODPOWIEDZI. Tom 12 PRAWO FINANSOWE — CZEŚĆ II. TESTY, PYTANIA I ODPOWIEDZI. Tom 11 PRAWO FINANSOWE — CZĘŚĆ I. TESTY, PYTANIA I ODPOWIEDZI. KONSTYTUCYJNE. Tom 10 PRAWO PRACY I UBEZPIECZEŃ SPOŁECZNYCH. Tom 9 PRAWO ADMINISTRACYJNE USTROJOWE. Tom 8 PRAWO ADMINISTRACYJNE MATERIALNE. TESTY, PYTANIA I ODPOWIEDZI. Tom 7 PRAWO KARNE (MATERIALNE, PROCESOWE) I INNE. Tom 6 PRAWO SPÓŁEK HANDLOWYCH I PRAWO GOSPODARCZE PUBLICZNE. Tom 5 PRAWO KONSTYTUCYJNE. Tom 4 POSTĘPOWANIE CYWILNE. Tom 3 PRAWO RODZINNE I RZECZOWE. TESTY, PYTANIA I ODPOWIEDZI. Tom 2 PRAWO CYWILNE. TESTY, PYTANIA I ODPOWIEDZI. Tom 1 www.sklep.beck.pl Studencka Poradnia Prawna Metodologia pracy w SPP Pod redakcją Izabeli Kraśnickiej Metodologia pracy w SPP Redakcja: Agnieszka Fiutak Okładka: Robert Rogiński © Wydawnictwo C. H. Beck 2009 Wydawnictwo C. H. Beck, Sp. z o.o. ul. Bonifraterska 17, 00-203 Warszawa Skład i łamanie: Wydawnictwo C. H. Beck Druk i oprawa: Elpil, Siedlce ISBN 978-83-255-1111-1 SpiS tre(cid:285)ci Spis autorów .............................................................................................................. XXI Wykaz skrótów .......................................................................................................... XXV Wykaz podstawowej literatury .................................................................................. XXXIII Wst(cid:266)p ........................................................................................................................ XXXVII cz(cid:266)(cid:286)ć i. prawo cywilne rozdział i. Metodologia pracy w sekcji prawa cywilnego ................................... 1. Metodologia pracy w sekcji prawa cywilnego .................................................... 2. Podsumowanie .................................................................................................... rozdział ii. Kazusy ................................................................................................. A. Post(cid:266)powanie o ustalenie płci ............................................................................. 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ B. Odwołanie darowizny ......................................................................................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. a. Ochrona posesoryjna .................................................................................. b. Prawo pierwokupu ..................................................................................... c. Odwołanie darowizny ................................................................................ d. Polubowne rozwi(cid:261)zanie sporu .................................................................... 3. Działanie Poradni ............................................................................................ C. Uregulowanie prawa do mieszkania ................................................................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. a. Umowa darowizny ..................................................................................... b. Rozrz(cid:261)dzenie testamentowe ....................................................................... c. Ustanowienie słu(cid:298)ebno(cid:286)ci .......................................................................... 3. Działanie Poradni ............................................................................................ D. Testament ustny ................................................................................................... 3 3 5 7 7 7 8 11 11 11 12 12 13 15 18 18 20 20 21 21 22 25 26 27 VI Spis tre(cid:286)ci 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. a. Kto i kiedy mo(cid:298)e zło(cid:298)yć wniosek o stwierdzenie nabycia spadku i jakie winien przedło(cid:298)yć dokumenty? .................................................................. b. Czy w danym przypadku została spełniona przesłanka obawy rychłej (cid:286)mierci? ...................................................................................................... c. Czy dwa listy prywatne mog(cid:261) pełnić rol(cid:266) pisma stwierdzaj(cid:261)cego tre(cid:286)ć testamentu ustnego? .................................................................................. d. Czy osoby b(cid:266)d(cid:261)ce (cid:286)wiadkami udzielania sakramentu namaszczenia chorych mog(cid:261) być uznane za (cid:286)wiadków testamentu? ................................ 3. Działanie Poradni ............................................................................................ E. Zado(cid:286)ćuczynienie za zgwałcenie ........................................................................ 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ F. Odszkodowanie za eksperyment medyczny ........................................................ 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. a. Ogólne zasady przeprowadzania eksperymentu medycznego ................... b. Przesłanki odpowiedzialno(cid:286)ci odszkodowawczej za eksperyment medyczny ................................................................................................... 3. Działanie Poradni ............................................................................................ rozdział iii. Artykuły ............................................................................................. A. Odst(cid:261)pienie od umowy sprzeda(cid:298)y konsumenckiej .............................................. 1. Wst(cid:266)p .............................................................................................................. 2. Przesłanki odst(cid:261)pienia od umowy .................................................................. a. Niemo(cid:298)liwo(cid:286)ć wymiany albo naprawy ...................................................... b. Nadmierne koszty ....................................................................................... c. Niewymienienie albo nienaprawienie towaru w odpowiednim czasie ...... d. Znaczne niedogodno(cid:286)ci .............................................................................. e. Istotno(cid:286)ć niezgodno(cid:286)ci z umow(cid:261) ............................................................... 3. Termin odst(cid:261)pienia od umowy ....................................................................... 4. Skutki odst(cid:261)pienia od umowy ........................................................................ 5. Wnioski ko(cid:276)cowe ........................................................................................... B. Zaspokajanie potrzeb mieszkaniowych mał(cid:298)onków przez spółdzielni(cid:266) mieszkaniow(cid:261) ...................................................................................................... 1. Wst(cid:266)p .............................................................................................................. 2. Zaspokajanie potrzeb mieszkaniowych mał(cid:298)onków przez spółdzielni(cid:266) mieszkaniow(cid:261) pod rz(cid:261)dem PrSpółdz .............................................................. 3. Wspólno(cid:286)ć spółdzielczego lokatorskiego prawa do lokalu powstałego pod rz(cid:261)dem PrSpółdz i trwaj(cid:261)cego po wej(cid:286)ciu w (cid:298)ycie SpółMieszkU .......... 27 28 28 29 31 32 32 34 34 34 37 41 41 42 42 50 56 59 59 59 61 61 62 63 64 65 66 67 70 71 71 72 74 Spis tre(cid:286)ci 4. Zaspokajanie potrzeb mieszkaniowych mał(cid:298)onków przez spółdzielni(cid:266) mieszkaniow(cid:261) według SpółMieszkU .............................................................. C. „Przekształcenie” spółdzielczego prawa do lokalu w odr(cid:266)bn(cid:261) własno(cid:286)ć .............. 1. Geneza uprawnienia do (cid:298)(cid:261)dania „przekształcenia” spółdzielczego prawa do lokalu w odr(cid:266)bn(cid:261) własno(cid:286)ć ....................................................................... 2. Zakres podmiotowy uprawnienia ................................................................... 3. Charakter uprawnienia .................................................................................... 4. Przesłanki uprawnienia ................................................................................... 5. Okre(cid:286)lenie przedmiotu odr(cid:266)bnej własno(cid:286)ci .................................................... 6. Przymusowa realizacja roszczenia ................................................................. 7. Podsumowanie ................................................................................................ D. Skutki likwidacji spółdzielni mieszkaniowej ...................................................... 1. Uwagi ogólne .................................................................................................. 2. Skutki likwidacji spółdzielni mieszkaniowej w przypadku spółdzielczego VII 76 85 85 87 92 95 96 99 102 103 103 lokatorskiego prawa do lokalu ....................................................................... 104 3. Skutki likwidacji spółdzielni mieszkaniowej w przypadku spółdzielczego własno(cid:286)ciowego prawa do lokalu ................................................................... 4. Roszczenia maj(cid:261)tkowe przysługuj(cid:261)ce w zwi(cid:261)zku z likwidacj(cid:261) spółdzielni mieszkaniowej ................................................................................................ 5. Skutki likwidacji dla spółdzielni jako podmiotu prawa ................................. 6. Zako(cid:276)czenie .................................................................................................... E. Pozycja wierzycieli po wadliwej likwidacji spółki z o.o. ..................................... 1. Przedstawienie problemu ................................................................................ 2. Istota i przebieg procesu likwidacji ................................................................ 3. Likwidator i jego rola w procesie likwidacji ................................................. 4. Ochrona praw wierzycieli spółki z o.o. w likwidacji ..................................... a. Ogłoszenie o likwidacji i wezwanie wierzycieli ....................................... b. Zabezpieczenie wierzytelno(cid:286)ci przez zło(cid:298)enie zabezpieczenia do depozytu ..................................................................................................... c. Wypłata na rzecz wspólników przed pełnym zaspokojeniem wierzycieli . d. Wniosek o zmian(cid:266) likwidatora .................................................................. e. Odpowiedzialno(cid:286)ć członków zarz(cid:261)du z art. 299 KSH .............................. 5. Pozycja wierzycieli spółki wykre(cid:286)lonej z KRS .............................................. a. Prawo wgl(cid:261)du w dokumenty zlikwidowanej spółki .................................. b. Odpowiedzialno(cid:286)ć likwidatorów za naruszenie art. 279 KSH .................. c. Odpowiedzialno(cid:286)ć likwidatora za zaniechanie zabezpieczenia depozytowego ............................................................................................. d. Podział kwoty likwidacyjnej przed upływem terminu z art. 286 KSH ....... e. Odpowiedzialno(cid:286)ć członków zarz(cid:261)du z art. 299 KSH .............................. f. Odpowiedzialno(cid:286)ć likwidatora z art. 299 KSH ......................................... 6. Podsumowanie ................................................................................................ 110 114 116 117 117 117 118 120 121 121 123 124 125 126 127 127 128 128 129 129 130 132 VIII Spis tre(cid:286)ci F. Mediacja w sprawach cywilnych – zarys problematyki ...................................... 1. Poj(cid:266)cie mediacji .............................................................................................. 2. Zakres przedmiotowy mediacji ....................................................................... 3. Mediator .......................................................................................................... 4. Wszcz(cid:266)cie post(cid:266)powania mediacyjnego ......................................................... 5. Przebieg post(cid:266)powania mediacyjnego ............................................................ 6. Koszty mediacji .............................................................................................. 7. Podsumowanie ................................................................................................ G. Koszty s(cid:261)dowe w sprawach cywilnych w (cid:286)wietle działalno(cid:286)ci poradni prawnych – zagadnienia wybrane ........................................................................................ 1. Wst(cid:266)p .............................................................................................................. 2. Poj(cid:266)cie i rodzaje kosztów s(cid:261)dowych .............................................................. 3. Zasady uiszczania kosztów s(cid:261)dowych ............................................................ 4. Zwolnienie od kosztów s(cid:261)dowych ................................................................. cz(cid:266)(cid:286)ć ii. prawo karne rozdział i. Metodologia pracy w sekcji prawa karnego ..................................... 1. Uwagi ogólne ................................................................................................... 2. Metodologia pracy w sekcji prawa karnego ................................................... 3. Przykładowe scenariusze zaj(cid:266)ć ....................................................................... rozdział ii. Kazusy .................................................................................................. A. Przemoc w rodzinie ............................................................................................. 1. Stan faktyczny ................................................................................................. 2. Ocena prawna ................................................................................................. a. Prawo karne ................................................................................................ b. Ochrona cywilnoprawna ............................................................................ c. Prawo administracyjne ............................................................................... 3. Działanie Poradni ............................................................................................ B. Zatrzymanie przez funkcjonariuszy policji .......................................................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ C. Penalizacja posiadania (cid:286)rodków odurzaj(cid:261)cych i substancji psychotropowych wobec czynno(cid:286)ci za(cid:298)ywania powy(cid:298)szych substancji, na gruncie NarkU ........... 1. Stan faktyczny ................................................................................................. 2. Ocena prawna ................................................................................................. a. Regulacja ustawowa ................................................................................... b. Stanowisko doktryny .................................................................................. c. Posiadanie a czynno(cid:286)ć za(cid:298)ywania narkotyku – sankcja prawno karna ...... d. Wykładnia j(cid:266)zykowa i funkcjonalna .......................................................... 133 133 134 136 139 141 144 145 146 146 147 149 151 155 155 157 167 187 187 187 188 188 197 201 203 203 203 204 207 208 208 209 209 209 210 211 Spis tre(cid:286)ci e. Czynno(cid:286)ci procesowe w przedmiotowej sprawie ...................................... f. Zasada okre(cid:286)lono(cid:286)ci wyroku skazuj(cid:261)cego ................................................. 3. Działanie Poradni ............................................................................................ D. Problematyka wypadku drogowego .................................................................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ E. Warunkowe zwolnienie w sytuacji zbiegu kar .................................................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ F. Problematyka przywłaszczenia oraz wznowienia post(cid:266)powania karnego .......... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ G. Wła(cid:286)ciwo(cid:286)ć rzeczowa s(cid:261)dów w post(cid:266)powaniu karnym ...................................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ H. Zastosowanie warunkowego zawieszenia wykonania kary lub warunkowego przedterminowego zwolnienia z odbywania kary wobec sprawcy przest(cid:266)pstwa popełnionego w warunkach recydywy wielokrotnej specjalnej .......................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ I. Mo(cid:298)liwe (cid:286)rodki prawne w post(cid:266)powaniu karnym po uprawomocnieniu si(cid:266) wyroku skazuj(cid:261)cego ............................................................................................ 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ J. Skazuj(cid:261)cy wyrok s(cid:261)du a cofni(cid:266)cie licencji na wykonywanie transportu drogowego taksówk(cid:261) ........................................................................................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ K. Problematyka kwaliikacji prawnej posiadania nasion konopi w Polsce ............ 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ L. Zakres odpowiedzialno(cid:286)ci gwaranta w prawie karnym ...................................... 1. Stan faktyczny ................................................................................................ IX 211 212 212 213 213 214 218 218 218 219 223 223 223 224 232 232 232 233 243 243 243 244 247 247 247 248 250 250 250 251 254 254 254 255 258 258 258 X Spis tre(cid:286)ci 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ Ł. Przesłanki warunkowego zwolnienia .................................................................. 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ M. Przewlekło(cid:286)ć post(cid:266)powania karnego w (cid:286)wietle prawa polskiego oraz EKPCz .. 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. a. Poj(cid:266)cie przewlekło(cid:286)ci post(cid:266)powania na gruncie prawa polskiego, EKPCz oraz praktyki ETPCz .................................................................................. b. Skarga do ETPCz ....................................................................................... c. Post(cid:266)powanie przygotowawcze ................................................................. d. Post(cid:266)powanie s(cid:261)dowe ................................................................................. e. Zasadno(cid:286)ć skargi pod wzgl(cid:266)dem merytorycznym ..................................... 3. Działanie Poradni ............................................................................................ Rozdział III. Artykuły ............................................................................................. A. Zmiana przepisów dotycz(cid:261)cych przedawnienia i warunkowego przedterminowego zwolnienia w (cid:286)wietle art. 4 § 1 KK ...................................... 1. Przedawnienie ................................................................................................. 2. Przedterminowe zwolnienie ............................................................................ 3. Wnioski ........................................................................................................... B. Terapia dla sprawców przemocy domowej ......................................................... 1. Przemoc .......................................................................................................... 2. Sprawca przemocy .......................................................................................... 3. Przyczyny przemocy ....................................................................................... 4. Skutki przemocy ............................................................................................. 5. Terapia dla sprawców przemocy ..................................................................... 6. Terminologia ................................................................................................... 7. Terapia jako element systemu przeciwdziałania przemocy ............................ 8. Rozwi(cid:261)zania problemu terapii – jako elementu przeciwdziałania przemocy – przyj(cid:266)te w innych pa(cid:276)stwach ......................................................................... a. Stany Zjednoczone ..................................................................................... b. Austria ........................................................................................................ c. Niemcy ....................................................................................................... d. Polska ......................................................................................................... C. Praktyczna rola instytucji przedstawiciela osoby skazanej w polskim post(cid:266)powaniu karnym wykonawczym ................................................................ 1. Wst(cid:266)p .............................................................................................................. 2. Istota instytucji przedstawiciela skazanego .................................................... 3. Instytucje i organizacje, które mog(cid:261) delegować przedstawiciela (art. 38 KKW) .. 259 261 261 261 264 265 266 266 266 266 270 272 273 279 286 287 287 289 293 297 298 299 301 301 303 305 305 307 309 309 310 310 312 316 316 317 318 Spis tre(cid:286)ci 4. Przedstawiciel społeczny czy mo(cid:298)e quasi-obro(cid:276)ca? ...................................... 5. Rola przedstawiciela w post(cid:266)powaniu ........................................................... 6. Klinika Prawa jako instytucja wskazana w art. 38 KKW ............................... 7. Procedura ustanowienia przedstawiciela – opis przypadku zaistniałego w praktyce klinicznej w 2005 r. ..................................................................... 8. Podsumowanie – przyszło(cid:286)ć instytucji przedstawiciela skazanego ................ D. Przepis art. 2 EKPCz ........................................................................................... 1. Uwagi ogólne .................................................................................................. 2. ETPCz – kontrola zobowi(cid:261)za(cid:276) wynikaj(cid:261)cych z EKPCz – zagadnienia proceduralne – dopuszczalno(cid:286)ć ...................................................................... 3. Prawa i wolno(cid:286)ci – dyskusyjny podział? Przegl(cid:261)d orzecznictwa dotycz(cid:261)cego prawa do (cid:298)ycia (art. 2 EKPCz) ....................................................................... 4. Ochrona (cid:298)ycia w Polsce – wyrok w sprawie Dzieciak przeciwko Polsce ...... cz(cid:266)(cid:286)ć iii. prawo pracy rozdział i. Metodologia .......................................................................................... A. Metodologia pracy kliniki prawa w sekcji prawa pracy ..................................... B. Symulacje procesów jako metoda praktycznego nauczania prawa w sekcji XI 319 320 321 322 324 325 325 326 328 330 337 337 prawa pracy ......................................................................................................... 339 rozdział ii. Kazusy ................................................................................................. A. Prawo do otrzymania akcji pracowniczych ......................................................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ B. Skutki zawarcia umowy o prac(cid:266) z nieistniej(cid:261)c(cid:261) spółk(cid:261) z o.o. ............................. 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ C. Likwidacja czy przej(cid:286)cie zakładu pracy na innego pracodawc(cid:266)? ....................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ rozdział iii. Artykuły ............................................................................................. A. Odpowiedzialno(cid:286)ć materialna pracowników na zasadach ogólnych (art. 114–122 KP) ................................................................................................ 1. Zagadnienia ogólne ......................................................................................... 2. Odpowiedzialno(cid:286)ć pracownika za szkod(cid:266) wyrz(cid:261)dzon(cid:261) nieumy(cid:286)lnie ............. 3. Odpowiedzialno(cid:286)ć pracownika za szkod(cid:266) wyrz(cid:261)dzon(cid:261) umy(cid:286)lnie .................. 4. Odpowiedzialno(cid:286)ć za szkod(cid:266) wyrz(cid:261)dzon(cid:261) przez pracownika osobie trzeciej .. 347 347 347 348 352 352 352 354 363 364 364 364 368 369 369 369 371 372 373 XII Spis tre(cid:286)ci 5. Wyrz(cid:261)dzenie szkody przez kilku pracowników ............................................. 6. Ugodowe naprawienie szkody ........................................................................ 7. Przedawnienie ................................................................................................. B. Poj(cid:266)cie osoby bezrobotnej w (cid:286)wietle przepisów o zatrudnieniu i bezrobociu ..... C. Kontrowersyjna wspólno(cid:286)ć mał(cid:298)e(cid:276)ska a prawo do renty rodzinnej ................... 1. Wst(cid:266)p .............................................................................................................. 2. Główne nurty orzecznictwa ............................................................................ 3. Konsekwencje wprowadzenia separacji do KRO ........................................... 4. Sytuacje, w których istnieje interes prawny w ustaleniu prawa do alimentów w trakcie trwania mał(cid:298)e(cid:276)stwa ......................................................................... 5. Próba zdeiniowania wspólno(cid:286)ci mał(cid:298)e(cid:276)skiej ................................................ 6. Omówienie uchwały SN z 26.10.2006 r., III UZP 3/06 .................................. D. Zakaz dyskryminacji w zatrudnieniu cudzoziemców spoza UE – wybrane zagadnienia .......................................................................................................... 1. Uwagi wst(cid:266)pne ................................................................................................ 2. Zakaz dyskryminacji w prawie mi(cid:266)dzynarodowym i europejskim ................ 3. Zasada niedyskryminacji w KP ...................................................................... 4. Zakaz dyskryminacji w zakresie zawarcia stosunku pracy ............................ 5. Zakaz dyskryminacji w zakresie rozwi(cid:261)zania stosunku pracy ....................... E. Bezrobocie a nielegalne zatrudnienie w (cid:286)wietle polskiego prawa pracy i nauczania Jana Pawła II ................................................................................... 1. Prawo do pracy w nauczaniu Jana Pawła II .................................................. 2. Prawo do pracy a bezrobocie .......................................................................... 3. Nielegalne zatrudnienie a godno(cid:286)ć pracy ....................................................... 4. Uwagi ko(cid:276)cowe .............................................................................................. F. Atypowo(cid:286)ć stosunku pracy członków zarz(cid:261)du spółek kapitałowych – wybrane problemy prawne ................................................................................................. 1. Uwagi wprowadzaj(cid:261)ce .................................................................................... 2. Specyika stosunku pracy członków zarz(cid:261)du spółek kapitałowych ............... 3. Uwagi ko(cid:276)cowe .............................................................................................. G. Wolno(cid:286)ć zrzeszania si(cid:266) w zwi(cid:261)zkach zawodowych osób bezrobotnych ............. 1. Uwagi wst(cid:266)pne ................................................................................................ 2. Wolno(cid:286)ć zrzeszania si(cid:266) osób bezrobotnych według ustawodawstwa polskiego .. 3. Konstytucyjna regulacja wolno(cid:286)ci zrzeszania si(cid:266) ........................................... 4. Wolno(cid:286)ć zrzeszania si(cid:266) w (cid:286)wietle przepisów aktów mi(cid:266)dzynarodowych i wspólnotowych ............................................................................................. 5. Uchwała SN z 10.1.1992 r. ............................................................................. 6. Uwagi ko(cid:276)cowe .............................................................................................. H. Sytuacja prawna dyrektora generalnego urz(cid:266)du .................................................. 1. Uwagi wst(cid:266)pne ................................................................................................ 2. Zadania dyrektora generalnego urz(cid:266)du ........................................................... 374 376 376 377 387 387 388 390 391 392 393 396 396 397 398 400 403 405 405 406 408 411 412 412 413 423 424 424 424 430 430 433 434 434 434 435 Spis tre(cid:286)ci 3. Podporz(cid:261)dkowanie dyrektora generalnego urz(cid:266)du ......................................... 4. Obsadzanie stanowiska dyrektora generalnego urz(cid:266)du .................................. 5. Zmiana tre(cid:286)ci stosunku pracy dyrektora generalnego urz(cid:266)du ......................... 6. Ustanie stosunku pracy dyrektora generalnego urz(cid:266)du .................................. 7. Uwagi ko(cid:276)cowe .............................................................................................. I. Uprawnienia pracownicze ojca wychowuj(cid:261)cego dziecko ................................... J. Ochrona roszcze(cid:276) pracowniczych w razie niewypłacalno(cid:286)ci pracodawcy w (cid:286)wietle prawa polskiego i wspólnotowego – wybrane zagadnienia ................ Cz(cid:266)(cid:286)ć IV. Prawo administracyjne Rozdział I. Metodologia pracy SPP na przykładzie Centrum Informacji Administracyjnej ..................................................................................................... 1. Znaczenie zaj(cid:266)ć w ramach CIA ...................................................................... 2. Rola opiekunów .............................................................................................. 3. Formy pracy podczas spotka(cid:276) CIA ................................................................. 4. Warunki efektywno(cid:286)ci zaj(cid:266)ć CIA ................................................................... 5. Etapy przygotowania opinii ............................................................................ 6. Konstrukcja opinii .......................................................................................... 7. Kryteria oceny wewn(cid:266)trznej opinii ................................................................. Rozdział II. Kazusy ................................................................................................. A. „Becikowe” dla osoby przebywaj(cid:261)cej za granic(cid:261) ............................................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ B. Równowa(cid:298)nik pieni(cid:266)(cid:298)ny za brak lokalu mieszkalnego ....................................... 1. Stan faktyczny ................................................................................................. 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ C. Zwrot opłaty za kart(cid:266) pojazdu ............................................................................. 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. a. Poj(cid:266)cie karty pojazdu samochodowego ..................................................... b. Podstawa prawna pobierania opłaty za kart(cid:266) pojazdu samochodowego przez starost(cid:266) .............................................................................................. c. Czy przepis § 1 pkt 1 rozporz(cid:261)dzenia z 28.7.2003 r., mógł stanowić podstaw(cid:266) prawn(cid:261) do pobrania, w okresie poprzedzaj(cid:261)cym wydanie wyroku przez TK, opłaty za kart(cid:266) pojazdu w wysoko(cid:286)ci 500 zł? .............. d. Na jakiej drodze mo(cid:298)na kwestionować odmow(cid:266) zwrotu opłaty za kart(cid:266) pojazdu? ..................................................................................................... D. Naruszenie stosunków wodnych na gruntach s(cid:261)siednich .................................... XIII 436 438 439 440 441 441 450 471 471 472 472 473 474 477 477 479 479 479 479 483 483 483 484 485 486 487 487 487 488 488 489 490 XIV Spis tre(cid:286)ci 1. Stan faktyczny ................................................................................................. 2. Ocena prawna .................................................................................................. a. Podstawy normatywne przedmiotowego stanu faktycznego ..................... b. Wła(cid:286)ciwo(cid:286)ć rzeczowa organu administracji publicznej z zakresu zmiany stanu wód na s(cid:261)siednich gruntach .............................................................. c. Przekazanie sprawy pana Jana Kowalskiego Powiatowemu Inspektorowi Nadzoru Budowlanemu w Czelu(cid:286)ciach ..................................................... 3. Podsumowanie ............................................................................................... E. Nienale(cid:298)nie pobrane (cid:286)wiadczenia rodzinne ........................................................ 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ F. Powstanie długu celnego przy „mieniu przesiedle(cid:276)czym” ................................. 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ G. Uci(cid:261)(cid:298)liwe s(cid:261)siedztwo .......................................................................................... 1. Stan faktyczny ................................................................................................ 2. Działania Poradni ............................................................................................ H. Sprzeda(cid:298) nieruchomo(cid:286)ci b(cid:266)d(cid:261)cych własno(cid:286)ci(cid:261) gminy w trybie bezprzetargowym z uwzgl(cid:266)dnieniem prawa pierwsze(cid:276)stwa ............................... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. a. Prawo pierwsze(cid:276)stwa w uj(cid:266)ciu normatywnym .......................................... b. Tryb zbywania nieruchomo(cid:286)ci na rzecz podmiotów korzystaj(cid:261)cych z prawa pierwsze(cid:276)stwa ............................................................................... I. Nabycie w drodze spadku (darowizny) spółdzielczego prawa własno(cid:286)ciowego do lokalu – ulgi oraz konsekwencje z tytułu niezapłacenia podatku w terminie 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. a. Podatnicy podatku od spadków i darowizn ................................................ b. Moment powstania obowi(cid:261)zku podatkowego ............................................ c. Sposób obliczania podatku od spadków i darowizn .................................. d. Organ podatkowy wła(cid:286)ciwy do pobrania podatku z tytułu obj(cid:266)cia spadku i darowizny ................................................................................................. e. Dokumenty, jakie nale(cid:298)y doł(cid:261)czyć do zeznania podatkowego podatku od spadków i darowizn ............................................................................... f. Ulgi w zapłacie podatku od spadków i darowizn ....................................... g. Przedawnienie zobowi(cid:261)zania podatkowego ............................................... h. Sposób obliczania odsetek od zobowi(cid:261)zania podatkowego z tytułu 490 491 491 491 492 492 493 493 493 499 500 500 501 503 504 504 507 513 514 514 514 516 517 517 518 518 518 519 521 521 522 523 podatku od spadków i darowizn ................................................................. 524 Spis tre(cid:286)ci i. Konsekwencje podatkowe z tytułu darowizny córce podatnika spółdzielczego własno(cid:286)ciowego prawa do lokalu wynikaj(cid:261)ce z faktu jej zameldowania w tym lokalu ....................................................................... rozdział iii. Artykuły ............................................................................................. A. Legalno(cid:286)ć a legalizm w realizacji zada(cid:276) w zakresie bezpiecze(cid:276)stwa ruchu drogowego ........................................................................................................... 1. Zasady ogólne jako element wykładni przepisów prawa administracyjnego ... 2. Szczególna rola zasady pa(cid:276)stwa prawnego .................................................... 3. Zasada ne bis in idem w post(cid:266)powaniu administracyjnym ............................. 4. Sfera prawnej legitymizacji władzy ................................................................ 5. Nowa sytuacja faktyczna wyzwaniem dla organów administracji publicznej ..... 6. Obowi(cid:261)zek podj(cid:266)cia działa(cid:276) przeciwdziałaj(cid:261)cych pogorszeniu warunków bezpiecze(cid:276)stwa drogowego ............................................................................ B. Zasada proporcjonalno(cid:286)ci a kara za usuni(cid:266)cie drzewa w (cid:286)wietle OchrPrzyrU ... C. Zasady ustalania wła(cid:286)ciwo(cid:286)ci organów podatkowych i egzekucyjnych w sprawach dotycz(cid:261)cych orzekania o odpowiedzialno(cid:286)ci osób trzecich, udzielania ulg podatkowych oraz dokonywania zabezpiecze(cid:276) na maj(cid:261)tku i prowadzenia egzekucji wobec tych podmiotów ............................................... 1. Uwagi ogólne .................................................................................................. 2. Organ wła(cid:286)ciwy do orzeczenia o odpowiedzialno(cid:286)ci osoby trzeciej .............. 3. Ustalenie organu wła(cid:286)ciwego do rozpatrzenia wniosku o udzielenie ulg w zapłacie nale(cid:298)no(cid:286)ci publicznoprawnej ........................................................ 4. Organ wła(cid:286)ciwy do dokonania zabezpieczenia wykonania obowi(cid:261)zku nało(cid:298)onego na osob(cid:266) trzeci(cid:261) ........................................................................... 5. Organ egzekucyjny wła(cid:286)ciwy do przeprowadzenia egzekucji wobec osoby trzeciej ............................................................................................................. 6. Wnioski ............................................................................................................ D. Uznanie w procedurze przyznawania pomocy społecznej – wybrane zagadnienia .......................................................................................................... 1. Uwagi ogólne .................................................................................................. 2. Uznanie w polskim prawie pomocy społecznej .............................................. 3. Zasada uznaniowo(cid:286)ci w pomocy społecznej w orzecznictwie NSA .............. 4. Uwagi ko(cid:276)cowe .............................................................................................. E. Wniosek o wydanie pisemnej interpretacji przepisów prawa ............................. 1. Wnioskodawca ................................................................................................ 2. Przedmiot interpretacji .................................................................................... 3. Wła(cid:286)ciwy organ .............................................................................................. 4. Tre(cid:286)ć wniosku o interpretacj(cid:266) i jego wniesienie ............................................. 5. Wydanie interpretacji ...................................................................................... F. Uwag kilka o administracyjno-prawnych aspektach transseksualizmu .............. G. Ugoda administracyjna jako forma działania administracji ................................ XV 525 527 527 528 529 530 531 532 534 535 540 540 543 545 547 549 550 550 550 553 556 558 559 560 561 562 564 566 567 573 XVI Spis tre(cid:286)ci H. Kiedy powstaje spór kompetencyjny mi(cid:266)dzy organami administracji publicznej? Przyczynek do dyskusji ....................................................................................... 580 cz(cid:266)(cid:286)ć V. Varia rozdział i. Metodologia pracy w sekcji mediacji oraz poradni prawa medycznego .............................................................................................................. A. Metodologia nowotworzonej sekcji mediacji, oparta na ameryka(cid:276)skim modelu kliniki mediacji ..................................................................................................... 1. Wprowadzenie ................................................................................................ 2. Struktura i formy kształcenia klinicznego w Polsce i podstawowe umiej(cid:266)tno(cid:286)ci prawnicze nabywane w klinikach prawa .................................. 3. Metodologia sekcji mediacji ........................................................................... a. Proces mediacji, a sekcja mediacji w strukturach UPP ............................. b. Metodologia sekcji mediacji ...................................................................... 4. Podsumowanie ................................................................................................ B. Działalno(cid:286)ć Studenckiej Poradni Prawa Medycznego Collegium Medicum w Krakowie ......................................................................................................... 1. Idea Studenckiej Poradni Prawa Medycznego ............................................... 2. Współpraca w ramach (cid:286)wiadczenia pomocy prawnej .................................... 3. Odbiorcy usług (cid:286)wiadczonych przez SPPM ................................................... 4. Organizacja SPPM .......................................................................................... 5. Prowadzenie zaj(cid:266)ć w poradni ......................................................................... 6. Jak przygotować studentów do pracy w SPPM? ............................................ 7. Podsumowanie ................................................................................................ rozdział ii. Kazusy .................................................................................................. A. Skarga do ETPCz w Strasburgu. Odpowiedzialno(cid:286)ć radcy prawnego ................ 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. a. Skarga do ETPCz w Strasburgu ................................................................ b. Odpowiedzialno(cid:286)ć radcy prawnego ........................................................... 3. Działanie Poradni ............................................................................................ B. Mo(cid:298)liwo(cid:286)ć zaprzeczenia ojcostwa w prawie polskim w (cid:286)wietle standardów EKPCz ................................................................................................................. 1. Stan faktyczny ................................................................................................. 2. Zagadnienia wst(cid:266)pne ...................................................................................... 3. Aktualna regulacja zaprzeczenia ojcostwa w prawie polskim ....................... 4. Analiza warunków formalnych do wniesienia skargi ..................................... 5. Zarzuty naruszenia praw gwarantowanych Konwencj(cid:261) ................................. a. Prawo do rzetelnego procesu ..................................................................... b. Standard ochrony prawa do (cid:298)ycia prywatnego i rodzinnego ..................... 587 587 587 589 590 591 592 595 596 598 599 600 600 602 604 604 607 607 607 608 608 610 613 613 613 614 615 616 618 618 619 Spis tre(cid:286)ci c. Naruszenie zasady niedyskryminacji ......................................................... 6. Podsumowanie ................................................................................................ C. Skuteczno(cid:286)ć dochodzenia roszcze(cid:276) alimentacyjnych w Polsce i za granic(cid:261) .... 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. 3. Działanie Poradni ............................................................................................ D. Skuteczno(cid:286)ć egzekucji roszcze(cid:276) alimentacyjnych. (cid:285)wiadczenia zast(cid:266)pcze wypłacane przez fundusz alimentacyjny ............................................................. 1. Stan faktyczny ................................................................................................ 3. Ocena prawna ................................................................................................. a. Warunki nabywania prawa do (cid:286)wiadczenia z funduszu alimentacyjnego .. b. Procedura ubiegania si(cid:266) o (cid:286)wiadczenia z funduszu .................................... 4. Działanie Poradni ............................................................................................ E. Problematyka autorskich praw maj(cid:261)tkowych do utworu stworzonego w wyniku wykonywania umowy o prac(cid:266) oraz umowy cywilnoprawnej ............................. 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. F. Instytucja dozwolonego u(cid:298)ytku publicznego w sferze nadawania utworów w odniesieniu do osób prowadz(cid:261)cych drobn(cid:261) działalno(cid:286)ć gospodarcz(cid:261) ............. 1. Stan faktyczny ................................................................................................ 2. Ocena prawna ................................................................................................. rozdział iii. Artykuły ............................................................................................. A. Prawo do s(cid:261)du w orzecznictwie ETPCz w Strasburgu ........................................ 1. Wst(cid:266)p .............................................................................................................. 2. Powody zainteresowania post(cid:266)powaniem przed ETPCz w Strasburgu ......... 3. Europejski Trybunał Praw Człowieka ............................................................ 4. Post(cid:266)powanie przed ETPCz w Strasburgu – informacje ogólne .................... 5. Problematyka prawa do s(cid:261)du .......................................................................... a. Uwagi ogólne ............................................................................................. b. Przewlekło(cid:286)ć post(cid:266)powania w prawie polskim ......................................... c. Przewlekło(cid:286)ć post(cid:266)powania w orzecznictwie ETPCz ............................... d. Zachowanie zasady kontradyktoryjno(cid:286)ci post(cid:266)powania ............................ e. Inne aspekty prawa do s(cid:261)du ....................................................................... 6. Pełnomocnicy ................................................................................................. 7. Koszty s(cid:261)dowe ................................................................................................ 8. (cid:285)rodki odwoławcze ......................................................................................... 9. Wyrok ............................................................................................................. B. Ochrona obywateli i osób zamieszkuj(cid:261)cych w UE oraz jej ewolucja ................. 1. Wprowadzenie ................................................................................................ 2. Prawo do opieki dyplomatycznej i konsularnej ............................................. XVII 623 623 624 624 625 626 627 627 627 628 629 630 631 631 631 636 636 636 641 641 641 641 642 643 644 644 645 646 650 651 652 653 653 654 655 655 658 XVIII Spis tre(cid:286)ci 3. Prawo petycji i skarg ...................................................................................... a. Prawo petycji do Parlamentu Europejskiego ............................................. b. Prawo skargi do Rzecznika Praw Obywatelskich ...................................... c. Prawo zwrócenia si(cid:266) do instytucji wspólnotowych ................................... d. Skarga do Trybunału Sprawiedliwo(cid:286)ci WE (S(cid:261)d Pierwszej Instancji, S(cid:261)d ds. Słu(cid:298)by Publicznej UE) – informacje podstawowe ........................ 4. Prawo dost(cid:266)pu do dokumentów ..................................................................... 5. Prawo obywatelskie w Traktacie z Lizbony ................................................... C. Instytucja pomocy obcemu pa(cid:276)stwu w egzekucji administracyjnej ................... 1. Dyrektywa Rady Nr 76/308/EWG jako matryca instytucji pomocy 659 659 660 661 661 662 663 665 666 667 668 669 670 671 672 673 674 675 676 677 677 679 680 683 687 690 690 690 691 693 695 695 697 697 699 mi(cid:266)dzynarodowej ............................................................................................ 2. Zakres przedmiotowy i (cid:296)ródła nale(cid:298)no(cid:286)ci dochodzonych w trybie ustawy ... 3. Organ wykonuj(cid:261)cy i organ egzekucyjny ........................................................ 4. Formy pomocy i generalne przesłanki jej udzielenia ..................................... 5. Post(cid:266)powanie w sprawie udzielenia informacji ............................................. 6. Post(cid:266)powanie w sprawie powiadomienia zainteresowanego ......................... 7. Post(cid:266)powanie w sprawie egzekucji lub zabezpieczenia nale(cid:298)no(cid:286)ci ............... 8. Prawne instrumenty reakcji zobowi(cid:261)zanego wobec roszcze(cid:276) niemieckiego Głównego Urz(cid:266)du Celnego ............................................................................. 9. Kwestionowanie okre(cid:286)lonych we wniosku nale(cid:298)no(cid:286)ci .................................. 10. Kwestionowanie dopuszczalno(cid:286)ci egzekucji .................................................. 11. Ocena i podsumowanie .................................................................................. D. Mał(cid:298)e(cid:276)ska spółka cywilna w (cid:286)wietle znowelizowanych przepisów KRO ........... 1. Wprowadzenie ................................................................................................ 2. Spółka cywilna w obrocie gospodarczym ...................................................... 3. Spółka cywilna mi(cid:266)dzy mał(cid:298)onkami a maj(cid:261)tkowe stosunki mał(cid:298)e(cid:276)skie ....... 4. Prowadzenie przedsi(cid:266)biorstwa nale(cid:298)(cid:261)cego do maj(cid:261)tku wspólnego mał(cid:298)onków w (cid:286)wietle nowych przepisów KRO ............................................. 5. Odpowiedzialno(cid:286)ć za zobowi(cid:261)zania wynikaj(cid:261)ce z działalno(cid:286)ci gospodarczej .. 6. Podsumowanie ................................................................................................ E. Prawo autorskie w działalno(cid:286)ci UPP ................................................................... 1. Wprowadzenie ................................................................................................ 2. Poj(cid:266)cie dozwolonego u(cid:298)ytku .......................................................................... 3. U(cid:298)ytek prywatny i u(cid:298)ytek publiczny .............................................................. 4. Uniwersytecka Poradnia Prawa jako instytucja o(cid:286)wiatowa lub naukowa w rozumieniu art. 27 PrAut ............................................................................ a. Instytucje naukowe i o(cid:286)wiatowe w rozumieniu ustawy ............................ b. Student jako podmiot procesu dydaktycznego w ramach instytucji naukowej .................................................................................................... c. Uczelniane poradnie prawa jako instytucje o(cid:286)wiatowe ............................. d. Zakres eksploatacji ..................................................................................... Spis tre(cid:286)ci e. Korzystanie z baz danych jako dozwolona eksploatacja ........................... 5. Dozwolony u(cid:298)ytek prywatny w pracy studentów UPP .................................. a. Kryterium kr(cid:266)gu uprawnionych osób ......................................................... b. Kryterium celu dozwolonego u(cid:298)ytku osobistego, w tym u(cid:298)ytek dla celów zawodowych ............................................................................................... c. Korzystanie ze specjalistycznych baz danych ........................................... 6. Prowadzenie archiwów akt przez SPP ............................................................ 7. Przekazywanie skopiowanych materiałów klientom jako zał(cid:261)cznik do sporz(cid:261)dzanych opinii ................................................................................. 8. Zako(cid:276)czenie ......................................
Pobierz darmowy fragment (pdf)

Gdzie kupić całą publikację:

Metodologia pracy w SPP
Autor:

Opinie na temat publikacji:


Inne popularne pozycje z tej kategorii:


Czytaj również:


Prowadzisz stronę lub blog? Wstaw link do fragmentu tej książki i współpracuj z Cyfroteką: