Cyfroteka.pl

klikaj i czytaj online

Cyfro
Czytomierz
01767 017407 17793237 na godz. na dobę w sumie
Pomoc państwa. Wybrane zagadnienia - ebook/pdf
Pomoc państwa. Wybrane zagadnienia - ebook/pdf
Autor: , , Liczba stron: 401
Wydawca: C. H. Beck Język publikacji: polski
ISBN: 978-83-255-0580-6 Data wydania:
Lektor:
Kategoria: ebooki >> prawo i podatki >> europejskie
Porównaj ceny (książka, ebook, audiobook).

Książka jest pierwszym w naszej literaturze spojrzeniem na mechanizmy i filozofię kontroli pomocy państwa z perspektywy wspólnotowej. Obszernie i szczegółowo przedstawia praktykę orzeczniczą Komisji Europejskiej i sądów wspólnotowych w tym zakresie. Stawia również pytania o sens przyznawania pomocy i jej efektywność. Kontrola pomocy państwa jest niezbędnym elementem polityki konkurencji. Zapewnia sprawne funkcjonowanie wspólnego rynku i pozwala na zachowanie skutecznej konkurencji między podmiotami prowadzącymi działalność gospodarczą. Książka adresowana jest do urzędników państwowych i samorządowych zajmujących się sprawami pomocy publicznej, kadry zarządzającej przedsiębiorstw, a także prawników i ekonomistów świadczących usługi doradcze na rzecz administracji i gospodarki.

Znajdź podobne książki Ostatnio czytane w tej kategorii

Darmowy fragment publikacji:

ZARYS PRAWA Pomoc pañstwa Wybrane zagadnienia Polecamy nasze publikacje z zakresu prawa europejskiego: A. Nowak-Far (red.) PRAWO ŒWIATOWEJ ORGANIZACJI HANDLU A UNIA EUROPEJSKA Akademia Prawa J. Barcz (red.) OCHRONA PRAW PODSTAWOWYCH W UNII EUROPEJSKIEJ Zarys Prawa J. Barcik, A. Wentkowska PRAWO UNII EUROPEJSKIEJ Z UWZGLÊDNIENIEM TRAKTATU Z LIZBONY Wyk³ady i Æwiczenia M. Fedorowicz, K. Nizio³ PRAWO FINANSOWE POLSKI I UNII EUROPEJSKIEJ Wyk³ady i Æwiczenia M. M. Kenig-Witkowska (red.) PRAWO INSTYTUCJONALNE UNII EUROPEJSKIEJ, wyd. 4 Podrêczniki Prawnicze A. £azowski, A. Zawidzka PRAWO MIÊDZYNARODOWE PUBLICZNE Podrêczniki Prawnicze E. Skibiñska PRAWO UNII EUROPEJSKIEJ Z WPROWADZENIEM Teksty Ustaw Becka PRAWO UNII EUROPEJSKIEJ Z WPROWADZENIEM, wyd. 12 Twoje Prawo www.sklep.beck.pl POMOC PAÑSTWA WYBRANE ZAGADNIENIA Pod redakcj¹ BART£OMIEJA KURCZA Autorzy: KRZYSZTOF BOLESTA, AGNIESZKA DRZEWOSKA, BART£OMIEJ GURBA, RAFA£ JANAS, MAREK KOŒKA, BART£OMIEJ KURCZ, AGATA MAZURKIEWICZ-GORGOL, AGNIESZKA MONTOYA-IWAÑCZUK, MA£GORZATA NESTOROWICZ, KAMILA SKOWYRA, MIKO£AJ STASIAK Pomoc pañstwa. Wybrane zagadnienia Redakcja: Anna £ubiñska-Bujak © Wydawnictwo C. H. Beck 2009 Wydawnictwo C. H. Beck Sp. z o.o. ul. Bonifraterska 17, 00-203 Warszawa Sk³ad i ³amanie: Wydawnictwo C. H. Beck Druk i oprawa: Elpil, Siedlce ISBN 978-83-255-0580-6 Autorzy Krzysztof Bolesta – mgr ekonomii, pracownik Urz(cid:266)du Komitetu Integracji Euro- pejskiej, uczestnik negocjacji pierwszego programu pomocy pa(cid:276)stwa dla polskiego górnictwa, autor wielu publikacji dotycz(cid:261)cych górnictwa w(cid:266)gla kamiennego. Od 2004 r. w Komisji Europejskiej. Pocz(cid:261)tkowo pracownik Dy- rektoriatu ds. Konkurencji, gdzie zajmował si(cid:266) m.in. ocen(cid:261) programów po- mocy pa(cid:276)stwa z zakresu ochrony (cid:286)rodowiska. Obecnie pracownik Dyrekto- riatu ds. Transportu i Energii, gdzie zajmuje si(cid:266) tematyk(cid:261) rynków ropy naftowej i w(cid:266)gla kamiennego, a tak(cid:298)e problematyk(cid:261) czystych technologii w(cid:266)glowych. Agnieszka Drzewoska – mgr prawa Uniwersytetu Łódzkiego, dyplom studiów prawa mi(cid:266)dzynarodowego uniwersytetu w Antwerpii (Uni�ersitaire In� Uni�ersitaire In- stelling Antwerpen); LLM uniwersytet w Brukseli (Vrije Uni�ersiteit Brussel). Pracownik Dyrekcji Generalnej ds. Konkurencji w Komisji Eu- ropejskiej od 2003 r. Zajmuje si(cid:266) głównie ocen(cid:261) (cid:286)rodków pomocy regio- nalnej, a tak(cid:298)e zwi(cid:261)zkami zasad pomocy pa(cid:276)stwa z problematyk(cid:261) fundu- szy struktu ralnych, w tym – w obu przypadkach – przegl(cid:261)dem odno(cid:286)nego ustawodawstwa oraz działalno(cid:286)ci(cid:261) szkoleniow(cid:261) z zakresu pomocy pa(cid:276)- stwa dla pracowników administracji krajów członkowskich UE oraz kra- jów przygotowuj(cid:261)cych kandydatur(cid:266) do UE. Bartlomiej Gurba – mgr ekonomii Akademii Ekonomicznej w Krakowie, dokto� rant ekonomii w Centrum Studiów nad Integracj(cid:261) Europejsk(cid:261) (ZEI) Uni- wersytetu w Bonn. Stypendysta Fundacji im. Konrada Adenauera. Od 2005 r. pracuje w Komisji Europejskiej w Brukseli w Dyrekcji General- nej ds. Konkurencji. Rafał Janas – absolwent WPiA UJ (1999), Szkoły Prawa Niemieckiego na UJ (1999). Od 2003 r. doktorant w Europejskim Kolegium Doktoranckim „Trans formacja systemu i dostosowywanie prawa w jednocz(cid:261)cej si(cid:266) Euro� pie” (Kraków – Moguncja – Heidelberg). Urz(cid:266)dnik Komisji Europejskiej, od grudnia 2006 r. pracuje w Dyrekcji Generalnej ds. Polityki Regional- nej, w dziale: Sprawy prawne, procedury, gdzie zajmuje si(cid:266) m.in. pomoc(cid:261) pa(cid:276)stwa. Do zainteresowa(cid:276) naukowych nale(cid:298)(cid:261) kwestie zwi(cid:261)zane z budow(cid:261) europejskiej przestrzeni administracyjnej, z uznawaniem aktów admini- stracyjnych oraz z podstawowymi wolno(cid:286)ciami wspólnego rynku, a tak(cid:298)e problemy polityki regionalnej oraz pomocy pa(cid:276)stwa. Marek Ko(cid:286)ka – mgr prawa, doktorant Uniwersytetu Rheinishe Friedrich–Wil� Rheinishe Friedrich–Wil- helms–Uni�ersität w Bonn, obecnie pracownik Komisji Europejskiej, Dyrekcji Generalnej ds. Konkurencji. Autor uko(cid:276)czył Wydział Prawa i Administracji Uniwersytetu Warszawskiego oraz studia Magister iuris comparati�i w Bonn. V Autorzy Bartłomiej Kurcz – dr nauk prawnych Uniwersytetu Jagiello(cid:276)skiego, LLM w dziedzinie prawa europejskiego, Uniwersytet w Leu�en (Belgia), Di�Di- ploma in Legal Studies, Uniwersytet Cambridge. Od 2004 r. pracownik Komi sji Europejskiej (Dyrekcja ds. Konkurencji, a nast(cid:266)pnie ds. Rynku Wewn(cid:266)trznego) oraz wykładowca na Uniwersytecie Jagiello(cid:276)skim. Autor wielu publikacji z prawa europejskiego, w tym wyró(cid:298)nionej pierwsz(cid:261) na- grod(cid:261) Fundacji Promocji Prawa Europejskiego ksi(cid:261)(cid:298)ki „Dyrektywy i ich implementacja do prawa krajowego”, Kraków 2004. Agata Mazurkiewicz-Gorgol – mgr ekonomii SGH, były pracownik Urz(cid:266)du Ochrony Konkurencji i Konsumentów, a obecnie Wydziału zajmuj(cid:261)cego si(cid:266) restrukturyzacj(cid:261) przemysłu w Dyrekcji Generalnej ds. Konkurencji Komisji Europejskiej. Agnieszka Montoya-Iwa(cid:276)czuk – LLM (Monachium), obecnie pracuje w Dyrek- cji ds. Konkurencji i Pomocy Pa(cid:276)stwa w Urz(cid:266)dzie Nadzoru EFTA. Wcze- (cid:286)niej zajmowała si(cid:266) indywidualnymi sprawami pomocy pa(cid:276)stwa w sek- torach mediów i telekomunikacji w Dyrekcji Generalnej ds. Konkurencji Komisji Europejskiej. Małgorzata Anna Nesterowicz – dr nauk prawnych Uniwersytetu Mikołaja Ko- pernika w Toruniu, LLM w dziedzinie prawa europejskiego Uniwersyte- tu w Lund (Szwecja), stypendysta Fullbrighta na Uniwersytecie w Rich- mond (USA). Pracowała na Wydziale Prawa UMK w Toruniu, a nast(cid:266)pnie w Euro pejskim Trybunale Sprawiedliwo(cid:286)ci w Luksemburgu. Obecnie pra- cuje w Europejskiej Agencji Bezpiecze(cid:276)stwa Morskiego, która jest organem UE z siedzib(cid:261) w Lizbonie. Kamila Skowyra – mgr prawa, absolwentka Uniwersytetu im. Adama Mickiewi- cza w Poznaniu oraz studiów podyplomowych w dziedzinie ekonomicznej analizy prawa na Uniwersytecie w Hamburgu (European Master of Law and Economics; EMLE). Stypendystka DAAD oraz Deutsche Forschungsgeme- inschaft w ramach Graduiertenkolleg Recht und Ökonomie na Uniwersyte- cie w Hamburgu. Od kilku lat pracuje w Komisji Europejskiej w Brukseli, w Dyrekcji Generalnej ds. Przedsi(cid:266)biorstw i Przemysłu. Mikołaj Stasiak – mgr prawa, wieloletni pracownik Urz(cid:266)du Ochrony Konkuren- cji i Konsumentów, a nast(cid:266)pnie Stałego Przedstawicielstwa Polski przy UE oraz Dyrekcji Generalnej ds. Transportu i Energii Komisji Europejskiej. Obecnie, prowadzi firm(cid:266) „EASY STATE AID Mikołaj Stasiak”, która spe- cjalizuje si(cid:266) w doradztwie z zakresu pomocy pa(cid:276)stwa. VI Spis tre(cid:286)ci Autorzy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . V Spis tre(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . VII Słowo wst(cid:266)pne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XV Od redaktora . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XIX Wykaz skrótów . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXI Bibliograia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXV Orzecznictwo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXXI Rozdział I. Mi(cid:266)dzy ustami a brzegiem pucharu… gdzie jest pomoc pa(cid:276)stwa? Definicja pomocy pa(cid:276)stwa w (cid:286)wietle orzecznictwa ETS-u (Bartłomiej Kurcz) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Wprowadzenie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Selektywna korzy(cid:286)ć . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.1. Pewno(cid:286)ć wyst(cid:261)pienia korzy(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . 2.2. Test prywatnego inwestora lub wierzyciela . . . . . . . . . . . . . . . . . 2.3. Selektywno(cid:286)ć a (cid:286)rodki natury ogólnej . . . . . . . . . . . . . . . . . . . . . 3. Interwencja pa(cid:276)stwa przy u(cid:298)yciu zasobów pa(cid:276)stwowych . . . . . . . . . 4. Wpływ (cid:286)rodka pomocowego na wymian(cid:266) handlow(cid:261) mi(cid:266)dzy pa(cid:276)stwami członkowskimi . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5. Konkluzje . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział II. Małe (i (cid:286)rednie) jest pi(cid:266)kne… O stosowaniu komisyjnej deinicji małych i (cid:286)rednich przedsi(cid:266)biorstw w dziedzinie pomocy pa(cid:276)stwa (Kamila Skowyra) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Wprowadzenie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Pierwsza deinicja M(cid:285)P z Zalecenia 96/280/WE . . . . . . . . . . . . . . . . 3. Obecnie obowi(cid:261)zuj(cid:261)ca deinicja M(cid:285)P (Zalecenie 2003/361/WE) . . . . . . 3.1. Próg liczby osób zatrudnionych . . . . . . . . . . . . . . . . . . . . . . . . . . 3.2. Pułapy inansowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Deinicja przedsi(cid:266)biorstwa – obliczanie danych i relacje 1 1 2 3 5 9 11 14 15 17 17 18 20 21 22 23 24 25 27 28 29 29 32 VII z innymi podmiotami . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.1. Przedsi(cid:266)biorstwa niezale(cid:298)ne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.2. Przedsi(cid:266)biorstwa partnerskie . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.3. Przedsi(cid:266)biorstwa zwi(cid:261)zane . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5. Problemy i niedogodno(cid:286)ci typowe dla M(cid:285)P jako wyznacznik konieczno(cid:286)ci pomocy pa(cid:276)stwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.1. Decyzje Komisji oceniaj(cid:261)ce niezale(cid:298)no(cid:286)ć M(cid:285)P . . . . . . . . . . . . . . 5.1.1. Decyzje negatywne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.1.2. Decyzje o wszcz(cid:266)ciu post(cid:266)powania okre(cid:286)lonego w art. 88 ust. 2 TWE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Spis tre(cid:286)ci 5.1.3. Decyzje pozytywne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.2. Orzecznictwo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6. Ocena prawna i polityczna . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6.1. Problem „strategicznego” stosowania deinicji . . . . . . . . . . . . . . . 6.2. Zmiany pułapów i progów . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział III. Przywilej nielicznych? Pomoc regionalna na wspieranie rozwoju gospodarczego niektórych regionów UE (Agnieszka Drzewoska) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Wprowadzenie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Podstawy dopuszczalno(cid:286)ci pomocy regionalnej: ogólne postanowienia Traktatu oraz ich uszczegółowienie w innych (cid:296)ródłach prawa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Podstawowe kryteria zgodno(cid:286)ci proponowanego (cid:286)rodka pomocy regionalnej z Wytycznymi 2007–2013 . . . . . . . . . . . . . . . . . . . . . . . . 3.1. „Mapy regionalne”: regiony kwaliikuj(cid:261)ce si(cid:266) do pomocy regionalnej oraz intensywno(cid:286)ć pomocy . . . . . . . . . . . . . . . . . . . . 3.1.1. Regiony kwaliikuj(cid:261)ce si(cid:266) do obj(cid:266)cia pomoc(cid:261) oraz intensywno(cid:286)ć pomocy w Polsce . . . . . . . . . . . . . . . . . . . . . 3.2. Zasi(cid:266)g sektorowy Wytycznych 2007–2013 . . . . . . . . . . . . . . . . . 3.3. Beneicjenci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.4. Na jakie cele dozwolona jest pomoc regionalna? . . . . . . . . . . . . . 3.5. Jakie koszty mog(cid:261) zostać obj(cid:266)te pomoc(cid:261) regionaln(cid:261) (z wyszczególnieniem korzystniejszych uregulowa(cid:276) dla małych i (cid:286)rednich przedsi(cid:266)biorstw)? . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.6. Kumulacja pomocy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.7. Efekt zach(cid:266)ty . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.8. Utrzymanie inwestycji i miejsc pracy w regionie . . . . . . . . . . . . 3.9. Wkład beneicjenta w inansowanie inwestycji . . . . . . . . . . . . . . 3.10. Pomoc dla nowoutworzonych przedsi(cid:266)biorstw . . . . . . . . . . . . . 3.11. Pomoc operacyjna . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3.12. Uwagi ko(cid:276)cowe dotycz(cid:261)ce ogólnych warunków dopuszczalno(cid:286)ci okre(cid:286)lonych w Wytycznych 2007–2013 . . . . . . 4. Zasady szczególne dla du(cid:298)ych projektów inwestycyjnych . . . . . . . . . 4.1. Potrzeba wprowadzenia zasad szczególnych dla du(cid:298)ych projektów inwestycyjnych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.2. Poj(cid:266)cie „du(cid:298)y projekt inwestycyjny” oraz „jednostkowy projekt inwestycyjny” . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.3. Korekta dopuszczalnego pułapu (intensywno(cid:286)ci) pomocy dla du(cid:298)ych projektów . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.4. Próg indywidualnego zgłoszenia do Komisji . . . . . . . . . . . . . . . . 4.5. Testy rynkowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.5.1. Ocena udziałów w rynku . . . . . . . . . . . . . . . . . . . . . . . . . . 4.5.1.1. Odno(cid:286)ny produkt . . . . . . . . . . . . . . . . . . . . . . . . . . 4.5.1.2. Odno(cid:286)ny rynek produktowy . . . . . . . . . . . . . . . . . 4.5.1.3. Rynki geograiczne . . . . . . . . . . . . . . . . . . . . . . . . 4.5.2. Ocena sytuacji strukturalnej rynku oraz zdolno(cid:286)ci produkcyjnych projektu . . . . . . . . . . . . . . . . . . . . . . . . . . . VIII 36 38 41 42 42 45 45 47 48 49 52 53 57 57 59 62 63 64 64 65 67 69 70 70 71 76 77 78 83 84 86 89 91 Spis tre(cid:286)ci 4.6. Inne elementy oceny du(cid:298)ych projektów inwestycyjnych podlegaj(cid:261)cych obowi(cid:261)zkowi indywidualnego zgłoszenia i odpowiadaj(cid:261)ce im wymagane zobowi(cid:261)zania ze strony pa(cid:276)stw członkowskich . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4.7. Ex post monitoring . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5. Rozporz(cid:261)dzenie w sprawie wył(cid:261)cze(cid:276) blokowych . . . . . . . . . . . . . . . . 5.1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.2. Podstawowe warunki kwaliikuj(cid:261)ce instrumenty do wył(cid:261)czenia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5.3. Szczegółowe warunki zgodno(cid:286)ci z uregulowaniami dotycz(cid:261)� cymi pomocy regionalnej – zmiany w odniesieniu do Wytycz� nych 2007–2013 oraz Rozporz(cid:261)dzenia 1628/2006 . . . . . . . . . . . 93 94 95 95 96 99 5.4. Brak bonusów regionalnych dla innych instrumentów pomocowych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 102 6. Podsumowanie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 103 Rozdział IV. Na jednym jad(cid:261) wozie…? Relacja pomi(cid:266)dzy pomoc(cid:261) pa(cid:276)stwa a polityk(cid:261) spójno(cid:286)ci (Rafał Janas) . . . . . . . . . . . . . . . . . . . . . . . . 105 1. Podstawowe cele polityki spójno(cid:286)ci a pomoc pa(cid:276)stwa . . . . . . . . . . . . 105 1.1. Podstawowe formy realizacji polityki spójno(cid:286)ci – Fundusze Strukturalne oraz Fundusz Spójno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . 106 1.2. Zasady wdra(cid:298)ania funduszy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 107 1.3. Programy Operacyjne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 108 2. Zapewnienie koordynacji mi(cid:266)dzy politykami . . . . . . . . . . . . . . . . . . . 108 2.1. Uwagi wst(cid:266)pne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 108 2.2. Trwało(cid:286)ć efektów polityk . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 109 2.3. Ró(cid:298)nice podej(cid:286)ć pomi(cid:266)dzy politykami . . . . . . . . . . . . . . . . . . . . . 110 3. Koordynacja pomi(cid:266)dzy politykami . . . . . . . . . . . . . . . . . . . . . . . . . . . 111 3.1. Problemy praktyczne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 111 3.2. Obowi(cid:261)zek zwrotu pomocy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 112 4. Komplementarno(cid:286)ć czy prymat? Postanowienia harmonizuj(cid:261)ce polityki . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 114 5. Cele po(cid:286)rednie obu polityk . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 115 6. Trwało(cid:286)ć i efektywno(cid:286)ć interwencji . . . . . . . . . . . . . . . . . . . . . . . . . . 117 7. Struktura wdra(cid:298)ania funduszy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 119 8. Kształtowanie „wspólnotowej polityki gospodarczej” . . . . . . . . . . . . 119 9. Pomoc pa(cid:276)stwa i polityka spójno(cid:286)ci a (cid:286)wiatowy kryzys gospodarczy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 121 10. Kwestia stosowalno(cid:286)ci obu polityk w pa(cid:276)stwach trzecich . . . . . . . . . 123 11. Procedura podejmowania decyzji odno(cid:286)nie pomocy pa(cid:276)stwa . . . . . . 124 12. Perspektywy pomocy pa(cid:276)stwa i polityki spójno(cid:286)ci . . . . . . . . . . . . . . 125 13. Efektywna ochrona prawna . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 126 14. Podsumowanie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 128 Rozdział V. Jak astronomowi teleskop? Pomoc pa(cid:276)stwa na działalno(cid:286)ć badawcz(cid:261), rozwojow(cid:261) i innowacyjn(cid:261) (Bartłomiej Kurcz) . . . . . . 131 1. Wprowadzenie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 131 2. Analiza ekonomiczna – test bilansuj(cid:261)cy . . . . . . . . . . . . . . . . . . . . . . . 132 IX Spis tre(cid:286)ci 2.1. Ukierunkowanie pomocy na nieprawidłowo(cid:286)ć w funkcjonowaniu rynku . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 133 2.2. Stosowno(cid:286)ć pomocy pa(cid:276)stwa jako instrumentu wsparcia . . . . . . 140 2.3. Efekt zach(cid:266)ty, niezb(cid:266)dno(cid:286)ć wsparcia i proporcjonalno(cid:286)ć pomocy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 141 2.4. Analiza zakłócenia konkurencji i wymiany handlowej . . . . . . . . 143 2.5. Wynik testu bilansuj(cid:261)cego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 145 3. Pozostałe przepisy wspólnotowych Zasad ramowych na działalno(cid:286)ć B R I – uwagi i kontrowersje . . . . . . . . . . . . . . . . . . 145 3.1. Co jest pomoc(cid:261) pa(cid:276)stwa w dziedzienie B R I? . . . . . . . . . . . . 146 3.2. Która pomoc jest zgodna ze wspólnym rynkiem w dziedzinie B R I? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 149 4. Ogólne rozporz(cid:261)dzenie w sprawie wył(cid:261)cze(cid:276) grupowych a B R I . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 152 5. Konkluzje . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 153 Rozdział VI. Jak trwoga to do… pa(cid:276)stwa po pieni(cid:261)dze. Komu pomaga pomoc pa(cid:276)stwa na ratowanie i restrukturyzacj(cid:266) przedsi(cid:266)biorstw? (Agata Mazurkiewicz-Gorgol) . . . . . . . . . . . . . . . . . . . . 157 1. Wprowadzenie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 157 2. Geneza pomocy na restrukturyzacj(cid:266) . . . . . . . . . . . . . . . . . . . . . . . . . . 158 3. Zasady udzielania pomocy na ratowanie i restrukturyzacj(cid:266) . . . . . . . . 161 3.1. Beneicjenci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 162 3.2. Pomoc na ratowanie czy na restrukturyzacj(cid:266) przedsi(cid:266)biorstwa? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 164 3.3. Pomoc na restrukturyzacj(cid:266) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 167 3.4. Unikanie zbyt du(cid:298)ego zakłócenia konkurencji . . . . . . . . . . . . . . . 170 3.5. Udział własny . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 172 3.6. Realizacja planu, nadu(cid:298)ycie pomocy . . . . . . . . . . . . . . . . . . . . . . 176 3.7. Zasada „pierwszy i ostatni raz” . . . . . . . . . . . . . . . . . . . . . . . . . . 177 4. Restrukturyzacja czy prywatyzacja? . . . . . . . . . . . . . . . . . . . . . . . . . . 178 5. Ekonomiczne uzasadnienie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 179 6. Restrukturyzacja w czasach kryzysu . . . . . . . . . . . . . . . . . . . . . . . . . . 184 7. Podsumowanie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 186 Rozdział VII. Zanieczyszczaj(cid:261)cemu dzi(cid:266)kujemy. Pomoc pa(cid:276)stwa na finansowanie energii o niskiej emisji CO2 (Bartłomiej Gruba) . . . . . . . 189 1. Wst(cid:266)p . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 189 2. Przesłanki dla udzielania pomocy . . . . . . . . . . . . . . . . . . . . . . . . . . . . 192 2.1. Koszty społeczne zanieczyszcze(cid:276) (cid:286)rodowiska a koszty prywatne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 192 2.2. Zasada zanieczyszczaj(cid:261)cy płaci i jej umocowanie w Traktacie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 193 2.3. Przepisy dotycz(cid:261)ce pomocy pa(cid:276)stwa w Traktacie . . . . . . . . . . . . 194 2.4. Stan „niewydolno(cid:286)ci/niedoskonało(cid:286)ci rynku” warunkiem udzielania pomocy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 194 3. Zachowanie zasad konkurencji . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 196 3.1. Efekt zach(cid:266)ty i konieczno(cid:286)ć u(cid:298)ycia pomocy . . . . . . . . . . . . . . . . 196 X Spis tre(cid:286)ci 3.2. Proporcjonalno(cid:286)ć pomocy − zasada kosztów dodatkowych . . . . 196 3.3. Bilansowanie efektu (cid:286)rodowiskowego pomocy i zakłóce(cid:276) konkurencji . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 198 4. Główne metody udzielania pomocy pa(cid:276)stwa na energi(cid:266) odnawialn(cid:261) a dotychczasowa praktyka Komisji Europejskiej w ocenie wybranych programów pomocowych . . . . . . . . . . . . . . . . . . . . . . . . . 199 4.1. Pomoc inwestycyjna a pomoc operacyjna . . . . . . . . . . . . . . . . . . 199 4.2. Pomoc w systemie certyikatów . . . . . . . . . . . . . . . . . . . . . . . . . . 205 5. Wnioski . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 207 Rozdział VIII. Schyłek w(cid:266)gla, niech (cid:298)yje w(cid:266)giel! Pomoc pa(cid:276)stwa dla górnictwa w(cid:266)gla kamiennego (Krzysztof Bolesta) . . . . . . . . . . . . . . . . 209 1. Od rynku do pomocy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 209 2. Koniec w(cid:266)gla? – ostatnia decyzja w ramach EWWiS . . . . . . . . . . . . . 210 3. „Big Bang 2004” – powrót w(cid:266)gla do UE . . . . . . . . . . . . . . . . . . . . . . 212 4. Inny Traktat – te same potrzeby – Rozporz(cid:261)dzenie 1407/2002 . . . . . 213 5. Wysychaj(cid:261)cy strumie(cid:276) – Rozporz(cid:261)dzenie 1407/2002 w praktyce . . . 216 6. Kolejny zmierzch w(cid:266)gla? Pomoc pa(cid:276)stwa czy rynek? . . . . . . . . . . . . 217 7. Je(cid:286)li nie rynek, to co? Problem podstawy prawnej . . . . . . . . . . . . . . . 218 7.1. Usługi w ogólnym interesie gospodarczym . . . . . . . . . . . . . . . . . 218 7.2. Pomoc regionalna . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 221 7.3. Pomoc na zatrudnienie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 221 7.4. Pomoc na ochron(cid:266) (cid:286)rodowiska . . . . . . . . . . . . . . . . . . . . . . . . . . . 222 8. Podstawy si(cid:266) zmieniaj(cid:261) – w(cid:266)giel zostaje . . . . . . . . . . . . . . . . . . . . . . . 223 Rozdział IX. Poprosz(cid:266) bilet… na koszt pa(cid:276)stwa. Pomoc pa(cid:276)stwa a rekompensata za usługi o charakterze powszechnym w transporcie drogowym (Mikołaj Stasiak) . . . . . . . . . . . . . . . . . . . . . . . . 225 1. Wst(cid:266)p . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 225 2. Rekompensata za usługi o charakterze powszechnym a pomoc pa(cid:276)stwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 227 2.1. Rekompensata jako selektywna ekonomiczna korzy(cid:286)ć. . . . . . . . . 227 2.1.1. Obowi(cid:261)zek (cid:286)wiadczenia usług . . . . . . . . . . . . . . . . . . . . . . 228 2.1.2. Parametry słu(cid:298)(cid:261)ce obliczeniu rekompensaty . . . . . . . . . . . 229 2.1.3. Obliczanie rekompensaty . . . . . . . . . . . . . . . . . . . . . . . . . . 230 2.1.4. Wybór przedsi(cid:266)biorcy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 231 2.2. Naruszenie konkurencji i wpływ na wymian(cid:266) handlow(cid:261) . . . . . . . 234 3. Dopuszczalno(cid:286)ć udzielania pomocy pa(cid:276)stwa w formie rekompensaty . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 235 3.1. Podej(cid:286)cie Komisji Europejskiej . . . . . . . . . . . . . . . . . . . . . . . . . . 236 3.2. Warunki dopuszczalno(cid:286)ci udzielania pomocy na podstawie Rozporz(cid:261)dzenia 1370/2007 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 238 3.2.1. Tre(cid:286)ć umowy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 239 3.2.2. Udzielanie zamówie(cid:276) prowadz(cid:261)cych do zawarcia umowy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 240 3.2.2.1. Procedura przewidziana w Dyrektywach 2004/17 3.2.2.2. Procedura przewidziana w Rozporz(cid:261)dzeniu 1370/2007 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 241 i 2004/18 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 240 XI Spis tre(cid:286)ci 3.2.3. Rekompensata . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 243 3.2.4. Sprawozdawczo(cid:286)ć . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 243 3.2.5. Przepisy przej(cid:286)ciowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 244 3.2.6. Zgodno(cid:286)ć z Traktatem . . . . . . . . . . . . . . . . . . . . . . . . . . . . 244 4. Wnioski . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 245 Rozdział X. Co ma pływać dzi(cid:266)ki pa(cid:276)stwu nie utonie…? O pomocy pa(cid:276)stwa w transporcie morskim (Małgorzata Anna Nesterowicz) . . . . . . 247 1. Wst(cid:266)p . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 247 2. (cid:297)egluga morska . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 248 2.1. Uwagi wst(cid:266)pne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 248 2.2. Pomoc dla (cid:298)eglugi – uregulowania sektorowe . . . . . . . . . . . . . . . 252 2.2.1. Pierwsze wytyczne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 252 2.2.2. Obowi(cid:261)zuj(cid:261)ce wytyczne Komisji w sprawie pomocy pa(cid:276)stwa dla transportu morskiego (2004) . . . . . . . . . . . . . 253 2.2.2.1. (cid:285)rodki iskalne i socjalne zmierzaj(cid:261)ce do poprawy konkurencyjno(cid:286)ci . . . . . . . . . . . . . . . . . . 255 2.2.2.2. Pomoc inwestycyjna . . . . . . . . . . . . . . . . . . . . . . . 260 2.2.2.3. Pomoc regionalna . . . . . . . . . . . . . . . . . . . . . . . . . 261 2.2.2.4. Pomoc na restrukturyzacj(cid:266) . . . . . . . . . . . . . . . . . . 261 2.2.2.5. Pomoc na szkolenia marynarzy i oicerów . . . . . . 264 2.2.2.6. Pomoc dla transportu bliskiego zasi(cid:266)gu . . . . . . . . 265 2.2.2.7. Pomoc z tytułu wykonywania usług publicznych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 267 3. Wnioski . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 273 Rozdział XI. Telewizja bez granic? Finansowanie misji publicznej radia i telewizji w prawie wspólnotowym (Agnieszka Montoya-Iwa(cid:276)czuk) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 277 1. Wst(cid:266)p . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 277 1.1. Rys historyczny . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 277 1.2. Dlaczego abonament telewizyjny jest pomoc(cid:261) publiczn(cid:261)? . . . . . 282 1.3. Dlaczego Altmark nie ma zastosowania? . . . . . . . . . . . . . . . . . . . 285 1.4. Dlaczego usługi telewizyjne nie mieszcz(cid:261) si(cid:266) w poj(cid:266)ciu kultury? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 287 2. Ocena zgodno(cid:286)ci pomocy pa(cid:276)stwa w sektorze radiowo�telewizyjnym . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 288 2.1. Uwagi ogólne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 288 2.2. Deinicja misji publicznej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 289 2.2.1. Granice swobody pa(cid:276)stw członkowskich . . . . . . . . . . . . . . 289 2.2.2. Precyzja i jasno(cid:286)ć deinicji . . . . . . . . . . . . . . . . . . . . . . . . . 294 2.2.3. Przykłady deinicji usług (cid:286)wiadczonych w ogólnym interesie gospodarczym nadawców publicznych . . . . . . . . 295 2.2.3.1. Działalno(cid:286)ć programowa . . . . . . . . . . . . . . . . . . . 295 2.2.3.2. Pozaprogramowe dziedziny działalno(cid:286)ci nadawców publicznych . . . . . . . . . . . . . . . . . . . . . 297 2.2.3.3. Usługi w nowych mediach . . . . . . . . . . . . . . . . . . 299 2.2.3.4. Inna działalno(cid:286)ć nadawców publicznych . . . . . . . 299 XII Spis tre(cid:286)ci 2.2.4. Działalno(cid:286)ć komercyjna i oczywisty bł(cid:261)d deinicji . . . . . . 300 2.2.5. Usługi powszechnego versus indywidualnego dost(cid:266)pu (on-demand ) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 302 2.2.6. Uprzednie powierzenie misji publicznej . . . . . . . . . . . . . . . 303 2.2.7. Czasowe ograniczenie misji publicznej . . . . . . . . . . . . . . . 303 2.3. Powierzenie misji i nadzór . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 304 2.3.1. Powierzenie misji . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 304 2.3.2. Uprzednie powierzenie misji (tzw. procedura ex ante) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 305 2.3.3. Nadzór . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 307 2.4. Kryterium proporcjonalno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . 308 2.4.1. Uwagi wst(cid:266)pne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 308 2.4.2. Jasno(cid:286)ć i precyzja misji publicznej . . . . . . . . . . . . . . . . . . . 311 2.4.3. Wybór systemu inansowania . . . . . . . . . . . . . . . . . . . . . . . 311 2.4.4. Rozdział rachunkowo(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . 312 2.4.5. Alokacja przychodów i wydatków . . . . . . . . . . . . . . . . . . . 314 2.4.6. Obliczanie kompensacji oraz nadmiernej kompensacji . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 316 2.4.7. Nadwy(cid:298)ka rekompensaty . . . . . . . . . . . . . . . . . . . . . . . . . . 318 2.4.8. Zachowanie zgodne z regułami gospodarki rynkowej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 320 2.4.8.1. Uwagi wst(cid:266)pne . . . . . . . . . . . . . . . . . . . . . . . . . . . 320 2.4.8.2. Zani(cid:298)anie cen usług i produktów . . . . . . . . . . . . . 321 2.4.8.3. Stosunki z komercyjnymi spółkami�córkami . . . . 323 2.4.8.4. Inne przykłady (nie)konkurencyjnych zachowa(cid:276) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 324 3. Uwagi ko(cid:276)cowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 325 Rozdział XII. Co cesarskie cesarzowi… Zwrot pomocy pa(cid:276)stwa (Marek Ko(cid:286)ka) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 329 1. Wst(cid:266)p . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 329 1.1. Zarys rozwoju zasad dotycz(cid:261)cych windykacji pomocy pa(cid:276)stwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 330 1.2. Zasady . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 331 1.3. Istota obowi(cid:261)zku zwrotu pomocy . . . . . . . . . . . . . . . . . . . . . . . . 332 1.4. Wyj(cid:261)tki od obowi(cid:261)zku zwrotu pomocy . . . . . . . . . . . . . . . . . . . . 333 1.4.1. Ochrona uzasadnionych oczekiwa(cid:276) i ochrona pewno(cid:286)ci prawnej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 334 1.4.2. Przedawnienie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 334 1.4.3. „Absolutna niemo(cid:298)liwo(cid:286)ć” . . . . . . . . . . . . . . . . . . . . . . . . . 335 2. Rola Komisji i organów przyznaj(cid:261)cych pomoc w pa(cid:276)stwach członkowskich . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 335 2.1. Rola Komisji Europejskiej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 336 2.2. Rola organów krajowych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 339 3. Rola s(cid:261)dów . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 341 3.1. Rola s(cid:261)dów wspólnotowych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 342 3.2. Rola s(cid:261)dów krajowych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 344 XIII Spis tre(cid:286)ci 3.2.1. Uprawnienia s(cid:261)dów krajowych w przypadku niedopełnienia obowi(cid:261)zku notyikacji . . . . . . . . . . . . . . . . 344 3.2.2. Uprawnienia s(cid:261)dów krajowych w przypadku decyzji Komisji orzekaj(cid:261)cej o zwrocie pomocy pa(cid:276)stwa . . . . . . . . 346 4. Szczegółowe zagadnienia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 349 4.1. Beneicjenci w upadło(cid:286)ci/niewypłacalni beneicjenci . . . . . . . . . 349 4.2. Problematyka zwi(cid:261)zana z wykładni(cid:261) w sprawie „Deggendorf ” . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 352 5. Konkluzje i statystyki . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 353 Indeks rzeczowy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 357 XIV Słowo wst(cid:266)pne Prawo pomocy pa(cid:276)stwa nale(cid:298)y w ostatnich latach do najbardziej dy- namicznie rozwijaj(cid:261)cych si(cid:266) dziedzin prawa wspólnotowego. Dzieje si(cid:266) tak na skutek działania wielu czynników. Cz(cid:266)(cid:286)ć z nich ma zwi(cid:261)zek ze zmiana- mi we współczesnej gospodarce (cid:286)wiatowej oraz potrzeb(cid:261) sprostania przez europejskie przedsi(cid:266)biorstwa rosn(cid:261)cej konkurencji ze strony firm z innych kontynentów. Pobudzenie rozwoju europejskiej gospodarki musi oznaczać stopniowe zmniejszanie wolumenu pomocy, przy równoczesnym precyzyj- nym jej ukierunkowaniu tam, gdzie mo(cid:298)e ona przynie(cid:286)ć najlepsze rezultaty (innowacje, badania i rozwój, inwestycje w kapitał ludzki). Wa(cid:298)nym czynnikiem w dyskusjach nad kwestiami dotycz(cid:261)cymi po- mocy pa(cid:276)stwa we Wspólnocie jest równie(cid:298) potrzeba zachowania europej- skiego modelu socjalnego, w którym szczególn(cid:261) rol(cid:266) odgrywaj(cid:261) usługi (cid:286)wiadczone w ogólnym interesie gospodarczym (np. usługi zdrowotne, tele komunikacyjne, w sektorze energetyki, transportowe, pocztowe). Finan sowanie tych usług z udziałem (cid:286)rodków publicznych zapewniać musi z jednej strony ich faktyczn(cid:261) dost(cid:266)pno(cid:286)ć dla obywateli Unii Europejskiej poł(cid:261)czon(cid:261) z wysok(cid:261) jako(cid:286)ci(cid:261) (cid:286)wiadcze(cid:276), z drugiej za(cid:286) nie mo(cid:298)e prowadzić do przyznania nadmiernych rekompensat lub nadmiernego zakłócenia kon- kurencji. Usługi te maj(cid:261) równie(cid:298) do odegrania wa(cid:298)n(cid:261) rol(cid:266) w zapewnieniu spójno(cid:286)ci socjalnej i terytorialnej Unii Europejskiej. Wpływ na wspólnotowe prawo pomocy pa(cid:276)stwa posiadaj(cid:261) równie(cid:298) tak ostatnio silnie odczuwane zjawiska zachodz(cid:261)ce w skali ogólno(cid:286)wiatowej, jak np. zmiany klimatyczne oraz zwi(cid:261)zana z tym potrzeba redukcji ilo(cid:286)ci wytwarzanych gazów cieplarnianych oraz kryzys finansowy i gospodar- czy, który w ostatnich miesi(cid:261)cach dotkn(cid:261)ł bole(cid:286)nie wiele przedsi(cid:266) biorstw i licznych mieszka(cid:276)ców pa(cid:276)stw członkowskich UE. Odpowiadaj(cid:261)c na wezwanie Rady Europejskiej do zreformowania syste mów pomocy pa(cid:276)stwa w pa(cid:276)stwach członkowskich, Komisja Euro� pejska przyj(cid:266)ła w 2005 r. plan działa(cid:276) w zakresie pomocy pa(cid:276)stwa na lata 2005–2009. W jego ramach przyj(cid:266)to na szczeblu wspólnotowym wiele no- wych regulacji o podstawowym znaczeniu dla wspólnotowego prawa po- mocy pa(cid:276)stwa. Dotycz(cid:261) one takich obszarów, jak np. pomoc regionalna, pomoc na ochron(cid:266) (cid:286)rodowiska, pomoc na badania, rozwój i innowacje, po- moc dla małych i (cid:286)rednich przedsi(cid:266)biorstw, pomoc zwi(cid:261)zana z usługami XV Słowo wst(cid:266)pne (cid:286)wiadczonymi w ogólnym interesie gospodarczym, pomoc w formie gwa- rancji pa(cid:276)stwowych, pomoc de minimis. Istotnym jest zwłaszcza, (cid:298)e no we przepisy w sprawie wył(cid:261)cze(cid:276) blokowych prowadz(cid:261) do znacznego zwi(cid:266)k- szenia odpowiedzialno(cid:286)ci pa(cid:276)stw członkowskich za prawidłowe stoso� wanie wspólnotowego prawa pomocy pa(cid:276)stwa. Refor ma obj(cid:266)ła równie(cid:298) przepisy proceduralne znajduj(cid:261)ce zastosowanie w sprawach pomocy pa(cid:276)- stwa. Prócz zmian samej procedury notyfika cyjnej, odnotować przede wszystkim nale(cid:298)y doprecyzowanie przez Komisj(cid:266) obowi(cid:261)zków pa(cid:276)stw członkowskich zwi(cid:261)zanych z windykacj(cid:261) pomocy przyznanej bezpraw- nie, a tak(cid:298)e nowe ramy współpracy mi(cid:266)dzy s(cid:261)dami krajowymi a Komisj(cid:261) w sprawach pomocy pa(cid:276)stwa. Szczególn(cid:261) rol(cid:266) w kształtowaniu wspólnotowego prawa pomocy pa(cid:276)- stwa odgrywa orzecznictwo Europejskiego Trybunału Sprawiedliwo(cid:286)ci i S(cid:261)du Pierwszej Instancji. W ostatnich latach doszło przy tym do wy- dania przez s(cid:261)dy wspólnotowe wielu precedensowych dla tej dziedziny prawa wspólno towego orzecze(cid:276). Dotycz(cid:261) one tak fundamentalnych zagad� nie(cid:276), jak np. de finicja pomocy pa(cid:276)stwa, rekompensaty z tytułu usług pu� blicznych, windykacja bezprawnej pomocy, rola s(cid:261)dów krajowych w za- pewnieniu skuteczno(cid:286)ci zakazu wykonawczego z art. 88 ust. 3 TWE. Blisko pi(cid:266)ć lat jakie dzieli nas od przyst(cid:261)pienia Polski do Unii Euro- pejskiej jasno pokazało, jak ogromn(cid:261) rol(cid:266) w (cid:298)yciu gospodarczym, społecz- nym i politycznym pa(cid:276)stwa członkowskiego odgrywa wspólnotowe prawo pomocy pa(cid:276)stwa. Warto wspomnieć w tym kontek(cid:286)cie powszechnie znany kazus polskich stoczni oraz zagadnienie kontraktów długoterminowych w polskiej energetyce. Problematyka ta jest przy tym szczególnie wa(cid:298)na nie tylko dla polskich organów szczebla centralnego (odpowiedzialnych np. za restrukturyzacj(cid:266) i prywatyzacj(cid:266) całych sektorów gospodarki), ale tak(cid:298)e dla władz regionalnych i lokalnych. Stanowi bowiem wa(cid:298)ne narz(cid:266)- dzie reali zacji przez nie polityki zwi(cid:261)zanej np. z rozwojem przedsi(cid:266)bior- czo(cid:286)ci, budow(cid:261) infrastruktury, ochron(cid:261) (cid:286)rodowiska, ochron(cid:261) dziedzictwa narodowego itd. Kwestiami tymi (cid:298)ywo interesuj(cid:261) si(cid:266) równie(cid:298) same przed- si(cid:266)biorstwa, zarówno jako beneficjenci lub potencjalni beneficjenci po- mocy, jak i jako podmioty, które odczuwaj(cid:261) niekorzystne skutki udzielenia wsparcia na rzecz przedsi(cid:266)biorstw konkurencyjnych. W polskiej literaturze prawniczej i ekonomicznej ci(cid:261)gle odczuwalny jest przy tym pewien niedo- syt wysokiej jako(cid:286)ci opracowa(cid:276) po(cid:286)wi(cid:266)conych tym zagadnieniom. Odpowiedzi(cid:261) grupy polskich prawników i ekonomistów, zwi(cid:261)zanych (aktualnie lub w przeszło(cid:286)ci) z instytucjami wspólnotowymi, na wskazane wy(cid:298)ej procesy i wyzwania, przed którymi stoj(cid:261) polskie władze i przedsi(cid:266)- biorstwa jest praca pt. „Pomoc pa(cid:276)stwa. Wybrane zagadnienia”, pod red. dra Bartłomieja Kurcza. Ksi(cid:261)(cid:298)ka ta trafia do r(cid:261)k czytelników w szczegól- XVI Słowo wst(cid:266)pne nie wa(cid:298)nym momencie. Ko(cid:276)czy si(cid:266) bowiem proces wdra(cid:298)ania na szczeblu wspólnotowym nowych rozwi(cid:261)za(cid:276) prawnych w zakresie pomocy pa(cid:276)stwa zapocz(cid:261)tkowany przez Komisj(cid:266) w 2005 r. Równocze(cid:286)nie Polska stoi przed konieczno(cid:286)ci(cid:261) doko(cid:276)czenia reform społecznych i gospodarczych zwi(cid:261)za- nych ze zmian(cid:261) systemow(cid:261) z pocz(cid:261)tku lat dziewi(cid:266)ćdziesi(cid:261)tych ubiegłego wieku. Jest to szczególnie wa(cid:298)ne w perspektywie przyst(cid:261)pienia naszego kraju w najbli(cid:298)szych latach do strefy euro. Gospodarka naszego kraju wy- maga równie(cid:298) znacznych inwestycji, które pozwol(cid:261) skutecznie zmierzyć si(cid:266) z wyzwaniami globalizacji. Istnieje zatem pilna potrzeba pogł(cid:266)bionej analizy nowego kształtu regulacji wspólnotowych dotycz(cid:261)cych wsparcia dla przedsi(cid:266)biorstw przyznawanego przez pa(cid:276)stwo lub przy u(cid:298)yciu zaso- bów pa(cid:276)stwowych. Praca ta w istotnym zakresie zaspokaja to zapotrze- bowanie. Obejmuje ona tak istotne dla Polski zagadnienia, jak np. kwe- stie pomocy dla małych i (cid:286)rednich przedsi(cid:266)biorstw, pomocy regionalnej, pomocy na ratowanie i restrukturyzacj(cid:266), pomocy na badania i rozwój, po- mocy w sektorach w(cid:266)gla kamiennego, energetyki i transportu morskiego, pomocy dla nadawców publicznych. Podkre(cid:286)lić nale(cid:298)y, i(cid:298) ksi(cid:261)(cid:298)ka została przygotowa ne przez osoby o szczególnie wysokich kwalifikacjach, które z racji obowi(cid:261)zków zawodowych w praktyce stosuj(cid:261) (stosowały) na szcze- blu wspólno towym analizowane regulacje. Zawarte w ksi(cid:261)(cid:298)ce rozwa(cid:298)ania s(cid:261) przy tym w pełni kompetentne i mocno osadzone w praktyce orzeczni- czej Komisji Europejskiej i s(cid:261)dów wspólnotowych. Daj(cid:261) one Czytelnikowi aktu alny i rzeczywisty obraz spraw pomocy pa(cid:276)stwa widziany z perspek- tywy instytu cji Wspólnoty Europejskiej. Nie trzeba dodawać, (cid:298)e akurat w tej dziedzinie ta perspektywa posiada pierwszorz(cid:266)dne znaczenie. Powy(cid:298)sze sprawia, i(cid:298) praca „Pomoc pa(cid:276)stwa. Wybrane zagadnienia” w peł ni zasługuje na zarekomendowanie jej polskim Czytelnikom. Po- winna ona zwłaszcza trafić w r(cid:266)ce urz(cid:266)dników pa(cid:276)stwowych i samorz(cid:261)- dowych wszystkich szczebli zajmuj(cid:261)cych si(cid:266) sprawami pomocy publicznej, kadry zarz(cid:261)dzaj(cid:261)cej przedsi(cid:266)biorstwami, a tak(cid:298)e prawników i ekonomi- stów (cid:286)wiadcz(cid:261)cych usługi doradcze na rzecz administracji i gospodarki. Ksi(cid:261)(cid:298)ka zasługuje równie(cid:298) na zainteresowanie i uwag(cid:266) ze strony pracow- ników naukowych i studentów z wydziałów prawa i administracji oraz uczelni ekonomicznych. Prof. UJ dr hab. Sławomir Dudzik Katedra Prawa Europejskiego Uniwersytetu Jagiello(cid:276)skiego XVII Od redaktora W literaturze po(cid:286)wi(cid:266)conej wspólnotowemu prawu konkurencji problematyka pomocy pa(cid:276)stwa, mimo i(cid:298) stanowi jego integraln(cid:261) cz(cid:266)(cid:286)ć, jest cz(cid:266)sto pomijana. Wielokrotnie traktuje si(cid:266) j(cid:261) te(cid:298) „po macoszemu” na wykładach czy sympozjach po(cid:286)wi(cid:266)conych prawu wspólnotowemu. Moim zdaniem, co unaocznił obecny kry- zys inansowy – zupełnie niezasłu(cid:298)enie. Mimo (cid:298)e art. 87 Traktatu ustanawiaj(cid:261)cego Wspólnot(cid:266) Europejsk(cid:261) (TWE) za- kazuje, co do zasady, przyznawania wybranym przedsi(cid:266)biorcom pomocy przez pa(cid:276)stwo, to jednak deklarowana w 2006 r. wielko(cid:286)ć pomocy przyznawanej przez wszystkie 27 pa(cid:276)stw członkowskich wynosiła około 80 zakładanych przycho- dów polskiego bud(cid:298)etu na rok 2008 i co najmniej 6 razy wi(cid:266)cej ni(cid:298) wyniosły wszystkie kary nało(cid:298)one przez Komisj(cid:266) w latach 1990–2007 na przedsi(cid:266)biorstwa, które naruszyły wspólno towe prawo konkurencji. Jak jest to mo(cid:298)liwe? W drodze wyj(cid:261)tku od generalnego zakazu, pomoc pa(cid:276)stwa mo(cid:298)e zostać uznana za zgodn(cid:261) ze wspólnym rynkiem. Prawo wspólnotowe zezwala na przy- znawanie takiej pomocy. Jedynym organem dla wszystkich pa(cid:276)stw członkowskich Unii Europejskiej, który jest uprawniony do orzekania o zgodno(cid:286)ci pomocy ze wspólnym rynkiem jest Komisja Europejska. Dlatego te(cid:298) dla całej rzeszy przed- si(cid:266)biorstw korzystaj(cid:261)cych z programów pomocowych (w tym cz(cid:266)sto współinan- sowanych ze wspólnotowych funduszy strukturalnych) polityka Komisji w dzie- dzinie pomocy pa(cid:276)stwa ma fundamentalne znaczenie. Wiedza o tym jak Komisja i Europejski Trybunał Sprawiedliwo(cid:286)ci podchodz(cid:261) do problematyki pomocy jest kluczowa. St(cid:261)d pomysł na ksi(cid:261)(cid:298)k(cid:266), któr(cid:261) oddajemy do r(cid:261)k Czytelników. Autorami s(cid:261) wył(cid:261)cznie urz(cid:266)dnicy lub byli pracownicy unijnych instytucji, zarówno prawnicy, jak i ekonomi(cid:286)ci, którzy zajmuj(cid:261) lub zajmowali si(cid:266) w czasie swojej dotychczaso- wej pracy problematyk(cid:261) pomocy pa(cid:276)stwa. Ich unikalne do(cid:286)wiadczenie pozwala spojrzeć na problematyk(cid:266) pomocy z innej, szerszej perspektywy ni(cid:298) krajowa. W ksi(cid:261)(cid:298)ce wyra(cid:298)aj(cid:261) oni jednak oczywi(cid:286)cie wył(cid:261)cznie własne pogl(cid:261)dy, które nie mog(cid:261) być przypisane instytucjom unijnym. Celem niniejszej publikacji nie jest kompleksowe potraktowanie wszystkich aspektów zwi(cid:261)zanych z pomoc(cid:261) pa(cid:276)stwa. Dlatego te(cid:298) z zało(cid:298)enia nie jest ona praktycznym kompendium na temat tego jak prosto uzyskać pomoc. Ambicj(cid:261) ni- niejszego zbioru esejów jest problemowe potraktowanie najciekawszych zagad- nie(cid:276) odnosz(cid:261)cych si(cid:266) do pomocy pa(cid:276)stwa. Nie tylko tych najbardziej znanych, ale równie(cid:298) tych, które odnosz(cid:261) si(cid:266) do sektorów gospodarki niecz(cid:266)sto stanowi(cid:261)cych temat opracowa(cid:276) w literaturze przedmiotu. Poruszane zagadnienia dotycz(cid:261) zasad czy wytycznych, które maj(cid:261) zastosowanie niezale(cid:298)nie od obecnego kryzysu inan- sowego. Na jego przykładzie widać jednak jak du(cid:298)a jest pokusa do rozwi(cid:261)zywa- XIX
Pobierz darmowy fragment (pdf)

Gdzie kupić całą publikację:

Pomoc państwa. Wybrane zagadnienia
Autor:
, ,

Opinie na temat publikacji:


Inne popularne pozycje z tej kategorii:


Czytaj również:


Prowadzisz stronę lub blog? Wstaw link do fragmentu tej książki i współpracuj z Cyfroteką: