Cyfroteka.pl

klikaj i czytaj online

Cyfro
Czytomierz
00314 010172 16951930 na godz. na dobę w sumie
Prawo karne - część ogólna. Orzecznictwo - ebook/pdf
Prawo karne - część ogólna. Orzecznictwo - ebook/pdf
Autor: , Liczba stron: 791
Wydawca: C. H. Beck Język publikacji: polski
ISBN: 978-83-255-2566-8 Data wydania:
Lektor:
Kategoria: ebooki >> prawo i podatki >> orzecznictwo
Porównaj ceny (książka, ebook, audiobook).

Seria Zbiory Orzecznictwa Becka podaje wybór orzeczeń wraz ze skróconym stanem faktycznym oraz argumentacją z uzasadnienia. Całość opatrzona jest indeksami: rzeczowym i chronologicznym. Publikacje z tej serii są cennym uzupełnieniem podręczników. Stanowią niezbędną pomoc w trakcie pisania pracy magisterskiej oraz skuteczne narzędzie przy przygotowywaniu się do egzaminu na aplikację.

W niniejszym zbiorze przedstawiono wybór orzeczeń Trybunału Konstytucyjnego, Europejskiego Trybunału Praw Człowieka, Sądu Najwyższego oraz sądów apelacyjnych z zakresu prawa karnego materialnego. Jest on adresowany zarówno do studentów prawa, chcących poszerzyć swoją wiedzę zdobytą w trakcie zajęć uniwersyteckich, jak i aplikantów oraz praktyków prawa. Zbiór może być pomocny w przygotowaniach do egzaminów uniwersyteckich oraz zawodowych. Tematyka orzeczeń obejmuje zakres części ogólnej kodeksu karnego.

Autorami zbiorku są doktoranci Wydziału Prawa i Administracji UniwersytetuWarszawskiego, aplikanci oraz praktycy.

Znajdź podobne książki Ostatnio czytane w tej kategorii

Darmowy fragment publikacji:

Zbiory Orzecznictwa Becka Prawo karne – czêœæ ogólna Orzecznictwo Wprowadzenie Michał Królikowski Michał Królikowski, Krzysztof Szczucki (red.) C.H. Beck Spis tre(cid:287)ci Wykaz skrótów . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXV Wprowadzenie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . XXIX Rozdział I. Zasady odpowiedzialno(cid:286)ci karnej . . . . . . . . . . . . . . . . . . . . . . . . 1. Czyn jako podstawowa przesłanka odpowiedzialno(cid:286)ci . . . . . . . . . . . . . 2. Nullum crimen sine lege według EKPC . . . . . . . . . . . . . . . . . . . . . . . . . 3. Wymóg opublikowania aktu w dzienniku urz(cid:266)dowym . . . . . . . . . . . . . 4. Ograniczone konsekwencje zasady nullum crimen sine lege . . . . . . . . . 5. Dopuszczalno(cid:286)ć odwoływania si(cid:266) do sformułowa(cid:276) ocennych . . . . . . . . 6. Zasada okre(cid:286)lono(cid:286)ci czynu karalnego . . . . . . . . . . . . . . . . . . . . . . . . . . 7. Zasada nullum crimen sine lege w przepisach Konstytucji RP . . . . . . . 8. Dopuszczalno(cid:286)ć doprecyzowania znamion w aktach rangi 1 2 4 5 7 8 10 1 podustawowej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9. Dopuszczalno(cid:286)ć doprecyzowania znamion w aktach wykonawczych . . 10. Obiektywna aspołeczno(cid:286)ć czynu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 11. Konieczno(cid:286)ć wykazania, (cid:298)e czyn narusza istotne warto(cid:286)ci społeczne . . 12. Karygodno(cid:286)ć konkretnego czynu a nie typu zachowania . . . . . . . . . . . 13. Relacja pomi(cid:266)dzy karygodno(cid:286)ci(cid:261) a zasługiwaniem na kar(cid:266) . . . . . . . . . 14. Zwi(cid:266)kszenie niebezpiecze(cid:276)stwa dla dobra chronionego prawem . . . . . 15. Wł(cid:261)czenie si(cid:266) do ła(cid:276)cucha przyczyn okoliczno(cid:286)ci od sprawcy niezale(cid:298)nych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 16. Urzeczywistnienie si(cid:266) niebezpiecze(cid:276)stwa w skutku . . . . . . . . . . . . . . . 17. Wymóg (cid:286)cisłego zwi(cid:261)zku kinetyczno-funkcjonalnego ze skutkiem . . . 18. Zwi(cid:261)zek przyczynowy w przypadku kolizji drogowej . . . . . . . . . . . . . . 19. Odpowiedzialno(cid:286)ć w oparciu o zasad(cid:266) obiektywnego przypisania skutku . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 20. Gwarant zapobiegni(cid:266)cia skutkowi . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 21. Zaniechanie nast(cid:266)pstwem bezprawnych zachowa(cid:276) wielu osób . . . . . . . 22. Stosowanie kary z uwzgl(cid:266)dnieniem zasady humanitaryzmu . . . . . . . . . 23. Zasada humanitaryzmu a przeludnienie zakładów karnych . . . . . . . . . . 24. Zasada humanitaryzmu a poszanowanie (cid:298)ycia prywatnego 11 13 16 17 18 19 20 21 22 24 25 26 27 28 30 33 i rodzinnego skazanego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 34 25. Dostosowanie kary do granic zagro(cid:298)enia przewidzianego we wzgl(cid:266)dniejszej kwalifikacji prawnej . . . . . . . . . . . . . . . . . . . . . . . . . . . 26. Dostosowanie kary do granic zagro(cid:298)enia przewidzianego we wzgl(cid:266)dniejszej kwalifikacji prawnej . . . . . . . . . . . . . . . . . . . . . . . . . . . 36 37 VII Spis tre(cid:286)ci 27. O uznaniu ustawy za wzgl(cid:266)dniejsz(cid:261) decyduje nie tylko surowo(cid:286)ć kary (I) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39 28. O uznaniu ustawy za wzgl(cid:266)dniejsz(cid:261) decyduje nie tylko surowo(cid:286)ć kary (II) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 29. Nakaz dokonywania oceny zindywidualizowanej i zrelatywizowanej . 30. Brak obowi(cid:261)zku automatycznego polepszenia sytuacji oskar(cid:298)onego . . 31. Wpływ zmiany stanu prawnego na wydanie wyroku ł(cid:261)cznego . . . . . . . 32. Wymóg uwzgl(cid:266)dnienia okoliczno(cid:286)ci konkretnej sprawy . . . . . . . . . . . . 33. Znaczenie zagro(cid:298)enia przewidzianego w sankcji przepisu okre(cid:286)laj(cid:261)cego dany typ przest(cid:266)pstwa . . . . . . . . . . . . . . . . . . . . . . . . . . . 34. Znaczenie zwrotu „chce” dla umy(cid:286)lno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . 35. Okoliczno(cid:286)ci przedmiotowe w procesie ustalania zamiaru sprawcy . . . 36. Analiza całokształtu okoliczno(cid:286)ci zaj(cid:286)cia podstaw(cid:261) stwierdzenia zamiaru ewentualnego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 37. Ró(cid:298)nica mi(cid:266)dzy (cid:286)wiadomo(cid:286)ci(cid:261) nieumy(cid:286)ln(cid:261) a zamiarem ewentualnym . 38. Poj(cid:266)cie przeci(cid:266)tnej ostro(cid:298)no(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39. Zagadnienie wyznaczenia górnej granicy ustawowego zagro(cid:298)enia przewidzianego za przypisane nieletniemu przest(cid:266)pstwo . . . . . . . . . . . 40. Zbieg kumulatywny, gdy znamiona czynno(cid:286)ci wykonawczych s(cid:261) cz(cid:266)(cid:286)ciowo identyczne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41. Przyj(cid:266)cie konstrukcji czynu ci(cid:261)głego, je(cid:298)eli jeden z elementów czynu stanowi uprzywilejowany typ przest(cid:266)pstwa . . . . . . . . . . . . . . . . 42. Bezpo(cid:286)rednie powi(cid:261)zanie stosowania instytucji z art. 12 KK ze spełnieniem przesłanek przewidzianych w ustawie . . . . . . . . . . . . . . . . 43. Brak podstaw do uznania, i(cid:298) oskar(cid:298)ony dopu(cid:286)cił si(cid:266) przest(cid:266)pstwa ci(cid:261)głego w zakresie zarzucanym w akcie oskar(cid:298)enia . . . . . . . . . . . . . . . 44. Wykładnia przesłanki „krótkie odst(cid:266)py czasu” oraz problem to(cid:298)samo(cid:286)ci sposobu dokonania wszystkich zachowa(cid:276) . . . . . . . . . . . . . . Interpretacja przesłanek czynu ci(cid:261)głego . . . . . . . . . . . . . . . . . . . . . . . . . 45. 46. Kilkumiesi(cid:266)czne przedziały czasowe mog(cid:261) być traktowane jako „krótkie odst(cid:266)py czasu” . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 47. Prawomocne skazanie za czyn ci(cid:261)gły a zasada ne bis in idem . . . . . . . . 48. Czas popełnienia czynu ci(cid:261)głego a problem uko(cid:276)czenia przez sprawc(cid:266) 17 roku (cid:298)ycia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rozdział II. Formy popełnienia przest(cid:266)pstwa . . . . . . . . . . . . . . . . . . . . . . . . 49. Wyznaczenie granic karalnego usiłowania . . . . . . . . . . . . . . . . . . . . . . . 50. Ocena działa(cid:276) sprawców w kontek(cid:286)cie zwrotu „bezpo(cid:286)rednio zmierza” u(cid:298)ytego w art. 13 § 1 KK . . . . . . . . . . . . . . . . . . . . . . . . . . . . 51. Ocena postaci zamiaru sprawcy w przypadku usiłowania . . . . . . . . . . . 52. Ocena uko(cid:276)czenia lub nieuko(cid:276)czenia usiłowania . . . . . . . . . . . . . . . . . 53. Wyja(cid:286)nienie ró(cid:298)nicy pomi(cid:266)dzy przygotowaniem a usiłowaniem . . . . . 54. Ocena mo(cid:298)liwo(cid:286)ci popełnienia pod(cid:298)egania w formie usiłowania . . . . . 55. Ocena charakteru „(cid:286)rodka nie nadaj(cid:261)cego si(cid:266) do popełnienia czynu zabronionego” w kontek(cid:286)cie art. 13 § 2 KK . . . . . . . . . . . . . . . . . . . . . 56. Ocena charakteru nieprzydatno(cid:286)ci (cid:286)rodka do realizacji celu . . . . . . . . . 40 41 42 43 44 47 49 50 51 52 53 54 55 56 57 58 59 61 62 65 66 68 68 69 71 72 73 73 75 76 VIII Spis tre(cid:286)ci 57. Ocena usiłowania obiektywnie mo(cid:298)liwego, którego realizacja stała si(cid:266) niemo(cid:298)liwa w trakcie wykonywania czynno(cid:286)ci w wyniku wł(cid:261)czenia si(cid:266) niesprzyjaj(cid:261)cych okoliczno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . 58. Ocena przyj(cid:266)cia konstrukcji usiłowania nieudolnego przy przest(cid:266)pstwach o zło(cid:298)onym charakterze . . . . . . . . . . . . . . . . . . . . . . . . 59. Wymiar kary za usiłowanie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 60. Ocena mo(cid:298)liwo(cid:286)ci nadzwyczajnego złagodzenia kary lub odst(cid:261)pienia od jej wymierzenia w przypadku usiłowania nieudolnego . 61. Ocena dobrowolno(cid:286)ci odst(cid:261)pienia od usiłowania . . . . . . . . . . . . . . . . . 62. Ocena dobrowolno(cid:286)ci odst(cid:261)pienia od dokonania czynu w (cid:286)wietle 77 78 80 80 82 art. 15 § 1 KK . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 83 63. Rodzaj usiłowania a mo(cid:298)liwo(cid:286)ć dobrowolnego odst(cid:261)pienia od dokonania czynu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 64. Ocena dobrowolno(cid:286)ci odst(cid:261)pienia od dokonania czynu zabronionego pod wpływem dezaprobaty wyra(cid:298)onej przez osob(cid:266) trzeci(cid:261) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65. Ocena mo(cid:298)liwo(cid:286)ci posłu(cid:298)enia si(cid:266) innymi osobami w celu odwrócenia niebezpiecze(cid:276)stwa gro(cid:298)(cid:261)cego dobru prawnemu . . . . . . . . . 66. Ocena dopuszczalno(cid:286)ci uznania odwrócenia skutku przest(cid:266)pnego przy pomocy innych osób. Karalno(cid:286)ć sprawcy za przest(cid:266)pstwa, których znamiona zostały zrealizowane przed zapobiegni(cid:266)ciem nast(cid:261)pienia zamierzonego skutku . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 67. Warunki karalno(cid:286)ci przygotowania . . . . . . . . . . . . . . . . . . . . . . . . . . . . 68. Odbicie odst(cid:261)pienia od przygotowania w konkretnych okoliczno(cid:286)ciach faktycznych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 69. Przesłanki sprawstwa sensu stricto . . . . . . . . . . . . . . . . . . . . . . . . . . . . 70. Istota współsprawstwa. Odpowiedzialno(cid:286)ć za eksces drugiego ze współsprawców . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 71. Ocena stopnia zrealizowania znamion typu czynu zabronionego dla przypisania współsprawstwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 72. Ocena własnor(cid:266)cznego realizowania znamion czynu zabronionego dla przyj(cid:266)cia współsprawstwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 73. Współsprawstwo osoby nie bior(cid:261)cej czynnego udziału w czynno(cid:286)ci 85 86 87 88 90 91 92 93 94 95 96 97 sprawczej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 74. Ocena formy zawarcia porozumienia pomi(cid:266)dzy współdziałaj(cid:261)cymi . . . 75. Współsprawstwo sukcesywne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 76. Istota sprawstawa kierowniczego i polecaj(cid:261)cego. Ocena okoliczno(cid:286)ci wył(cid:261)czaj(cid:261)cych odpowiedzialno(cid:286)ć bezpo(cid:286)redniego wykonawcy dla odpowiedzialno(cid:286)ci sprawcy kierowniczego lub polecaj(cid:261)cego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98 Istota sprawstwa kierowniczego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 100 77. 78. Ocena przyj(cid:266)cia konstrukcji sprawstwa kierowniczego w sytuacji gdy organizator nie kierował samym przebiegiem akcji przest(cid:266)pczej . . 101 79. Ocena momentu w którym sprawca kierowniczy musi faktycznie kierować wykonaniem znamion czynu dla przypisania sprawstwa . . . . 102 80. Ocena postaci nakłaniania, które mo(cid:298)e zostać uznane za pod(cid:298)eganie . . 104 81. Pod(cid:298)eganie w formie utrzymywania we wcze(cid:286)niej podj(cid:266)tym zamiarze . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 104 IX Spis tre(cid:286)ci 82. Ocena pod(cid:298)egania osoby ju(cid:298) posiadaj(cid:261)cej zamiar popełnienia przest(cid:266)pstwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 105 83. Ocena zmierzania do wywołania zamiaru popełnienia przest(cid:266)pstwa osoby bior(cid:261)cej udział w przygotowaniu do jego popełnienia . . . . . . . . 106 84. Ocena skutkowego charakteru pod(cid:298)egania . . . . . . . . . . . . . . . . . . . . . . 108 85. Skutkowy charakter pod(cid:298)egania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 109 86. Umy(cid:286)lno(cid:286)ć pod(cid:298)egania. Pomoc psychiczna . . . . . . . . . . . . . . . . . . . . . . 110 87. Pod(cid:298)eganie w formie posłu(cid:298)enia si(cid:266) osob(cid:261) trzeci(cid:261) w roli po(cid:286)rednika . . 111 88. Dopuszczalno(cid:286)ć pod(cid:298)egania w formie zaakceptowania propozycji osoby trzeciej gotowo(cid:286)ci do dokonania czynu zabronionego . . . . . . . . 89. Odpowiedzialno(cid:286)ć pod(cid:298)egacza. Zamiar pod(cid:298)egania . . . . . . . . . . . . . . . 90. Odpowiedzialno(cid:286)ć za pod(cid:298)eganie do czynu dokonanego nast(cid:266)pnie przez pod(cid:298)egacza . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 91. Podstawa prawna wymiaru kary za usiłowanie pod(cid:298)egania do 112 113 113 dokonania czynu zabronionego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 114 92. Stosunek odpowiedzialno(cid:286)ci pomocnika do odpowiedzialno(cid:286)ci sprawcy wykonawczego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 93. Ocena zamiaru pomocnika. Czas dokonania czynno(cid:286)ci pomocnika . . . 94. Ocena konieczno(cid:286)ci znajomo(cid:286)ci przez pomocnika personaliów osoby wzgl(cid:266)dem działa(cid:276) której podejmowane były przez pomocnika czynno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 119 95. Pomocnictwo przez zaniechanie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 120 96. Pomocnictwo psychiczne (I) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 122 97. Pomocnictwo psychiczne (II) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 123 98. Podstawa prawna nadzwyczajnego złagodzenia kary przy skazaniu 117 118 za pomocnictwo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 124 99. Okoliczno(cid:286)ci dotycz(cid:261)ce okre(cid:286)lonych współsprawców . . . . . . . . . . . . . . 125 100. Stosunek okoliczno(cid:286)ci wył(cid:261)czaj(cid:261)cych odpowiedzialno(cid:286)ć wykonawcy bezpo(cid:286)redniego a odpowiedzialno(cid:286)ć sprawcy kierowniczego lub polecaj(cid:261)cego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 126 101. Okoliczno(cid:286)ci osobiste sprawcy bezpo(cid:286)redniego a odpowiedzialno(cid:286)ć pomocnika . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 127 102. Mo(cid:298)liwo(cid:286)ć zastosowania art. 23 § 1 do pod(cid:298)egaj(cid:261)cego inn(cid:261) osob(cid:266) do współdziałania w dokonaniu czynu zabronionego, który zamierza popełnić, je(cid:286)li dobrowolnie odst(cid:261)pi od dokonania i zapobiegnie dokonania tego czynu . . . . . . . . . . . . . . . . . . . . . . . . . . . 128 Rozdział III. Wył(cid:261)czenie odpowiedzialno(cid:286)ci karnej . . . . . . . . . . . . . . . . . . . 129 103. Bezpo(cid:286)rednio(cid:286)ć a prawdopodobie(cid:276)stwo zamachu . . . . . . . . . . . . . . . . . 129 104. Zamach a niebezpiecze(cid:276)stwo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 130 105. Powtórzenie ataku a bezpo(cid:286)rednio(cid:286)ć zamachu . . . . . . . . . . . . . . . . . . . . 131 106. Obrona konieczna a mo(cid:298)liwo(cid:286)ć unikni(cid:266)cia ataku . . . . . . . . . . . . . . . . . 132 107. Bezprawno(cid:286)ć zamachu a zachowanie prowokuj(cid:261)ce . . . . . . . . . . . . . . . . 133 108. Przekroczenie granic – kryteria . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 134 109. Niebezpieczne narz(cid:266)dzie a przekroczenie granic obrony koniecznej . . 136 110. Działanie w obronie koniecznej a element podmiotowy . . . . . . . . . . . . 137 111. Zakres uprawnie(cid:276) broni(cid:261)cego si(cid:266) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 137 112. Aktywna obrona konieczna . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 139 X Spis tre(cid:286)ci 113. Samoistno(cid:286)ć obrony koniecznej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 140 114. Stopie(cid:276) społecznej szkodliwo(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 141 115. Dodatkowy element legalizuj(cid:261)cy obron(cid:266) konieczn(cid:261) . . . . . . . . . . . . . . . 143 116. Obrona konieczna a bójka . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 143 117. Prawo do obrony koniecznej a wykonywanie obowi(cid:261)zków słu(cid:298)bowych przez funkcjonariuszy publicznych . . . . . . . . . . . . . . . . . . 144 118. Dopuszczalno(cid:286)ć uwolnienia lekarza od odpowiedzialno(cid:286)ci za zmian(cid:266) zakresu zabiegu operacyjnego bez zgody pacjenta na podstawie stanu wy(cid:298)szej konieczno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . 146 119. (cid:295)ródło stanu wy(cid:298)szej konieczno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . 147 120. Wzgl(cid:266)dno(cid:286)ć poj(cid:266)cia konieczno(cid:286)ci – czas wojny . . . . . . . . . . . . . . . . . . 148 121. Wyj(cid:261)tkowy charakter stanu wy(cid:298)szej konieczno(cid:286)ci – niwelowanie dysproporcji maj(cid:261)tkowych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 149 122. Stan wy(cid:298)szej konieczno(cid:286)ci jako okoliczno(cid:286)ć wył(cid:261)czaj(cid:261)ca bezprawno(cid:286)ć czynu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 150 123. Ryzyko jako podstawa ekskulpacji . . . . . . . . . . . . . . . . . . . . . . . . . . . . 151 124. Zakres uzasadnionego ryzyka . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 152 125. Niezb(cid:266)dno(cid:286)ć zgody uczestnika eksperymentu badawczego . . . . . . . . . 153 126. Bł(cid:261)d prawnie istotny . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 154 127. Bł(cid:261)d a czynnik subiektywny . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 155 128. Bł(cid:261)d co do znamion a skala warto(cid:286)ciowania sprawcy . . . . . . . . . . . . . . 156 129. Bł(cid:261)d co do znamion a nieumiej(cid:266)tno(cid:286)ć zrozumienia tre(cid:286)ci przepisu . . . . 157 130. Bł(cid:261)d co do jednego znamienia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 158 131. Zboczenie działania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 159 132. Charakter prawny bł(cid:266)du co do kontratypu . . . . . . . . . . . . . . . . . . . . . . . 161 133. Zniesławienie w obronie społecznie uzasadnionego interesu a bł(cid:261)d co do kontratypu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 162 134. Nieusprawiedliwiona nie(cid:286)wiadomo(cid:286)ć bezprawno(cid:286)ci . . . . . . . . . . . . . . . 163 135. Nie(cid:286)wiadomo(cid:286)ć bezprawno(cid:286)ci a strona podmiotowa; obiektywny charakter kryteriów . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 164 136. Obiektywno-subiektywny charakter usprawiedliwionej nie(cid:286)wiadomo(cid:286)ci bezprawno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 165 137. Konieczno(cid:286)ć ustalenia (cid:286)wiadomo(cid:286)ci bezprawno(cid:286)ci . . . . . . . . . . . . . . . . 166 138. Ocena całokształtu okoliczno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 167 139. Istota bezprawno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 168 140. Nie(cid:286)wiadomo(cid:286)ć bezprawno(cid:286)ci a osobowo(cid:286)ć sprawcy . . . . . . . . . . . . . . 169 141. Niepoczytalno(cid:286)ć a wina . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 170 142. Opinia s(cid:261)dowo-psychiatryczna . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 171 143. Inne zakłócenia o charakterze niepatologicznym . . . . . . . . . . . . . . . . . . 172 144. Schizofrenia a niepoczytalno(cid:286)ć . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 173 145. Wymagania wiedzy medycznej do stwierdzenia zaburzenia psychicznego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 174 146. Ró(cid:298)norodno(cid:286)ć nat(cid:266)(cid:298)enia stanów poczytalno(cid:286)ci ograniczonej . . . . . . . . 175 147. Inne zaburzenia czynno(cid:286)ci psychicznych a silne wzburzenie . . . . . . . . 176 XI Spis tre(cid:286)ci Rozdział IV. Kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 177 148. Charakter kary 25 lat pozbawienia wolno(cid:286)ci oraz do(cid:298)ywotniego pozbawienia wolno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 177 149. Mo(cid:298)liwo(cid:286)ć wymierzenia kary do(cid:298)ywotniego pozbawienia wolno(cid:286)ci . . 179 150. Orzeczenie kary poni(cid:298)ej dolnej granicy sankcji . . . . . . . . . . . . . . . . . . . 181 151. Zast(cid:266)pcza kara pozbawienia wolno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . 182 152. Kara przeniesienia na inne stanowisko słu(cid:298)bowe . . . . . . . . . . . . . . . . . 183 153. Zobowi(cid:261)zanie skazanego do przeproszenia pokrzywdzonego . . . . . . . . 185 154. Orzeczenie kary grzywny w razie popełnienia przest(cid:266)pstwa w celu osi(cid:261)gni(cid:266)cia korzy(cid:286)ci maj(cid:261)tkowej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 187 155. Brak mo(cid:298)liwo(cid:286)ci wymierzenia kary grzywny obok innej kary zasadniczej innej ni(cid:298) kara pozbawienia wolno(cid:286)ci . . . . . . . . . . . . . . . . . 189 156. Niedopuszczalno(cid:286)ć orzekania „zbiorczej” kary grzywny . . . . . . . . . . . 190 157. Orzeczenie kary grzywny obok kary pozbawienia wolno(cid:286)ci . . . . . . . . . 191 158. Mo(cid:298)liwo(cid:286)ć orzekania grzywny kumulatywnej (I) . . . . . . . . . . . . . . . . . 192 159. Mo(cid:298)liwo(cid:286)ć orzekania grzywny kumulatywnej (II) . . . . . . . . . . . . . . . . 193 160. Dolna granica grzywny . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 194 161. Maksymalna liczba stawek dziennych grzywny . . . . . . . . . . . . . . . . . . 197 162. Orzekanie kary grzywny na podstawie ustawy szczególnej . . . . . . . . . 197 163. Podstawa orzeczenia kary ograniczenia wolno(cid:286)ci oraz dodatkowych obowi(cid:261)zków z niej płyn(cid:261)cych wobec oskar(cid:298)onego niepełni(cid:261)cego w dniu wydania wyroku słu(cid:298)by wojskowej . . . . . . . . . . 198 164. Orzeczenie kary ograniczenia wolno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . 200 165. Wymiar kary ograniczenia wolno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . 201 166. Obowi(cid:261)zek wykonania pracy wskazanej przez s(cid:261)d . . . . . . . . . . . . . . . . 202 167. Dodatkowe obowi(cid:261)zki przy karze pozbawienia wolno(cid:286)ci . . . . . . . . . . . 204 168. Obowi(cid:261)zek wykonywania nieodpłatnej kontrolowanej pracy . . . . . . . . 205 169. Obowi(cid:261)zek naprawienia szkody . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 206 170. Obowi(cid:261)zek naprawienia szkody a kara ograniczenia wolno(cid:286)ci . . . . . . . 207 171. Niedopuszczalno(cid:286)ć oddania pod dozór kuratora bez wymierzenia kary ograniczenia wolno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 209 172. Orzeczenie kary w niedopuszczalnym wymiarze . . . . . . . . . . . . . . . . . 210 Rozdział V. (cid:285)rodki karne . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 173. (cid:285)rodki karne – funkcja i charakter prawny . . . . . . . . . . . . . . . . . . . . . . 211 174. (cid:285)rodki karne – zbieg kumulatywny . . . . . . . . . . . . . . . . . . . . . . . . . . . . 213 175. (cid:285)rodki karne – odpowiednie stosowanie przepisów o wymiarze kary do wymiaru (cid:286)rodków karnych w przypadku ci(cid:261)gu przest(cid:266)pstw . . . 218 211 176. Zakres (cid:286)rodków karnych orzekanych w post(cid:266)powaniu nakazowym do noweli KPK z 10.1.2003 r. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 220 177. Niedopuszczalno(cid:286)ć orzekania (cid:286)rodka karnego niewskazanego we wniosku o skazanie bez przeprowadzenia rozprawy . . . . . . . . . . . . . . . 222 178. Nieuzgodnienie (cid:286)rodka karnego jako negatywna przesłanka skazania bez przeprowadzenia rozprawy . . . . . . . . . . . . . . . . . . . . . . . . 223 179. Przesłanki pozbawienia praw publicznych . . . . . . . . . . . . . . . . . . . . . . . 225 180. „Umy(cid:286)lno(cid:286)ć” oraz „motywacja zasługuj(cid:261)ca na szczególne pot(cid:266)pienie” jako przesłanki pozbawienia praw publicznych . . . . . . . . . 227 181. Poj(cid:266)cie „motywacji zasługuj(cid:261)cej na szczególne pot(cid:266)pienie” . . . . . . . . . 231 XII 182. Pozbawienie praw publicznych – termin pocz(cid:261)tkowy zakazu korzystania z praw publicznych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 233 Spis tre(cid:286)ci 183. Sposób okre(cid:286)lenia działalno(cid:286)ci w orzeczeniu zakazuj(cid:261)cym prowadzenia działalno(cid:286)ci gospodarczej . . . . . . . . . . . . . . . . . . . . . . . . . 234 184. Zakres czynno(cid:286)ci obj(cid:266)tych zakazem prowadzenia działalno(cid:286)ci gospodarczej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 237 185. Dopuszczalno(cid:286)ć orzeczenia zakazu wykonywania funkcji płatnika składek na ubezpieczenie społeczne . . . . . . . . . . . . . . . . . . . . . . . . . . . . 243 186. Zakres pojazdów obj(cid:266)tych zakazem prowadzenia pojazdów (I) . . . . . . 245 187. Zakres pojazdów obj(cid:266)tych zakazem prowadzenia pojazdów (II) . . . . . 247 188. Zakres pojazdów obj(cid:266)tych zakazem prowadzenia pojazdów (art. 42 § 1 KK) – pojazdy, do których prowadzenia nie s(cid:261) potrzebne uprawnienia stwierdzone dokumentem . . . . . . . . . . . . . . . . . 249 189. Niedopuszczalno(cid:286)ć zakazu prowadzenia rowerów na podstawie art. 42 § 2 KK . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 252 190. Wymiar czasowy zakazu prowadzenia pojazdów . . . . . . . . . . . . . . . . . 253 191. Okoliczno(cid:286)ci istotne dla wymiaru zakazu prowadzenia pojazdów . . . . 255 192. Zaliczenie okresu zatrzymania prawa jazdy na podstawie Prawa o ruchu drogowym na poczet zakazu prowadzenia pojazdów . . . . . . . . 256 193. Zaliczenie okresu faktycznego zatrzymania dokumentu uprawniaj(cid:261)cego do prowadzenia pojazdu na poczet zakazu prowadzenia pojazdów . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 263 194. Numerus clausus zdarze(cid:276) skutkuj(cid:261)cych przerwaniem biegu okresu, na który orzeczono zakaz prowadzenia pojazdów . . . . . . . . . . . . . . . . . 265 195. Poj(cid:266)cie przedmiotu pochodz(cid:261)cego z przest(cid:266)pstwa . . . . . . . . . . . . . . . . . 269 196. Własno(cid:286)ć sprawcy jako przesłanka orzeczenia przepadku narz(cid:266)dzi słu(cid:298)(cid:261)cych do popełnienia przest(cid:266)pstwa . . . . . . . . . . . . . . . . . . . . . . . . . 270 197. Przepadek korzy(cid:286)ci pochodz(cid:261)cej z przest(cid:266)pstwa przeniesionej na inny podmiot . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 273 198. Przedmiot czynno(cid:286)ci wykonawczej a przedmiot pochodz(cid:261)cy bezpo(cid:286)rednio z przest(cid:266)pstwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 282 199. Przepadek przedmiotów słu(cid:298)(cid:261)cych do popełniania przest(cid:266)pstw karanych na podstawie przepisów o przeciwdziałaniu narkomanii . . . . 290 200. Zwrot pokrzywdzonemu korzy(cid:286)ci uzyskanej w zamian za przedmiot przest(cid:266)pstwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 292 201. Przepadek korzy(cid:286)ci ze sprzeda(cid:298)y narkotyków . . . . . . . . . . . . . . . . . . . . 295 202. Niedopuszczalno(cid:286)ć orzeczenia przepadku z powodu (cid:286)mierci oskar(cid:298)onego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 298 203. Wniosek o orzeczenie (cid:286)rodka karnego – obowi(cid:261)zku naprawienia szkody . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 302 204. Podmioty uprawnione do zło(cid:298)enia wniosku o orzeczenie (cid:286)rodka karnego obowi(cid:261)zku naprawienia szkody . . . . . . . . . . . . . . . . . . . . . . . . 305 205. Podstawy prawne orzekania (cid:286)rodka karnego – obowi(cid:261)zku naprawienia szkody . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 309 206. Podstawa prawna zło(cid:298)enia przez prokuratora wniosku o naprawienie szkody . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 311 207. Warunki dopuszczalno(cid:286)ci orzeczenia obowi(cid:261)zku naprawienia szkody . 316 XIII Spis tre(cid:286)ci 208. Mo(cid:298)liwo(cid:286)ć nało(cid:298)enia solidarnego obowi(cid:261)zku naprawienia szkody na podstawie art. 46 KK . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 318 209. Ubezpieczenie sprawcy szkody a mo(cid:298)liwo(cid:286)ć orzeczenia obowi(cid:261)zku jej naprawienia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 321 210. Niedopuszczalno(cid:286)ć nawi(cid:261)zki w przypadku warunkowego umorzenia post(cid:266)powania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 326 211. Obowi(cid:261)zek naprawienia szkody a nawi(cid:261)zka . . . . . . . . . . . . . . . . . . . . . 328 212. Niedopuszczalno(cid:286)ć orzeczenia nawi(cid:261)zki po (cid:286)mierci pokrzywdzonego . 330 213. Umy(cid:286)lno(cid:286)ć jako przesłanka orzeczenia nawi(cid:261)zki na podstawie art. 47 KK . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 333 214. Wysoko(cid:286)ć nawi(cid:261)zki – obowi(cid:261)zek okre(cid:286)lenia wysoko(cid:286)ci nawi(cid:261)zki w wyroku . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 336 215. Niedopuszczalno(cid:286)ć regresu nawi(cid:261)zki zapłaconej pokrzywdzonemu w wypadku wobec ubezpieczyciela OC . . . . . . . . . . . . . . . . . . . . . . . . . 337 216. Orzekanie o sposobie spełnienia (cid:286)wiadczenia pieni(cid:266)(cid:298)nego . . . . . . . . . . 342 217. Termin spełnienia (cid:286)wiadczenia pieni(cid:266)(cid:298)nego orzekanego jako (cid:286)rodek karny . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 345 218. Niedopuszczalno(cid:286)ć stosowania art. 49a § 1 KK do (cid:298)ołnierza słu(cid:298)by czynnej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 347 219. Niedopuszczalno(cid:286)ć orzeczenia (cid:286)wiadczenia pieni(cid:266)(cid:298)nego w przypadku warunkowego umorzenia post(cid:266)powania karnego o przest(cid:266)pstwo skarbowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 349 220. Zakres podmiotów uprawnionych do uzyskania (cid:286)wiadczenia pieni(cid:266)(cid:298)nego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 355 221. Cel statutowy podmiotów uprawnionych do uzyskania (cid:286)wiadczenia pieni(cid:266)(cid:298)nego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 357 222. Konstytutywny charakter wpisu do wykazu, o którym mowa w art. 49a § 2 KK . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 359 223. Zakres beneficjentów (cid:286)wiadczenia pieni(cid:266)(cid:298)nego; dopuszczalno(cid:286)ć orzeczenia (cid:286)wiadczenia pieni(cid:266)(cid:298)nego w przypadku warunkowego umorzenia post(cid:266)powania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 361 224. Podstawa prawna podania wyroku do publicznej wiadomo(cid:286)ci . . . . . . . 365 225. Niedopuszczalno(cid:286)ć publikacji wizerunku skazanego wraz z podaniem wyroku do publicznej wiadomo(cid:286)ci . . . . . . . . . . . . . . . . . . . 366 Rozdział VI. Zasady wymiaru kary i (cid:286)rodków karnych . . . . . . . . . . . . . . . . 368 226. Zarzut naruszenia dyrektyw wymiaru kary . . . . . . . . . . . . . . . . . . . . . . 368 227. Dyrektywy i zasady wymiaru kary a ci(cid:261)g przest(cid:266)pstw . . . . . . . . . . . . . 369 228. Wymiar kary a społeczne poczucie sprawiedliwo(cid:286)ci . . . . . . . . . . . . . . . 372 229. Kara grzywny a zasady i dyrektywy s(cid:261)dowego wymiaru kary . . . . . . . 373 230. Kryteria oceny stopnia szkodliwo(cid:286)ci społecznej czynu a okoliczno(cid:286)ci wpływaj(cid:261)ce na wymiar kary . . . . . . . . . . . . . . . . . . . . . . 375 231. Cele wychowawcze kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 377 232. Zakaz orzekania kary do(cid:298)ywotniego pozbawienia wolno(cid:286)ci wobec sprawców nieletnich . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 379 233. Zasady i dyrektywy s(cid:261)dowego wymiaru kary a (cid:286)rodki karne . . . . . . . . 380 234. Nadzwyczajne złagodzenie czynu zagro(cid:298)onego alternatywnie karami wymienionymi w art. 32 pkt 1–3 KK . . . . . . . . . . . . . . . . . . . . . 382 XIV 235. Nadzwyczajne złagodzenie kary w przypadku zbrodni popełnionej w warunkach recydywy specjalnej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 383 236. Nadzwyczajne złagodzenie kary a warunkowe zawieszenie jej Spis tre(cid:286)ci wykonania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 385 237. Nadzwyczajne złagodzenie kary (I) . . . . . . . . . . . . . . . . . . . . . . . . . . . . 387 238. Nadzwyczajne złagodzenie kary (II) . . . . . . . . . . . . . . . . . . . . . . . . . . . 389 239. Poczytalno(cid:286)ć ograniczona a nadzwyczajne złagodzenie kary . . . . . . . . 390 240. Przebaczenie oskar(cid:298)onemu przez pokrzywdzonego a nadzwyczajne złagodzenie kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 392 241. Niska warto(cid:286)ć przedmiotu przest(cid:266)pstwa a nadzwyczajne złagodzenie kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 393 242. Zastosowanie nadzwyczajnego złagodzenia kary wobec sprawcy kwalifikowanego zabójstwa z art. 148 § 2 KK . . . . . . . . . . . . . . . . . . . 395 243. Fakt podj(cid:266)cia współpracy z organami (cid:286)cigania a mo(cid:298)liwo(cid:286)ć zastosowania instytucji nadzwyczajnego złagodzenia kary . . . . . . . . . . 399 244. Przesłanki stosowania obligatoryjnego nadzwyczajnego złagodzenia kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 400 245. Nadzwyczajne obligatoryjne złagodzenie kary (I) . . . . . . . . . . . . . . . . . 404 246. Nadzwyczajne obligatoryjne złagodzenie kary (II) . . . . . . . . . . . . . . . . 406 247. Ujawnienie informacji dotycz(cid:261)cych osób uczestnicz(cid:261)cych w popełnieniu przest(cid:266)pstw oraz istotnych okoliczno(cid:286)ci jego popełnienia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 407 248. Odwołanie przez oskar(cid:298)onego dotychczasowych wyja(cid:286)nie(cid:276) a mo(cid:298)liwo(cid:286)ć zastosowania nadzwyczajnego złagodzenia kary . . . . . . . 410 249. Obligatoryjne a fakultatywne nadzwyczajne złagodzenie kary . . . . . . . 412 250. Nadzwyczajne obligatoryjne złagodzenie kary . . . . . . . . . . . . . . . . . . . 413 251. Mo(cid:298)liwo(cid:286)ć zastosowania nadzwyczajnego obligatoryjnego złagodzenia kary a „dozowanie” istotnych informacji, o których mowa w art. 60 § 3 KK . . . . . . . . . . . . . . . . . . . . 414 252. Obrona oskar(cid:298)onego a mo(cid:298)liwo(cid:286)ć skorzystania z instytucji nadzwyczajnego obligatoryjnego złagodzenia kary . . . . . . . . . . . . . . . . 416 253. Nadzwyczajne obligatoryjne złagodzenie kary . . . . . . . . . . . . . . . . . . . 418 254. Czyn ci(cid:261)gły a nadzwyczajne obligatoryjne złagodzenie kary . . . . . . . . 419 255. Nadzwyczajne złagodzenie kary a czyn ci(cid:261)gły . . . . . . . . . . . . . . . . . . . 421 256. Nadzwyczajne złagodzenie kary a ci(cid:261)g przest(cid:266)pstw . . . . . . . . . . . . . . . 422 257. Nadzwyczajne złagodzenie kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 424 258. Zło(cid:298)enie wyja(cid:286)nie(cid:276) w swojej sprawie a nadzwyczajne złagodzenie kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 425 259. Nadzwyczajne obligatoryjne złagodzenie kary . . . . . . . . . . . . . . . . . . . 429 260. Naprawienie szkody i ujawnienie istotnych okoliczno(cid:286)ci dotycz(cid:261)cych przest(cid:266)pstwa a odst(cid:261)pienie od wymierzenia kary . . . . . . . 430 261. Odst(cid:261)pienie od wymierzenia kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 431 262. Zaliczenie na poczet orzeczonej kary okresu rzeczywistego pozbawienia wolno(cid:286)ci a mo(cid:298)liwo(cid:286)ć uzyskania odszkodowania lub zado(cid:286)ćuczynienia za ten okres . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 433 263. Rzeczywiste pozbawienie wolno(cid:286)ci w sprawie a zatrzymanie administracyjne (porz(cid:261)dkowe) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 434 XV Spis tre(cid:286)ci 264. Zaliczenie pobytu oskar(cid:298)onego w zamkni(cid:266)tym szpitalu psychiatrycznym na poczet wymierzonej kary . . . . . . . . . . . . . . . . . . . 438 265. Nadzwyczajne obostrzenie kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 439 266. Wybór zakładu karnego i systemu terapeutycznego . . . . . . . . . . . . . . . 441 Rozdział VII. Powrót do przest(cid:266)pstwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 443 267. Prawomocne zarz(cid:261)dzenie wykonania kary pozbawienia wolno(cid:286)ci orzeczonej w zawieszeniu a warunek odbycia kary pozbawienia wolno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 443 268. Przesłanki spełnienia warunku odbycia kary w przypadku aresztu tymczasowego, amnestii i ułaskawienia . . . . . . . . . . . . . . . . . . . . . . . . . 444 269. Przest(cid:266)pstwo umy(cid:286)lne jako przesłanka recydywy zwykłej . . . . . . . . . . 445 270. Pobyt w schronisku dla nieletnich lub zakładzie poprawczym a warunek „skazania” . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 446 271. Odbycie zast(cid:266)pczej kary pozbawienia wolno(cid:286)ci a warunek skazania na kar(cid:266) pozbawienia wolno(cid:286)ci i jej „odbycia” . . . . . . . . . . . . . . . . . . . . 447 272. Odbycie kary pozbawienia wolno(cid:286)ci za granic(cid:261) a recydywa . . . . . . . . . 448 273. Wymiar poszczególnych odbytych kar pozbawienia wolno(cid:286)ci a multirecydywa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 449 274. Poj(cid:266)cie ponownego popełnienia przest(cid:266)pstwa a multirecydywa (I) . . . 451 275. Poj(cid:266)cie ponownego popełnienia przest(cid:266)pstwa a multirecydywa (II) . . . 452 276. Poj(cid:266)cie przest(cid:266)pstwa przeciwko mieniu popełnionego z u(cid:298)yciem przemocy a multirecydywa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 454 277. Recydywa jako immanentny element kwalifikacji prawnej przest(cid:266)pstwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 456 278. Uczynienie sobie z przest(cid:266)pstwa stałego (cid:296)ródła dochodu . . . . . . . . . . . 457 279. Udział w zorganizowanej grupie przest(cid:266)pczej a mo(cid:298)liwo(cid:286)ć zawieszenia wykonania kary pozbawienia wolno(cid:286)ci . . . . . . . . . . . . . . . 458 Rozdział VIII. (cid:285)rodki zwi(cid:261)zane z poddaniem sprawcy próbie . . . . . . . . . . . 459 280. Orzeczenie o warunkowym umorzeniu post(cid:266)powania, a domniemanie niewinno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 459 281. Przesłanki warunkowego umorzenia post(cid:266)powania – stopie(cid:276) społecznej szkodliwo(cid:286)ci czynu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 461 282. Przyznanie si(cid:266) oskar(cid:298)onego, a mo(cid:298)liwo(cid:286)ć warunkowego umorzenia post(cid:266)powania (I) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 462 283. Przyznanie si(cid:266) oskar(cid:298)onego, a mo(cid:298)liwo(cid:286)ć warunkowego umorzenia post(cid:266)powania (II) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 463 284. Mo(cid:298)liwo(cid:286)ć pojednania sprawcy a (cid:286)mierć pokrzywdzonego . . . . . . . . . 465 285. Mo(cid:298)liwo(cid:286)ć pojednania sprawcy a wielo(cid:286)ć pokrzywdzonych . . . . . . . . . 467 286. Okoliczno(cid:286)ci popełnienia czynu, a mo(cid:298)liwo(cid:286)ć warunkowego umorzenia post(cid:266)powania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 468 287. Niekaralno(cid:286)ć za przest(cid:266)pstwo umy(cid:286)lne jako przesłanka warunkowego umorzenia post(cid:266)powania . . . . . . . . . . . . . . . . . . . . . . . . 469 288. Mo(cid:298)liwo(cid:286)ć warunkowego umorzenia post(cid:266)powania przest(cid:266)pstw formalnych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 470 289. Orzeczenie obowi(cid:261)zku naprawienia szkody przy warunkowym umorzeniu post(cid:266)powania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 472 XVI Spis tre(cid:286)ci 290. (cid:285)wiadczenie pieni(cid:266)(cid:298)ne lub zakaz prowadzenia pojazdów, a warunkowe umorzenie post(cid:266)powania . . . . . . . . . . . . . . . . . . . . . . . . . 473 291. Zakaz prowadzenia pojazdów, a warunkowe umorzenie post(cid:266)powania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 474 292. Termin naprawienia szkody przy warunkowym umorzeniu post(cid:266)powania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 475 293. Kara ł(cid:261)czna a warunkowe zawieszenie wykonania kary . . . . . . . . . . . . 476 294. Zawieszenie wykonania kary ł(cid:261)cznej . . . . . . . . . . . . . . . . . . . . . . . . . . . 479 295. Dodatnia prognoza jako przesłanka warunkowego zawieszenia wykonania kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 480 296. Obowi(cid:261)zek ka(cid:298)dorazowego badania przesłanek warunkowego zawieszenia wykonania kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 481 297. Wzajemna relacja przesłanek warunkowego zawieszenia wykonania kary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 482 298. Obowi(cid:261)zek badania mo(cid:298)liwo(cid:286)ci zastosowania instytucji warunkowego zawieszenia wykonania kary . . . . . . . . . . . . . . . . . . . . . 483 299. Skutki zawieszenia wykonania kary ł(cid:261)cznej pozbawienia wolno(cid:286)ci . . . 484 300. Pozytywna prognoza jako przesłanka warunkowego zawieszenia wykonania kary (I) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 485 301. Pozytywna prognoza jako przesłanka warunkowego zawieszenia wykonania kary (II) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 486 302. Kryteria ustalania okresu próby (I) . . . . . . . . . . . . . . . . . . . . . . . . . . . . 487 303. Kryteria ustalania okresu próby (II) . . . . . . . . . . . . . . . . . . . . . . . . . . . . 488 304. Warunkowe zawieszenie wykonania kary wobec młodocianego . . . . . . 489 305. Orzeczenie kary grzywny przy warunkowym zawieszeniu post(cid:266)powania . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 490 306. Relacja przepisów art. 33 § 2 KK i art. 71 § 1 KK (I) . . . . . . . . . . . . . . 491 307. Relacja przepisów art. 33 § 2 KK i art. 71 § 1 KK (II) . . . . . . . . . . . . . 492 308. Ł(cid:261)czenie jednostkowych kar grzywny orzeczonych na podstawie art. 71 § 1 KK . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 493 309. Grzywna, a zarz(cid:261)dzenie wykonania warunkowo zawieszonej kary pozbawienia wolno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 495 310. Obowi(cid:261)zek wykonywania ci(cid:261)(cid:298)(cid:261)cego obowi(cid:261)zku ło(cid:298)enia na utrzymanie małoletnich dzieci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 497 311. Nakładanie obowi(cid:261)zku powstrzymywania si(cid:266) od nadu(cid:298)ywania alkoholu . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 498 312. Nakładanie obowi(cid:261)zku naprawienia szkody . . . . . . . . . . . . . . . . . . . . . 499 313. Obowi(cid:261)zek naprawienia szkody, a wymiar kary . . . . . . . . . . . . . . . . . . 500 314. Zakres obowi(cid:261)zku naprawienia szkody . . . . . . . . . . . . . . . . . . . . . . . . . 501 315. Solidarno(cid:286)ć obowi(cid:261)zku naprawienia szkody . . . . . . . . . . . . . . . . . . . . . 503 316. Zakres obowi(cid:261)zku naprawienia szkody (I) . . . . . . . . . . . . . . . . . . . . . . . 504 317. Zakres obowi(cid:261)zku naprawienia szkody (II) . . . . . . . . . . . . . . . . . . . . . . 505 318. Niemo(cid:298)no(cid:286)ć orzeczenia obowi(cid:261)zku naprawienia szkody wynikaj(cid:261)ca z art. 415 § 5 KPK . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 506 319. Obowi(cid:261)zek orzeczenia dozoru . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 507 320. Mo(cid:298)liwo(cid:286)ć zwolnienia z dozoru orzekanego obligatoryjnie . . . . . . . . . 508 321. Ponowne popełnienie przest(cid:266)pstwa, a zarz(cid:261)dzenie wykonania kary . . . 511 XVII Spis tre(cid:286)ci 322. Zarz(cid:261)dzenie wykonania kary z powodu uchylania si(cid:266) od nało(cid:298)onych obowi(cid:261)zków . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 512 323. Wyjazd za granic(cid:266), a wykonywanie dozoru . . . . . . . . . . . . . . . . . . . . . . 513 324. Zarz(cid:261)dzenie wykonania kary z powodu uchylania si(cid:266) od obowi(cid:261)zku naprawienia szkody . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 515 325. Termin do zarz(cid:261)dzenia wykonania kary . . . . . . . . . . . . . . . . . . . . . . . . . 516 326. Uchylanie si(cid:266) od obowi(cid:261)zku naprawienia szkody . . . . . . . . . . . . . . . . . 517 327. Zarz(cid:261)dzenie wykonania kary obj(cid:266)tej wyrokiem ł(cid:261)cznym . . . . . . . . . . . 518 328. Relacja art. 76 § 1 KK do art. 108 KK . . . . . . . . . . . . . . . . . . . . . . . . . . 519 329. Ocena zgodno(cid:286)ci z Konstytucj(cid:261) RP art. 77 § 1 KK . . . . . . . . . . . . . . . . 520 330. Warunkowe przedterminowe zwolnienie sprawców przest(cid:266)pstw nieumy(cid:286)lnych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 522 331. Warunkowe przedterminowe zwolnienie jako etap resocjalizacji . . . . . 523 332. Warunkowe przedterminowe zwolnienie – przesłanki (I) . . . . . . . . . . . 524 333. Warunkowe przedterminowe zwolnienie – przesłanki (II) . . . . . . . . . . 525 334. Fakultatywno(cid:286)ć warunkowego przedterminowego zwolnienia (I) . . . . 526 335. Fakultatywno(cid:286)ć warunkowego przedterminowego zwolnienia (II) . . . . 528 336. Kryteria prognozy kryminologicznej (I) . . . . . . . . . . . . . . . . . . . . . . . . 529 337. Kryteria prognozy kryminologicznej (II) . . . . . . . . . . . . . . . . . . . . . . . . 530 338. Zakaz ponownego badania charakteru przest(cid:266)pstwa w kontek(cid:286)cie okoliczno(cid:286)ci maj(cid:261)cych wpływ na ustalenie prognozy kryminologicznej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 532 339. Warunkowe zwolnienie a zast(cid:266)pcza kara pozbawienia wolno(cid:286)ci . . . . . . 533 340. Prognoza zachowania skazanego – wymogi merytoryczne . . . . . . . . . . 534 341. Pozytywna prognoza zachowania skazanego jako przesłanka warunkowego przedterminowego zwolnienia . . . . . . . . . . . . . . . . . . . . 535 342. Charakter popełnionego przest(cid:266)pstwa jako przesłanka warunkowego przedterminowego zwolnienia . . . . . . . . . . . . . . . . . . . . 536 343. Stosowanie warunkowego przedterminowego zwolnienia do sprawców przest(cid:266)pstw w warunkach recydywy szczególnej . . . . . . . . . 537 344. Przepisy intertemporalne w zakresie warunkowego przedterminowego zwolnienia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 538 345. Kognicja s(cid:261)du powszechnego o rozpoznanie wniosku o warunkowe przedterminowe zwolnienie . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 539 346. Warunkowe przedterminowe zwolnienie z kary aresztu . . . . . . . . . . . . 540 347. Przerwa w karze a okres odbywania kary pozbawienia wolno(cid:286)ci . . . . . 541 348. Termin orzekania w sprawie odwołania warunkowego zwolnienia . . . . 541 349. Warunkowe przedterminowe zwolnienie z kary ł(cid:261)cznej . . . . . . . . . . . . 543 350. Uznanie kary za odbyt(cid:261), a kara ł(cid:261)czna (I) . . . . . . . . . . . . . . . . . . . . . . . 545 351. Uznanie kary za odbyt(cid:261), a kara ł(cid:261)czna (II) . . . . . . . . . . . . . . . . . . . . . . . 547 352. Uznanie (cid:286)rodka karnego za wykonany . . . . . . . . . . . . . . . . . . . . . . . . . . 547 Rozdział IX. Zbieg przest(cid:266)pstw oraz ł(cid:261)czenie kar i (cid:286)rodków karnych . . . . 548 353. Zasady wymiaru kary ł(cid:261)cznej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 548 354. Chronologiczne usytuowanie wyroków przy karze ł(cid:261)cznej . . . . . . . . . . 551 355. Ł(cid:261)czenie (cid:286)rodków karnych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 552 356. Kara zast(cid:266)pcza przy ł(cid:261)czeniu kar . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 554 XVIII Spis tre(cid:286)ci 357. Wpływ zatarcia skazania na kar(cid:266) ł(cid:261)czn(cid:261) . . . . . . . . . . . . . . . . . . . . . . . . 557 358. Granice kary ł(cid:261)cznej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 558 359. Orzeczenie kary ł(cid:261)cznej w wyroku ł(cid:261)cznym . . . . . . . . . . . . . . . . . . . . . 559 360. Ł(cid:261)czenie kar ograniczenia wolno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . 562 361. Ł(cid:261)czenie kary grzywny . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 563 362. Wyrok ł(cid:261)czny a pogorszenie sytuacji skazanego . . . . . . . . . . . . . . . . . . 565 363. Zasada absorpcji i kumulacji przy wymiarze kary ł(cid:261)cznej . . . . . . . . . . . 566 364. Ł(cid:261)czenie kary pozbawienia wolno(cid:286)ci i ograniczenia wolno(cid:286)ci . . . . . . . 568 365. Wpływ warunkowego zawieszenia na kar(cid:266) ł(cid:261)czn(cid:261) . . . . . . . . . . . . . . . . 569 366. Orzeczenie kary ł(cid:261)cznej a kara zast(cid:266)pcza . . . . . . . . . . . . . . . . . . . . . . . . 571 367. Kara ł(cid:261)czna w wypadku zbiegu kary 25 lat pozbawienia wolno(cid:286)ci i do(cid:298)ywotniego pozbawienia wolno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . 572 368. Zasada absorpcji przy wydawaniu wyroku ł(cid:261)cznego . . . . . . . . . . . . . . . 573 369. Warunkowe zawieszenie wykonania kary ł(cid:261)cznej pozbawienia wolno(cid:286)ci . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 574 370. Wykonanie (cid:286)rodków karnych niepodlegaj(cid:261)cych ł(cid:261)czeniu . . . . . . . . . . . 576 371. Zasady orzekania kary w wypadku ci(cid:261)gu przest(cid:266)pstw . . . . . . . . . . . . . . 579 372. Ci(cid:261)g przest(cid:266)pstw a nadzwyczajne złagodzenie kary . . . . . . . . . . . . . . . 579 373. Ci(cid:261)g przest(cid:266)pstw a orzeczenie (cid:286)rodków karnych . . . . . . . . . . . . . . . . . . 581 374. Formy popełnienia przest(cid:266)pstwa a ci(cid:261)g przest(cid:266)pstw . . . . . . . . . . . . . . . 582 375. Ci(cid:261)g przest(cid:266)pstw a zakaz reformationis in peius . . . . . . . . . . . . . . . . . . 584 376. Wykonanie kar wymierzonych za zbiegaj(cid:261)ce si(cid:266) przest(cid:266)pstwa . . . . . . . 585 Rozdział X. (cid:285)rodki zabezpieczaj(cid:261)ce . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 587 377. Artykuł 93 jako ogólna norma gwarancyjna odnosz(cid:261)ca si(cid:266) do wszystkich (cid:286)rodków zabezpieczaj(cid:261)cych zwi(cid:261)zanych z umieszczeniem sprawcy w zakładzie zamkni(cid:266)tym . . . . . . . . . . . . . . . 587 378. Zasada proporcjonalno(cid:286)ci pozbawienia wolno(cid:286)ci do wagi czynu w kontek(cid:286)cie umieszczenia w zamkni(cid:266)tym zakładzie psychiatrycznym 588 379. Ocena społecznej szkodliwo(cid:286)ci czynu w kontek(cid:286)cie orzekania o zastosowaniu (cid:286)rodka zabezpieczaj(cid:261)cego . . . . . . . . . . . . . . . . . . . . . . . 589 380. Obligatoryjno(cid:286)ć post(cid:266)powania dowodowego przy orzekaniu (cid:286)rodka zabezpieczaj(cid:261)cego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 590 381. Forma przeprowadzenia dowodu z opinii biegłych oraz wymóg ustalenia sprawstwa w post(cid:266)powaniu dotycz(cid:261)cym orzeczenia (cid:286)rodka zabezpieczaj(cid:261)cego . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 591 382. Ocena prawdopodobie(cid:276)stwa ponownego popełnienia przez sprawc(cid:266) czynu zabronionego o znacznym stopniu społecznej szkodliwo(cid:286)ci . . . . 592 383. Mo(cid:298)liwo(cid:286)ć uchylenia (cid:286)rodka zabezpieczaj(cid:261)cego w czasie mi(cid:266)dzy uprawomocnieniem si(cid:266) wyroku a osadzeniem w zakładzie psychiatrycznym . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 593 384. Mo(cid:298)liwo(cid:286)ć stosowania przerw w toku wykonywania (cid:286)rodka zabezpieczaj(cid:261)cego okre(cid:286)lonego w art. 94 KK . . . . . . . . . . . . . . . . . . . . 594 385. Przesłanki ponownego umieszczenia sprawcy w zakładzie psychiatrycznym . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 595 386. Niedopuszczalno(cid:286)ć orzeczenia (cid:286)rodka zabezpieczaj(cid:261)cego w post(cid:266)powaniu wykonawczym . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 597 XIX
Pobierz darmowy fragment (pdf)

Gdzie kupić całą publikację:

Prawo karne - część ogólna. Orzecznictwo
Autor:
,

Opinie na temat publikacji:


Inne popularne pozycje z tej kategorii:


Czytaj również:


Prowadzisz stronę lub blog? Wstaw link do fragmentu tej książki i współpracuj z Cyfroteką: