Cyfroteka.pl

klikaj i czytaj online

Cyfro
Czytomierz
00879 011068 7491832 na godz. na dobę w sumie
Prawo europejskie - ebook/pdf
Prawo europejskie - ebook/pdf
Autor: Liczba stron: 393
Wydawca: C. H. Beck Język publikacji: polski
ISBN: 83-7387-896-3 Data wydania:
Lektor:
Kategoria: ebooki >> prawo i podatki
Porównaj ceny (książka, ebook, audiobook).

Podręcznik Prawo europejskie składa się z czterech części, z których:

W drugim wydaniu zamieszczono nowy rozdział na temat polityki przemieszczania się osób i układu z Schengen. Ponadto zawarto wiele uwag dotyczących Traktatu Konstytucyjnego oraz nowego orzecznictwa europejskiego.


Adresaci:


studenci prawa, jak również studenci innych wydziałów.


Znajdź podobne książki

Darmowy fragment publikacji:

Akademia Prawa Akademia Prawa Akademia Prawa Podana w przystępny i przejrzysty sposób wiedza zawarta w podręcznikach z serii pozwala na korzystanie z tych książek nie tylko studentom prawa, ale i studentom innych wydziałów. „Akademia Prawa” Podręcznik ci, z których: ü „Prawo europejskie” składa się z czterech częś- ü ü ü pierwsza przedstawia historię integracji UE oraz główne instytucje europejskie, druga prezentuje zasady funkcjonowania WE, trzecia zawiera omówienie współpracy międzyrządowej, czwarta dotyczy form współpracy w dziedzinie polityki obrony i bezpieczeństwa. drugim wydaniu W zamieszczono nowy rozdział na temat polityki przemieszczania się osób i układu z Schengen. Ponad- to zawarto wiele uwag dotyczących Traktatu Konstytucyjne- go oraz nowego orzecznictwa europejskiego. Matthias Herdegen Prawo europejskie 2. wydanie . d y w . 2 e i k s j e p o r u e o w a r P Prof. dr Matthias Herdegen – wykładowca m.in. Uniwersytetu Reńskiego im. Fryderyka Wilhelma w Bonn, autor licznych publika- cji z zakresu prawa administracyjnego, międzynarodowego i euro- pejskiego. www.sklep.beck.pl,e-mail:redakcja@beck.pl http://www.beck.pl,tel.:0223377600,fax:0223377601 ISBN 83-7387-896-3 n e g e d r e H 9 7 8 8 3 7 3 8 7 8 9 6 9 Cena 44,99 z³ C. H. Beck Wydawnictwo C. H. Beck Akademia Prawa Prawo europejskie W sprzeda¿y: M. Ahlt, M. Szpunar PRAWO EUROPEJSKIE, wyd. 4 PodrŒczniki Prawnicze M. Kenig-Witkowska (red.), R. Ostrihansky, A. £azowski PRAWO INSTYTUCJONALNE UNII EUROPEJSKIEJ, wyd. 2 PodrŒczniki Prawnicze A. £azowski (red.), A. £abŒdzka, M. Szpunar PRAWO UNII EUROPEJSKIEJ, wyd. 3 Repetytoria K. Lankosz (red.) TRAKTAT O UNII EUROPEJSKIEJ. KOMENTARZ Komentarze Becka J. Napiera‡a EUROPEJSKIE PRAWO SP(cid:211)£EK Zarys Prawa E. £Œtowska, K. Osajda NIEUCZCIWE KLAUZULE W PRAWIE UM(cid:211)W KONSUMENCKICH, wyd. 2 Orzecznictwo Europejskie M. Bernat ORZECZNICTWO TRYBUNA£U SPRAWIEDLIWO(cid:140)CI WSP(cid:211)LNOT EUROPEJSKICH W SPRAWACH GOSPODARCZYCH Orzecznictwo Europejskie PRAWO UNII EUROPEJSKIEJ Z WPROWADZENIEM, wyd. 5 Wprowadzenie E. Skibiæska Twoje Prawo www.sklep.beck.pl Prawo europejskie Dr Matthias Herdegen Profesor Uniwersytetu Reæskiego im. Fryderyka Wilhelma w Bonn 2. wydanie Wydawnictwo C.H. Beck Warszawa 2006 T‡umaczenie: Ewa Schwierskott Redakcja naukowa: Aleksander Cie(cid:156)liæski Redakcja: Izabela Dorf Wydawnictwo C. H. Beck 2006 Sk‡ad i ‡amanie: TiM-Print, Warszawa Drukarnia: P.W.P. INTERDRUK, Warszawa ISBN 83-7387-896-3 Spis tre(cid:156)ci s. Nb. WstŒp do drugiego wydania polskiego . . . . . . . . . . . . . . . . . . . XVII WstŒp do pierwszego wydania polskiego . . . . . . . . . . . . . . . . . XIX Wykaz skr(cid:243)t(cid:243)w . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXI Wykaz literatury . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXV Spis tre(cid:156)ci Spis tre(cid:156)ci Rozdzia‡ I. Wiadomo(cid:156)ci wprowadzaj„ce . . . . . . . . . . . . . . . . . . § 1. Prawo europejskie jako system powi„zanych porz„dk(cid:243)w prawnych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . I. Prawo europejskie w znaczeniu wŒ¿szym . . . . . . . . II. Prawo europejskie w znaczeniu szerszym . . . . . . . . III. Zr(cid:243)¿nicowane cele europejskich system(cid:243)w 1 1 2 4 prawnych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . IV. Wyja(cid:156)nienia terminologiczne . . . . . . . . . . . . . . . . . . . 7 9 § 2. Rada Europy. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 10 I. Cele i struktura . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 10 II. Akty prawne Rady Europy . . . . . . . . . . . . . . . . . . . . . 11 § 3. Europejska Konwencja o Ochronie Praw Cz‡owieka i Podstawowych Wolno(cid:156)ci jako og(cid:243)lnoeuropejski standard ochrony praw podstawowych . . . . . . . . . . . . . . . 13 1 2 5 11 13 14 14 17 18 V Spis tre(cid:156)ci s. Nb. I. Znaczenie Konwencji . . . . . . . . . . . . . . . . . . . . . . . . . . 13 II. Organy konwencyjne . . . . . . . . . . . . . . . . . . . . . . . . . . 15 III. PostŒpowanie. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 16 IV. Orzecznictwo Trybuna‡u dotycz„ce poszczeg(cid:243)lnych praw zagwarantowanych w Konwencji . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 21 1. Autonomiczna wyk‡adnia praw 18 20 22 24 zagwarantowanych w Konwencji . . . . . . . . . . . . . 21 24 2. Obowi„zki paæstwa w zakresie ochrony praw i wolno(cid:156)ci wed‡ug Konwencji . . . . . . . . . . . . . . . . . 23 3. Zakaz nieludzkiego traktowania . . . . . . . . . . . . . . 23 3.1. Ekstradycja . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 24 3.2. Wydalenie cudzoziemca . . . . . . . . . . . . . . . . . 24 3.3. Kara (cid:156)mierci . . . . . . . . . . . . . . . . . . . . . . . . . . . . 25 4. Ochrona rodziny i ¿ycia prywatnego . . . . . . . . . . 25 5. Wolno(cid:156)(cid:230) wyra¿ania opinii . . . . . . . . . . . . . . . . . . . . 26 6. Ochrona w‡asno(cid:156)ci . . . . . . . . . . . . . . . . . . . . . . . . . . 26 7. Zakaz dyskryminacji . . . . . . . . . . . . . . . . . . . . . . . . 29 8. Granice praw zagwarantowanych w Konwencji . 29 V. Obowi„zywanie Konwencji w prawie krajowym . . 32 VI. Znaczenie Konwencji dla ochrony praw § 4. Rozw(cid:243)j Wsp(cid:243)lnot Europejskich i Unii Europejskiej podstawowych Unii Europejskiej . . . . . . . . . . . . . . . 33 . . . . . 36 I. Europejska Wsp(cid:243)lnota WŒgla i Stali . . . . . . . . . . . . . 37 II. Traktaty Rzymskie: utworzenie Europejskiej Wsp(cid:243)lnoty Gospodarczej i Europejskiej Wsp(cid:243)lnoty Energii Atomowej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39 III. Dalsza rozbudowa porz„dku wsp(cid:243)lnotowego . . . . 40 IV. Traktat z Maastricht o Unii Europejskiej . . . . . . . . . . 41 1. Ustanowienie Unii Europejskiej . . . . . . . . . . . . . . . 42 2. Zmiany w Traktatach wsp(cid:243)lnotowych . . . . . . . . . 42 3. Umowa o polityce spo‡ecznej . . . . . . . . . . . . . . . . . 43 V. Europejski Obszar Gospodarczy . . . . . . . . . . . . . . . . 43 VI. Rozszerzenie Unii Europejskiej w 1995 r. . . . . . . . . . 44 VII. OdrŒbne nurty prawa wsp(cid:243)lnotowego (umowy z Schengen i Dublina) . . . . . . . . . . . . . . . . . 44 VIII. Traktat z Amsterdamu . . . . . . . . . . . . . . . . . . . . . . . . . 45 IX. Traktat z Nicei . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 46 X. Rozszerzenie Unii Europejskiej w 2004 r. . . . . . . . . . 47 26 27 28 29 30 31 32 33 36 37 40 41 43 43 46 48 51 53 54 55 56 57 58 59 63 64 VI Spis tre(cid:156)ci s. Nb. XI. Zakres terytorialny obowi„zywania prawa Unii Europejskiej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 48 65 XII. Konwent Europejski i Traktat ustanawiaj„cy KonstytucjŒ dla Europy . . . . . . . . . . . . . . . . . . . . . . . . 50 § 5. Struktura Unii Europejskiej . . . . . . . . . . . . . . . . . . . . . . . . . . 52 I. Trzy filary Unii Europejskiej . . . . . . . . . . . . . . . . . . . . 52 II. Rada Europejska jako kierowniczy organ Unii 66 67 67 Europejskiej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53 69 III. Wsp(cid:243)‡dzia‡anie organ(cid:243)w wsp(cid:243)lnotowych w II i III filarze . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54 IV. Relacja Wsp(cid:243)lnoty (cid:150) Unia Europejska. . . . . . . . . . . . 55 V. Powi„zanie Traktat(cid:243)w wsp(cid:243)lnotowych z Traktatem o UE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 56 VI. Wzmocniona wsp(cid:243)‡praca . . . . . . . . . . . . . . . . . . . . . . 57 70 72 74 75 § 6. Charakter prawny Wsp(cid:243)lnot Europejskich i Unii Europejskiej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58 76 I. Wsp(cid:243)lnoty Europejskie jako organizacje miŒdzynarodowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58 1. Podmiotowo(cid:156)(cid:230) prawna w prawie 76 miŒdzynarodowym . . . . . . . . . . . . . . . . . . . . . . . . . 58 76 2. Obowi„zywanie powszechnego prawa miŒdzynarodowego . . . . . . . . . . . . . . . . . . . . . . . . . 59 2.1. Zwi„zanie Wsp(cid:243)lnot Europejskich . . . . . . . . . 59 2.2. Prawo wsp(cid:243)lnotowe a stosunki prawnomiŒdzynarodowe miŒdzy paæstwami cz‡onkowskimi . . . . . . . . . . . . . . . . . . . . . . . . . . 60 3. Zdolno(cid:156)(cid:230) prawna w wewnŒtrznym obrocie prawnym . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 61 4. Przywileje i immunitety . . . . . . . . . . . . . . . . . . . . . 61 II. Ponadnarodowy charakter Wsp(cid:243)lnot Europejskich 61 1. Prawo wsp(cid:243)lnotowe jako autonomiczny system 78 78 79 80 81 82 prawny . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 62 83 2. (cid:132)Bezpo(cid:156)rednie obowi„zywanie(cid:148) prawa pochodnego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 63 III. Charakter prawny Unii Europejskiej . . . . . . . . . . . . . 64 IV. System Unii Europejskiej jako (cid:132)zwi„zek paæstw(cid:148) . 65 § 7. Stosunek Wsp(cid:243)lnot Europejskich i Unii Europejskiej do paæstw cz‡onkowskich . . . . . . . . . . . . . . . . . . . . . . . . . . . 68 68 I. Paæstwa cz‡onkowskie jako (cid:132)w‡odarze Traktat(cid:243)w(cid:148) 84 85 87 89 90 VII Spis tre(cid:156)ci s. Nb. II. Przyst„pienie i wyst„pienie paæstwa cz‡onkowskiego z Unii Europejskiej . . . . . . . . . . . . . 70 1. Przyst„pienie nowego paæstwa cz‡onkowskiego 70 2. Wyst„pienie paæstwa cz‡onkowskiego z Unii . . . 71 III. Podstawowe zasady w relacjach miŒdzy Wsp(cid:243)lnotami a paæstwami cz‡onkowskimi . . . . . . . 72 1. Obowi„zek lojalno(cid:156)ci i wierno(cid:156)ci Traktatowi (art. 10 TWE) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 72 2. Koordynacja polityk gospodarczych 93 93 94 96 96 98 (art. 4 TWE) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 73 3. Zakaz dyskryminacji (art. 12 TWE) . . . . . . . . . . . . 74 99 4. Zasada pomocniczo(cid:156)ci . . . . . . . . . . . . . . . . . . . . . . . 78 102 5. Klauzule ochronne i na wypadek stan(cid:243)w wyj„tkowych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 79 104 IV. Podstawowe warto(cid:156)ci Unii Europejskiej. . . . . . . . . . . 80 105 Rozdzia‡ II. Wsp(cid:243)lnoty Europejskie jako rdzeæ Unii Europejskiej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 83 § 8. Instytucje Wsp(cid:243)lnot Europejskich . . . . . . . . . . . . . . . . . . . . 83 106 I. Przegl„d . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 83 106 1. Wzajemne relacje dw(cid:243)ch Wsp(cid:243)lnot i ich wsp(cid:243)lnych organ(cid:243)w. . . . . . . . . . . . . . . . . . . . . . . . . 83 106 2. Organy naczelne . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 107 3. Podzia‡ funkcji w systemie wsp(cid:243)lnotowym . . . . . 85 112 4. Siedziba organ(cid:243)w . . . . . . . . . . . . . . . . . . . . . . . . . . . 86 113 5. Aparat administracyjny . . . . . . . . . . . . . . . . . . . . . . 87 114 6. Porozumienia miŒdzy organami . . . . . . . . . . . . . . 87 115 II. Rada Unii Europejskiej. . . . . . . . . . . . . . . . . . . . . . . . . 88 116 1. Uwagi wstŒpne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 88 116 2. Sk‡ad i aspekty organizacyjne. . . . . . . . . . . . . . . . . 89 117 2.1. Sk‡ad . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 89 117 2.2. Komitet Sta‡ych Przedstawicieli i Sekretariat Generalny jako organy pomocnicze . . . . . . . . 89 118 2.3. Regulamin Rady . . . . . . . . . . . . . . . . . . . . . . . . 90 119 3. Podejmowanie decyzji . . . . . . . . . . . . . . . . . . . . . . . 90 121 4. Zadania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 95 126 III. Komisja . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 128 1. Uwagi og(cid:243)lne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 128 2. Sk‡ad Komisji. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 129 3. Podejmowanie decyzji i Regulamin wewnŒtrzny 99 130 VIII Spis tre(cid:156)ci s. Nb. 4. Zadania. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 100 131 5. Organizacja wewnŒtrzna . . . . . . . . . . . . . . . . . . . . . 101 135 IV. Parlament Europejski. . . . . . . . . . . . . . . . . . . . . . . . . . . 103 136 1. Uwagi og(cid:243)lne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 103 136 2. Sk‡ad i organizacja . . . . . . . . . . . . . . . . . . . . . . . . . . 103 137 3. Zadania. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 107 140 4. Partie polityczne . . . . . . . . . . . . . . . . . . . . . . . . . . . . 109 141 V. Trybuna‡ Sprawiedliwo(cid:156)ci . . . . . . . . . . . . . . . . . . . . . . 109 142 1. Uwagi og(cid:243)lne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 109 142 2. Organizacja i tryb postŒpowania przed Trybuna‡em Sprawiedliwo(cid:156)ci . . . . . . . . . . . . . . . . . 110 144 3. S„d Pierwszej Instancji. . . . . . . . . . . . . . . . . . . . . . . 111 146 4. Orzecznictwo Trybuna‡u Sprawiedliwo(cid:156)ci jako czynnik integracyjny . . . . . . . . . . . . . . . . . . . . . . . . 112 147 VI. Trybuna‡ Obrachunkowy . . . . . . . . . . . . . . . . . . . . . . . 113 148 VII. Organy opiniodawcze . . . . . . . . . . . . . . . . . . . . . . . . . . 113 149 1. Komitet Ekonomiczno-Spo‡eczny . . . . . . . . . . . . . 113 149 2. Komitet Region(cid:243)w . . . . . . . . . . . . . . . . . . . . . . . . . . 114 150 VIII. Pozosta‡e instytucje . . . . . . . . . . . . . . . . . . . . . . . . . . . . 114 151 1. Europejski Bank Inwestycyjny . . . . . . . . . . . . . . . . 114 151 2. Inne samodzielne instytucje urzeczywistniaj„ce cele traktatowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 114 152 IX. Zasada r(cid:243)wnowagi instytucjonalnej . . . . . . . . . . . . . . 115 153 § 9. (cid:143)r(cid:243)d‡a prawa wsp(cid:243)lnotowego . . . . . . . . . . . . . . . . . . . . . . . 116 154 I. WstŒp . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 116 154 II. Pierwotne prawo wsp(cid:243)lnotowe . . . . . . . . . . . . . . . . . 117 155 1. Traktaty ustanawiaj„ce Wsp(cid:243)lnoty i ich czŒ(cid:156)ci sk‡adowe jako porz„dek prawny Wsp(cid:243)lnot . . . . . 117 156 1.1. Zasady podstawowe . . . . . . . . . . . . . . . . . . . . . 118 157 1.2. Zmiana Traktat(cid:243)w . . . . . . . . . . . . . . . . . . . . . . . 118 158 1.3. Bezpo(cid:156)rednia skuteczno(cid:156)(cid:230) postanowieæ traktatowych. . . . . . . . . . . . . . . . . . . . . . . . . . . . 120 161 2. Og(cid:243)lne zasady prawa wsp(cid:243)lnotowego . . . . . . . . . 122 163 3. Karta Praw Podstawowych Unii Europejskiej . . . 126 169 III. Pochodne prawo wsp(cid:243)lnotowe . . . . . . . . . . . . . . . . . 129 171 1. Rozporz„dzenie . . . . . . . . . . . . . . . . . . . . . . . . . . . . 129 172 2. Dyrektywy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 130 173 2.1. Nakaz skutecznej implementacji dyrektyw. . 131 176 2.2. Wyk‡adnia dyrektyw. . . . . . . . . . . . . . . . . . . . . 132 178 2.3. Bezpo(cid:156)rednia skuteczno(cid:156)(cid:230) dyrektyw . . . . . . . 133 179 IX Spis tre(cid:156)ci s. Nb. 3. Decyzje . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 135 182 4. Zalecenia i opinie . . . . . . . . . . . . . . . . . . . . . . . . . . . 136 183 5. Inne akty prawne . . . . . . . . . . . . . . . . . . . . . . . . . . . 136 184 6. Akty prawne w Traktacie Konstytucyjnym . . . . . 136 185 IV. Kompetencje Wsp(cid:243)lnot (Unii Europejskiej) oraz zasada kompetencji powierzonych . . . . . . . . . . 137 186 1. Podstawa traktatowa dla kompetencji organ(cid:243)w . 137 186 2. Niepisane kompetencje wsp(cid:243)lnotowe. . . . . . . . . . 138 188 3. Uprawnienie generalne wynikaj„ce z art. 308 TWE 139 190 4. Typologia kompetencji wsp(cid:243)lnotowych . . . . . . . . 139 191 5. Dyskusja na temat kompetencji . . . . . . . . . . . . . . . 140 192 6. Porz„dek kompetencyjny w Europejskim Traktacie Konstytucyjnym. . . . . . . . . . . . . . . . . . . . 142 194 V. Stanowienie prawa . . . . . . . . . . . . . . . . . . . . . . . . . . . . 142 195 1. Uwagi og(cid:243)lne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 142 195 2. Wsp(cid:243)‡dzia‡anie Parlamentu Europejskiego . . . . . 143 196 3. Wydawanie przepis(cid:243)w wykonawczych . . . . . . . . 145 200 VI. Wyk‡adnia prawa wsp(cid:243)lnotowego i rozw(cid:243)j prawa dokonywany przez s„dy . . . . . . . . . . . . . . . . . . . . . . . 146 201 VII. Domniemanie wa¿no(cid:156)ci akt(cid:243)w prawnych wydawanych przez organy wsp(cid:243)lnotowe . . . . . . . . 146 202 § 10. System ochrony prawa wsp(cid:243)lnotowego . . . . . . . . . . . . . . . 147 203 I. Trybuna‡ Sprawiedliwo(cid:156)ci jako gwarant ochrony prawa wsp(cid:243)lnotowego. . . . . . . . . . . . . . . . . . . . . . . . . 147 203 II. PostŒpowanie w razie naruszenia zobowi„zaæ traktatowych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 148 205 1. Skarga Komisji . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 148 205 2. Skarga paæstwa cz‡onkowskiego . . . . . . . . . . . . . . 149 206 3. (cid:140)rodki podejmowane wed‡ug zasad prawa III. Skarga o stwierdzenie niewa¿no(cid:156)ci miŒdzynarodowego . . . . . . . . . . . . . . . . . . . . . . . . . 149 207 . . . . . . . . . . . . . 150 208 1. Uwagi og(cid:243)lne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 150 208 2. Sp(cid:243)r miŒdzy organami. . . . . . . . . . . . . . . . . . . . . . . 151 209 3. Skarga o stwierdzenie niewa¿no(cid:156)ci wniesiona przez osoby prawne i fizyczne . . . . . . . . . . . . . . . . 152 212 3.1. Skarga na orzeczenia os(cid:243)b trzecich. . . . . . . . . . . 153 213 3.2. Skarga przeciwko aktom normatywnym. . . . . . 154 214 IV. Skarga na bezczynno(cid:156)(cid:230) organu (na zaniechanie). . . 155 217 V. Skarga prejudycjalna . . . . . . . . . . . . . . . . . . . . . . . . . . 155 218 1. Przedmiot i znaczenie . . . . . . . . . . . . . . . . . . . . . . . 155 218 X Spis tre(cid:156)ci s. Nb. 2. Podmioty uprawnione do zadawania pytaæ prawnych i obowi„zek zadawania pytaæ prawnych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 156 219 3. Wyj„tki od wa¿no(cid:156)ci prawa pochodnego: monopol Trybuna‡u odno(cid:156)nie uznania orzeczeæ za niewa¿ne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 157 220 4. Tymczasowa ochrona prawna . . . . . . . . . . . . . . . . 158 221 5. Dzia‡ania wi„¿„ce i postanowienie wstŒpne . . . . 160 222 VI. Skarga o odszkodowanie i odpowiedzialno(cid:156)(cid:230) Wsp(cid:243)lnot . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 161 223 VII. Rola sŒdziego. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 162 224 § 11. Prawo wsp(cid:243)lnotowe a prawo krajowe. . . . . . . . . . . . . . . . . 163 226 I. Prymat prawa wsp(cid:243)lnotowego. . . . . . . . . . . . . . . . . . 163 226 II. Odpowiedzialno(cid:156)(cid:230) paæstw cz‡onkowskich za naruszenie prawa wsp(cid:243)lnotowego . . . . . . . . . . . . . . 168 230 1. Odpowiedzialno(cid:156)(cid:230) paæstwa za brak implementacji dyrektyw . . . . . . . . . . . . . . . . . . . . . 168 230 2. Odpowiedzialno(cid:156)(cid:230) za akty ustawodawcze i akty postŒpowania administracyjnego . . . . . . . . 170 233 3. Wykonywanie prawa wsp(cid:243)lnotowego w prawie krajowym . . . . . . . . . . . . . . . . . . . . . . . . . 173 237 § 12. Finanse Wsp(cid:243)lnot Europejskich . . . . . . . . . . . . . . . . . . . . . . 175 238 I. Bud¿et. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 175 238 II. Dochody i wydatki bud¿etowe . . . . . . . . . . . . . . . . . 177 242 1. Dochody bud¿etowe . . . . . . . . . . . . . . . . . . . . . . . . 177 242 2. Wydatki bud¿etowe . . . . . . . . . . . . . . . . . . . . . . . . . 178 243 III. Dzia‡alno(cid:156)(cid:230) finansowa nieprzewidziana w bud¿ecie Wsp(cid:243)lnoty. . . . . . . . . . . . . . . . . . . . . . . . . 178 244 § 13. Obywatelstwo Unii . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 179 245 I. Znaczenie obywatelstwa unijnego . . . . . . . . . . . . . . 179 245 II. Swoboda przemieszczania siŒ i przebywania na terytorium paæstw cz‡onkowskich jako prawo obywatela Unii . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 180 247 III. Prawa polityczne. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 183 251 1. Prawo do uczestnictwa w wyborach komunalnych. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 183 251 2. Wybory do Parlamentu Europejskiego . . . . . . . . . 184 253 IV. Ochrona dyplomatyczna i konsularna . . . . . . . . . . . 185 254 § 14. Wsp(cid:243)lny rynek i rynek wewnŒtrzny . . . . . . . . . . . . . . . . . . 186 255 XI Spis tre(cid:156)ci s. Nb. I. Wsp(cid:243)lny rynek i rynek wewnŒtrzny jako cele integracji gospodarczej . . . . . . . . . . . . . . . . . . . . . . . . 186 255 II. Instrumenty s‡u¿„ce do urzeczywistnienia rynku wewnŒtrznego. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 188 258 III. Znaczenie generalnego upowa¿nienia wynikaj„cego z art. 308 TWE . . . . . . . . . . . . . . . . . . . 189 259 § 15. Swobody rynku wewnŒtrznego . . . . . . . . . . . . . . . . . . . . . . 190 260 I. Swobody jako filar rynku wewnŒtrznego . . . . . . . . 190 260 II. Wsp(cid:243)lna struktura: swobody jako podstawa zakazu ograniczeæ i dyskryminacji . . . . . . . . . . . . . . 190 261 III. Ochrona prawna . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 192 263 § 16. Swobodny przep‡yw towar(cid:243)w . . . . . . . . . . . . . . . . . . . . . . . 194 265 I. Zniesienie ce‡ wewnŒtrznych i op‡at o skutku r(cid:243)wnowa¿nym . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 194 265 II. Zakaz ograniczeæ ilo(cid:156)ciowych i (cid:156)rodk(cid:243)w o r(cid:243)wnowa¿nym skutku . . . . . . . . . . . . . . . . . . . . . . . 195 266 1. Znaczenie dla rynku wewnŒtrznego . . . . . . . . . . . 195 266 2. (cid:140)rodki o skutku r(cid:243)wnowa¿nym (cid:150) formu‡a Dassonville . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 196 267 3. Granice niedyskryminuj„cych ograniczeæ sprzeda¿y w my(cid:156)l zakazu art. 28 TWE (cid:150) formu‡a Keck . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 197 269 III. Uzasadnienia ograniczeæ w handlu. . . . . . . . . . . . . . 200 272 1. Wymogi konieczne wynikaj„ce z art. 28 TWE (cid:150) Cassis de Dijon . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 200 273 2. Uzasadnienie ograniczeæ w przep‡ywie towar(cid:243)w wed‡ug art. 30 TWE . . . . . . . . . . . . . . . . . 202 274 3. Zasada proporcjonalno(cid:156)ci . . . . . . . . . . . . . . . . . . . . 203 275 4. Ochrona w‡asno(cid:156)ci przemys‡owej i handlowej . . 207 279 IV. Oddzia‡ywanie orzecznictwa Trybuna‡u Sprawiedliwo(cid:156)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 211 282 V. Monopole o charakterze handlowym . . . . . . . . . . . . 212 283 § 17. Swobodny przep‡yw os(cid:243)b . . . . . . . . . . . . . . . . . . . . . . . . . . . 212 284 I. Swoboda przep‡ywu pracownik(cid:243)w. . . . . . . . . . . . . . 212 285 1. Przedmiot swobody przep‡ywu pracownik(cid:243)w . . 213 286 2. Naruszenie swobody przep‡ywu pracownik(cid:243)w przez podmioty trzecie . . . . . . . . . . . . . . . . . . . . . . 215 290 3. Ograniczenia i wyj„tki . . . . . . . . . . . . . . . . . . . . . . . 216 291 4. Prawo pochodne . . . . . . . . . . . . . . . . . . . . . . . . . . . . 217 292 II. Swoboda przedsiŒbiorczo(cid:156)ci. . . . . . . . . . . . . . . . . . . . 220 295 XII Spis tre(cid:156)ci s. Nb. 1. Zakres swobody przedsiŒbiorczo(cid:156)ci . . . . . . . . . . . 220 295 2. Ograniczenia i wyj„tki . . . . . . . . . . . . . . . . . . . . . . . 224 299 3. Prawo pochodne . . . . . . . . . . . . . . . . . . . . . . . . . . . . 224 300 III. Dyskryminacja na niekorzy(cid:156)(cid:230) w‡asnego obywatela . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 225 301 § 18. Swoboda (cid:156)wiadczenia us‡ug . . . . . . . . . . . . . . . . . . . . . . . . . 226 302 I. Przedmiot swobody (cid:156)wiadczenia us‡ug . . . . . . . . . . 226 302 II. Dopuszczalno(cid:156)(cid:230) ograniczeæ . . . . . . . . . . . . . . . . . . . . 229 303 III. Regulacja swobody (cid:156)wiadczenia us‡ug w prawie pochodnym . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 231 305 § 19. Swoboda przep‡ywu kapita‡u i p‡atno(cid:156)ci . . . . . . . . . . . . . . 234 308 § 20. Zbli¿anie prawodawstw krajowych . . . . . . . . . . . . . . . . . . . 237 311 I. Pochodne prawo wsp(cid:243)lnotowe . . . . . . . . . . . . . . . . . 237 311 II. Zbli¿anie prawa poprzez umowy prawa miŒdzynarodowego . . . . . . . . . . . . . . . . . . . . . . . . . . . 241 315 § 21. Regulacja swobody przep‡ywu os(cid:243)b i wsp(cid:243)‡praca w sprawach cywilnych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 241 316 I. Polityka swobody przep‡ywu os(cid:243)b . . . . . . . . . . . . . . 241 316 II. Re¿im z Schengen . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 242 317 III. Wsp(cid:243)‡praca s„dowa w sprawach cywilnych . . . . . . 244 321 § 22. Rolnictwo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 245 322 § 23. Prawo konkurencji . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 248 327 I. Uwagi og(cid:243)lne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 248 327 II. Zakaz karteli z art. 81 TWE . . . . . . . . . . . . . . . . . . . . . 249 329 1. Zakaz porozumieæ wp‡ywaj„cych na konkurencjŒ (art. 81 ust. 1 TWE). . . . . . . . . . . . . . . 249 329 2. Klauzula niewa¿no(cid:156)ci . . . . . . . . . . . . . . . . . . . . . . . 251 332 3. Wyj„tki (art. 81 ust. 3 TWE). . . . . . . . . . . . . . . . . . . 251 333 III. Zakaz nadu¿ywania pozycji dominuj„cej (art. 82 TWE) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 252 334 IV. W‡a(cid:156)ciwo(cid:156)(cid:230) i postŒpowanie administracyjne . . . . . 256 338 V. Kontrola koncentracji . . . . . . . . . . . . . . . . . . . . . . . . . . 258 341 VI. Ekstraterytorialna skuteczno(cid:156)(cid:230) prawa konkurencji. 259 343 VII. PrzedsiŒbiorstwa publiczne (art. 86 TWE) . . . . . . . . 260 344 VIII. Wzajemna relacja miŒdzy wsp(cid:243)lnotowym i krajowym prawem konkurencji . . . . . . . . . . . . . . . . 263 350 IX. Pomoc publiczna. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 264 351 X. Problemy konkurencji w prawie miŒdzynarodowym . . . . . . . . . . . . . . . . . . . . . . . . . . . 266 353 XIII Spis tre(cid:156)ci s. Nb. XI. DostŒp do sieci w sektorze energetycznym i innych sektorach. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 267 354 § 24. Polityka handlowa. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 268 355 I. Uwagi og(cid:243)lne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 268 355 II. Wsp(cid:243)lna taryfa celna . . . . . . . . . . . . . . . . . . . . . . . . . . 271 360 § 25. Ochrona (cid:156)rodowiska naturalnego. . . . . . . . . . . . . . . . . . . . . 272 362 § 26. Polityka spo‡eczna. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 276 370 I. Uwagi og(cid:243)lne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 276 370 II. Wprowadzenie porozumienia o polityce spo‡ecznej do TWE . . . . . . . . . . . . . . . . . . . . . . . . . . . . 277 371 III. Mechanizmy urzeczywistnienia prawa. . . . . . . . . . . 278 372 IV. Zakaz dyskryminacji na rynku pracy ze wzglŒdu na p‡e(cid:230). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 279 373 § 27. Inne polityki . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 284 379 I. Zatrudnienie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 284 379 II. Transport . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 285 380 III. Edukacja i kultura. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 286 381 IV. Ochrona zdrowia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 287 382 V. Ochrona konsument(cid:243)w . . . . . . . . . . . . . . . . . . . . . . . . 287 383 VI. Energetyka . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 288 384 VII. Przemys‡. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 288 385 VIII. Polityka regionalna. . . . . . . . . . . . . . . . . . . . . . . . . . . . 288 386 IX. Badania i rozw(cid:243)j technologiczny . . . . . . . . . . . . . . . . 289 387 § 28. Polityka gospodarcza i pieniŒ¿na: unia gospodarcza i walutowa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 289 388 I. Polityka gospodarcza . . . . . . . . . . . . . . . . . . . . . . . . . . 290 389 1. Podstawy traktatowe . . . . . . . . . . . . . . . . . . . . . . . . 290 389 2. Pakt Stabilno(cid:156)ci i Rozwoju . . . . . . . . . . . . . . . . . . . 292 391 II. Polityka pieniŒ¿na . . . . . . . . . . . . . . . . . . . . . . . . . . . . 295 394 III. Unia walutowa jako wyznacznik stabilno(cid:156)ci Wsp(cid:243)lnoty . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 296 395 IV. System instytucji w unii walutowej. . . . . . . . . . . . . . . 297 396 V. Europejski System Walutowy (cid:150) zarys historyczny . . 299 401 VI. Stopniowe urzeczywistnienie unii gospodarczej i walutowej. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 301 403 1. Pierwszy i drugi etap . . . . . . . . . . . . . . . . . . . . . . . . 301 404 2. Realizacja trzeciego etapu . . . . . . . . . . . . . . . . . . . . 302 405 2.1. Kryteria konwergencji. . . . . . . . . . . . . . . . . . . . 302 406 2.2. Plan czasowy i procedura postŒpowania. . . . 306 413 2.3. Paæstwa cz‡onkowskie unii walutowej. . . . . . 307 415 XIV Spis tre(cid:156)ci s. Nb. 2.4. Paæstwa cz‡onkowskie objŒte derogacj„. . . . . 308 416 2.5. Wyst„pienie z unii walutowej . . . . . . . . . . . . . 309 417 § 29. Stosunki zewnŒtrzne. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 310 418 I. Kompetencje w stosunkach zewnŒtrznych . . . . . . . 310 418 II. Skutki um(cid:243)w miŒdzynarodowych w prawie wsp(cid:243)lnotowym . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 313 421 III. Wsp(cid:243)lnota Europejska i handel miŒdzynarodowy (GATT/WTO). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 313 422 1. Zwi„zanie Wsp(cid:243)lnoty Europejskiej prawem miŒdzynarodowym . . . . . . . . . . . . . . . . . . . . . . . . . 313 422 2. Skuteczno(cid:156)(cid:230) przepis(cid:243)w WTO w prawie wsp(cid:243)lnotowym . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 314 424 IV. Umowy stowarzyszeniowe . . . . . . . . . . . . . . . . . . . . . 319 431 V. Europejski Obszar Gospodarczy . . . . . . . . . . . . . . . . 321 436 VI. Stosunki transatlantyckie . . . . . . . . . . . . . . . . . . . . . . 322 437 Rozdzia‡ III. Wsp(cid:243)‡praca miŒdzyrz„dowa i perspektywa reform w Unii Europejskiej. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 325 § 30. Wsp(cid:243)lna Polityka Zagraniczna i Bezpieczeæstwa . . . . . . . 325 439 § 31. Wsp(cid:243)‡praca Policyjna i S„dowa w Sprawach Karnych . . . 332 446 § 32. Perspektywy rozwoju Unii Europejskiej . . . . . . . . . . . . . . . 336 451 § 33. Traktat Konstytucyjny dla Europy . . . . . . . . . . . . . . . . . . . . 338 453 I. Dyskusje w sprawie Konstytucji . . . . . . . . . . . . . . . . 338 453 II. Zmiany w Traktacie Konstytucyjnym w formie opracowanej przez Konwent Europejski. . . . . . . . . . 339 454 Rozdzia‡ IV. Inne formy wsp(cid:243)‡pracy w dziedzinie polityki obronnej i bezpieczeæstwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 341 § 34. Unia Zachodnioeuropejska . . . . . . . . . . . . . . . . . . . . . . . . . . 341 455 I. Unia Zachodnioeuropejska jako sojusz obronny i jako system wsp(cid:243)lnego bepieczeæstwa . . . . . . . . . . 341 455 II. Przeniesienie zadaæ UZE na UniŒ Europejsk„ . . . . . 343 459 § 35. Organizacja Bezpieczeæstwa i Wsp(cid:243)‡pracy w Europie (OBWE) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 344 460 I. Rozw(cid:243)j od KBWE do OBWE. . . . . . . . . . . . . . . . . . . . 344 460 II. Instytucje . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 347 468 Indeks rzeczowy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 351 XV WstŒp do drugiego wydania polskiego WstŒp do drugiego wydania polskiego WstŒp do drugiego wydania polskiego Przyjazne przyjŒcie niniejszego podrŒcznika, jakie w stosunkowo kr(cid:243)t- kim czasie zgotowali mu polscy czytelnicy, zadecydowa‡o o konieczno- (cid:156)ci drugiego wydania. Jestem niezwykle zaszczycony, ¿e dr Ewa Schwierskott podjŒ‡a siŒ t‡umaczenia licznych zmian i uzupe‡nieæ, jakie zasz‡y w ksi„¿ce. Szcze- g(cid:243)lnie jestem jej wdziŒczny za okazane z jej strony zaanga¿owanie i pre- cyzjŒ w wykonanej przez ni„ pracy. Drugie wydanie koncentruje siŒ na opisie licznych reform dokonu- j„cych siŒ w Unii Europejskiej. Do rozdzia‡u po(cid:156)wiŒconego Europejskiej Konwencji Praw Cz‡owieka dodany zosta‡ opis wydanych w ostatnich latach wyrok(cid:243)w Europejskiego Trybuna‡u Praw Cz‡owieka oraz om(cid:243)wio- ny zakres ich oddzia‡ywania w prawie krajowym. W nowym wydaniu zosta‡o uwzglŒdnione tak¿e nowe orzecznictwo Trybuna‡u Sprawiedli- wo(cid:156)ci. Kolejna czŒ(cid:156)(cid:230) po(cid:156)wiŒcona zosta‡a Unii Gospodarczej i Walutowej, w kt(cid:243)rej dokonano wa¿nych reform w Pakcie Stabilizacji i Rozwoju w imiŒ zwiŒkszonej elastyczno(cid:156)ci podejmowanych rozwi„zaæ przy obecnym braku rozwoju gospodarczego. Wynik referendum we Francji na temat przysz‡o(cid:156)ci Traktatu Konsty- tucyjnego, kt(cid:243)re odby‡o siŒ w maju 2005 r. oraz referendum holender- XVII WstŒp do drugiego wydania polskiego skiego (kt(cid:243)rego wynik nie jest jednak wi„¿„cy) s„ bez w„tpienia ciŒ¿k„ klŒsk„ dla wszystkich, kt(cid:243)rzy mieli nadziejŒ na ustanowienie nowej pod- stawy traktatowej dla Unii Europejskiej. Mimo niejasnej przysz‡o(cid:156)ci Trak- tatu jego tekst zostaje poddany intensywnym dyskusjom na temat przy- sz‡ego obrazu Unii Europejskiej i bŒdzie mia‡ decyduj„cy wp‡yw na wszelkie przysz‡e prace reformatorskie. Bonn, marzec 2006 r. Matthias Herdegen XVIII WstŒp do pierwszego wydania polskiego WstŒp do pierwszego wydania polskiego WstŒp do pierwszego wydania polskiego Zgodnie z postanowieniami Traktatu Akcesyjnego podpisanego w kwietniu 2003 r. w Atenach, Rzeczpospolita Polska (cid:150) wraz z 10 innymi paæstwami (cid:150) stanie siŒ cz‡onkiem Unii Europejskiej oraz obu Wsp(cid:243)lnot Europejskich. Prawo Europejskie bŒdzie tym samym nieodzown„ czŒ- (cid:156)ci„ wykszta‡cenia prawnik(cid:243)w w Polsce, tak jak od dawna jest to w kra- jach cz‡onkowskich. CieszŒ siŒ bardzo, ¿e Pani dr Ewa Schwierskott podjŒ‡a siŒ zadania przet‡umaczenia mojego podrŒcznika na jej jŒzyk polski. Wykona‡a to zadanie z du¿ym zaaga¿owaniem, wykazuj„c siŒ doskona‡„ wiedz„ fa- chow„. Szczeg(cid:243)lnie wdziŒczny jestem za to, ¿e Pani dr Ewa Schwierskott szuka‡a zawsze kontaktu z autorem, by w interesie polskiego Czytelnika uzyska(cid:230) mo¿liwie wysoki stopieæ jasno(cid:156)ci i precyzyjno(cid:156)ci t‡umaczenia. Pani dr Ewa Schwierskott, aby zapewni(cid:230) aktualno(cid:156)(cid:230) podrŒcznika, do‡o¿y‡a wszelkich staraæ, by zosta‡y uwzglŒdnione najnowsze zmiany i tendencje w rozwoju prawa europejskiego. Bonn, lipiec 2003 r. Matthias Herdegen XIX
Pobierz darmowy fragment (pdf)

Gdzie kupić całą publikację:

Prawo europejskie
Autor:

Opinie na temat publikacji:


Inne popularne pozycje z tej kategorii:


Czytaj również:


Prowadzisz stronę lub blog? Wstaw link do fragmentu tej książki i współpracuj z Cyfroteką: