klikaj i czytaj online

00190 003817 22407398 na godz. na dobę w sumie
Prawo prywatne - ebook/pdf
Prawo prywatne - ebook/pdf
Autor: Liczba stron: 482
Wydawca: C. H. Beck Język publikacji: polski
ISBN: 978-83-255-2358-9 Data wydania:
Kategoria: ebooki >> prawo i podatki >> cywilne
Porównaj ceny (książka, ebook, audiobook).

TABELE PORÓWNAWCZE – nowa seria, która w sposób syntetyczny przedstawia najważniejszeinformacje z danych dziedzin prawa, ujęte w formie wygodnej i praktycznej tabeliporównawczej.

Prawo prywatne to opracowanie zawierające tabele przedstawiające porównawczonajważniejsze zagadnienia i instytucje prawa prywatnego:

Jeżeli jesteś aplikantem adwokackim, radcowskim czy notarialnymi przygotowujesz się do kolokwium z wskazanych powyżej dziedzinprawa jest to książka, dzięki której;

Znajdź podobne książki Ostatnio czytane w tej kategorii

Darmowy fragment publikacji:

APLIKACJE PRAWNICZE TABELE PORÓWNAWCZE Alicja Świczewska Prawo prywatne Wydawnictwo C.H. Beck TABELE PORÓWNAWCZE Prawo prywatne Alicja Świczewska Prawo prywatne Wydawnictwo C.H. BECK Warszawa 2011 Redakcja: Joanna Ablewicz Projekt okładki: Robert Rogiński © Wydawnictwo C.H. Beck 2011 Wydawnictwo C.H. Beck Sp. z o.o. ul. Bonifraterska 17, 00-203 Warszawa Skład i łamanie: Krzysztof Biesaga Druk i oprawa: Totem, Inowrocław ISBN 978-83-255-1989-6 ISBN e-book 978-83-255-2358-9 Spis tre(cid:258)ci Wstęp . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . VII IX Wykaz skrótów . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . I. Kodeks cywilny . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. Przedstawicielstwo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:344)(cid:495)(cid:561) Niewa(cid:268)ność(cid:498)(cid:561)bezskuteczność(cid:561)czynności(cid:561)prawnych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:345)(cid:495)(cid:561) Forma(cid:561)uzupełnienia(cid:496)(cid:561)zmiany(cid:496)(cid:561)rozwiązania(cid:561)albo(cid:561)wypowiedzenia(cid:561)umowy(cid:498)(cid:561)forma(cid:561) odstąpienia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:346)(cid:495)(cid:561) Forma(cid:561)pisemna(cid:561)dla(cid:561)celów(cid:561)dowodowych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:347)(cid:495)(cid:561) Nadzwyczajna(cid:561)zmiana(cid:561)stosunków . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:348)(cid:495)(cid:561) Terminy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:349)(cid:495)(cid:561) Wybrane(cid:561)zagadnienia(cid:561)części(cid:561)szczególnej(cid:561)zobowiązań . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Sprzeda(cid:268)(cid:496)(cid:561)zamiana(cid:496)(cid:561)dostawa(cid:496)(cid:561)kontraktacja(cid:496)(cid:561)dzieło(cid:496)(cid:561)roboty(cid:561)budowlane(cid:496)(cid:561)najem . . . . . (cid:349)(cid:495)(cid:343)(cid:495)(cid:561) (cid:349)(cid:495)(cid:344)(cid:495)(cid:561) Dzier(cid:268)awa(cid:496)(cid:561)leasing(cid:496)(cid:561)u(cid:268)yczenie(cid:496)(cid:561)po(cid:268)yczka(cid:496)(cid:561)rachunek(cid:561)bankowy(cid:496)(cid:561)zlecenie(cid:496)(cid:561) prowadzenie(cid:561)cudzych(cid:561)spraw(cid:561)bez(cid:561)zlecenia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:349)(cid:495)(cid:345)(cid:495)(cid:561) Agencja(cid:496)(cid:561)komis(cid:496)(cid:561)przewóz(cid:496)(cid:561)spedycja(cid:496)(cid:561)ubezpieczenie(cid:496)(cid:561)przechowanie(cid:496)(cid:561)skład . . . . . . . . . (cid:349)(cid:495)(cid:346)(cid:495)(cid:561) Spółka(cid:496)(cid:561)poręczenie(cid:496)(cid:561)darowizna(cid:496)(cid:561)renta(cid:496)(cid:561)do(cid:268)ywocie(cid:496)(cid:561)ugoda(cid:496)(cid:561)przyrzeczenie(cid:561)publiczne II(cid:495)(cid:561) Kodeks(cid:561)spółek(cid:561)handlowych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:343)(cid:495)(cid:561) Przepisy(cid:561)ogólne(cid:561)Kodeksu(cid:561)spółek(cid:561)handlowych . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:344)(cid:495)(cid:561) Spółki(cid:561)osobowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:344)a(cid:495)(cid:561) Spółka(cid:561)cywilna(cid:561)a(cid:561)spółka(cid:561)jawna . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:345)(cid:495)(cid:561) Spółki(cid:561)kapitałowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:346)(cid:495)(cid:561) Łączenie(cid:496)(cid:561)podział(cid:496)(cid:561)przekształcenie(cid:561)spółek(cid:561)handlowych(cid:561)oraz(cid:561)przekształcenie(cid:561) spółki(cid:561)cywilnej . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . III(cid:495)(cid:561)Prawo(cid:561)rodzinne(cid:561)i(cid:561)opiekuńcze(cid:561)(cid:558)(cid:561)wybrane(cid:561)zagadnienia . . . . . . . . . . . . . . . . . . . . . . . (cid:343)(cid:495)(cid:561) Ustalenie(cid:561)nieistnienia(cid:561)albo(cid:561)uniewa(cid:268)nienie(cid:561)mał(cid:268)eństwa . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:344)(cid:495)(cid:561) Rozwód(cid:561)a(cid:561)separacja. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:345)(cid:495)(cid:561) Ustawowy(cid:561)ustrój(cid:561)majątkowy(cid:561)(cid:558)(cid:561)majątek(cid:561)wspólny(cid:561)a(cid:561)majątek(cid:561)osobisty . . . . . . . . . . . . . . . . . . . (cid:346)(cid:495)(cid:561) Pozostałe(cid:561)ustroje(cid:561)majątkowe . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:347)(cid:495)(cid:561) Ojcostwo(cid:561)i(cid:561)macierzyństwo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:348)(cid:495)(cid:561) Przysposobienie(cid:496)(cid:561)opieka(cid:496)(cid:561)kuratela . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:349)(cid:495)(cid:561) Terminy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . IV(cid:495)(cid:561)Prawo(cid:561)pracy(cid:561)(cid:558)(cid:561)wybrane(cid:561)zagadnienia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:343)(cid:495)(cid:561) Źródła(cid:561)prawa(cid:561)pracy. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:344)(cid:495)(cid:561) Równe(cid:561)prawa(cid:561)pracowników(cid:496)(cid:561)równe(cid:561)traktowanie(cid:561)w(cid:561)zatrudnieniu . . . . . . . . . . . . . . . . . . . . . A. Świczewska, Prawo prywatne 1 1 4 9 9 10 10 45 45 65 76 86 97 97 102 139 147 254 311 311 315 318 324 328 339 358 366 366 366 V Spis tre(cid:258)ci (cid:345)(cid:495)(cid:561) Porozumienia(cid:561)o(cid:561)zawieszeniu(cid:561)stosowania(cid:561)przepisów(cid:561)prawa(cid:561)pracy(cid:561)oraz(cid:561)o(cid:561)stosowaniu(cid:561) mniej(cid:561)korzystnych(cid:561)warunków(cid:561)(cid:561)zatrudnienia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:346)(cid:495)(cid:561) Nawiązanie(cid:561)stosunku(cid:561)pracy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:347)(cid:495)(cid:561) Rozwiązanie(cid:561)stosunku(cid:561)pracy(cid:561)na(cid:561)podstawie(cid:561)umowy(cid:561)o(cid:561)pracę(cid:561)albo(cid:561)wyboru(cid:496)(cid:561)odwołanie . . . . (cid:348)(cid:495)(cid:561) Rozwiązanie(cid:561)umowy(cid:561)o(cid:561)pracę(cid:561)za(cid:561)wypowiedzeniem(cid:561)i(cid:561)bez(cid:561)wypowiedzenia(cid:561)przez(cid:561) pracodawcę(cid:561)albo(cid:561)pracownika . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:349)(cid:495)(cid:561) Wygaśnięcie(cid:561)umowy(cid:561)o(cid:561)pracę . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:350)(cid:495)(cid:561) Systemy(cid:561)czasu(cid:561)pracy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:351)(cid:495)(cid:561) Nale(cid:268)ności(cid:561)lub(cid:561)roszczenia(cid:561)pracowników(cid:561)i(cid:561)pracodawców . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:343)(cid:342)(cid:495)(cid:561) Potrącenia(cid:561)z(cid:561)wynagrodzenia(cid:561)pracownika . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:343)(cid:343)(cid:495)(cid:561) Urlopy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (cid:343)(cid:344)(cid:495)(cid:561) Terminy . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 372 373 380 383 396 397 401 415 417 439 VI A. Świczewska, Prawo prywatne Wstęp Gdy(cid:561)przygotowywałam(cid:561)się(cid:561)do(cid:561)egzaminów(cid:561)podczas(cid:561)studiów(cid:496)(cid:561)siłą(cid:561)rzeczy(cid:561)uczyłam(cid:561)się(cid:561)ka(cid:268)dej(cid:561)proce- dury(cid:561)z(cid:561)osobna(cid:495)(cid:561)Jednak(cid:561)nauka(cid:561)do(cid:561)konkursów(cid:561)na(cid:561)aplikacje(cid:561)adwokacką(cid:561)oraz(cid:561)sądową(cid:561)szybko(cid:561)okazała(cid:561)się(cid:561)in- nym(cid:561)wyzwaniem(cid:495)(cid:561)Ogromny(cid:561)materiał(cid:496)(cid:561)który(cid:561)nale(cid:268)ało(cid:561)opanować(cid:496)(cid:561)postanowiłam(cid:561)pogrupować(cid:561)i(cid:561)podzielić(cid:561) na(cid:561)zagadnienia(cid:495)(cid:561)Pomysł(cid:561)rozwinęłam(cid:561)podczas(cid:561)aplikacji(cid:496)(cid:561)ucząc(cid:561)się(cid:561)do(cid:561)corocznych(cid:561)kolokwiów(cid:496)(cid:561)a(cid:561)obecnie(cid:561) (cid:558)(cid:561)do(cid:561)egzaminu(cid:561)zawodowego(cid:495) Zbiór(cid:496)(cid:561)który(cid:561)macie(cid:561)Państwo(cid:561)przed(cid:561)sobą(cid:496)(cid:561)zawiera(cid:561)tabele(cid:561)przedstawiające(cid:561)porównawczo(cid:561)najwa(cid:268)niej- sze(cid:496)(cid:561)w(cid:561)mojej(cid:561)ocenie(cid:496)(cid:561)zagadnienia(cid:561)i(cid:561)instytucje(cid:561)prawa(cid:561)prywatnego(cid:497)(cid:561)Kodeksu(cid:561)spółek(cid:561)handlowych(cid:496)(cid:561)Kodeksu(cid:561) cywilnego(cid:496)(cid:561)Kodeksu(cid:561)rodzinnego(cid:561)i(cid:561)opiekuńczego(cid:561)oraz(cid:561)Prawa(cid:561)pracy(cid:495)(cid:561)Dodatkowy(cid:561)podział(cid:561)na(cid:561)szczegółowe(cid:561) hasła(cid:561)ułatwia(cid:561)szybkie(cid:561)znalezienie(cid:561)konkretnych(cid:561)regulacji(cid:495)(cid:561)Po(cid:561)ka(cid:268)dym(cid:561)zdaniu(cid:561)umieszczonym(cid:561)w(cid:561)tabeli(cid:561)po- dana(cid:561)jest(cid:561)podstawa(cid:561)prawna(cid:496)(cid:561)a(cid:561)stosowane(cid:561)skróty(cid:561)oraz(cid:561)oznaczenia(cid:561)matematyczne(cid:561)mają(cid:561)pomóc(cid:561)w(cid:561)spraw- nym(cid:561)zapamiętaniu(cid:561)treści(cid:561)przepisów(cid:495) Uwzględnione(cid:561) zostały(cid:561) nowelizacje(cid:561) Kodeksu(cid:561) spółek(cid:561) handlowych(cid:496)(cid:561) Kodeksu(cid:561) cywilnego(cid:496)(cid:561) Kodeksu(cid:561) rodzinnego(cid:561)i(cid:561)opiekuńczego(cid:561)oraz(cid:561)Prawa(cid:561)pracy(cid:496)(cid:561)a(cid:561)tak(cid:268)e(cid:561)wyroki(cid:561)Trybunału(cid:561)Konstytucyjnego(cid:561)dotyczące(cid:561) norm(cid:561)zawartych(cid:561)w(cid:561)powy(cid:268)szych(cid:561)ustawach(cid:561)(cid:558)(cid:561)według(cid:561)stanu(cid:561)na(cid:561)dzień(cid:561)(cid:344)(cid:344)(cid:495)(cid:343)(cid:344)(cid:495)(cid:344)(cid:342)(cid:343)(cid:342)(cid:561)r(cid:495)(cid:561)Ponadto(cid:496)(cid:561)wyszczegól- nione(cid:561)są(cid:561)zmiany(cid:561)wprowadzone(cid:561)w(cid:561)Prawie(cid:561)pracy(cid:561)ustawą(cid:561)z(cid:561)(cid:348)(cid:495)(cid:343)(cid:344)(cid:495)(cid:344)(cid:342)(cid:342)(cid:350)(cid:561)r(cid:495)(cid:561)o(cid:561)zmianie(cid:561)ustawy(cid:561)(cid:558)(cid:561)Kodeks(cid:561)pracy(cid:561) oraz(cid:561)niektórych(cid:561)innych(cid:561)ustaw(cid:561)(cid:507)Dz(cid:495)U(cid:495)(cid:561)Nr(cid:561)(cid:344)(cid:345)(cid:349)(cid:496)(cid:561)poz(cid:495)(cid:561)(cid:343)(cid:348)(cid:347)(cid:346)(cid:508)(cid:496)(cid:561)którą(cid:561)mo(cid:268)na(cid:561)określić(cid:561)jako(cid:561)nowelizację(cid:561)(cid:494)postę- pującą(cid:516)(cid:561)do(cid:561)(cid:344)(cid:342)(cid:343)(cid:345)(cid:561)r(cid:495)(cid:561)(cid:507)zob(cid:495)(cid:561)art(cid:495)(cid:561)(cid:343)(cid:344)(cid:561)ustawy(cid:561)nowelizującej(cid:508)(cid:495) Mam(cid:561)nadzieję(cid:496)(cid:561)(cid:268)e(cid:561)seria(cid:561)(cid:494)Tabele(cid:561)Aplikanta(cid:516)(cid:561)oka(cid:268)e(cid:561)się(cid:561)szczególnie(cid:561)przydatna(cid:561)dla(cid:561)młodych(cid:561)prawni- ków(cid:497)(cid:561)studentów(cid:561)i(cid:561)absolwentów(cid:496)(cid:561)którzy(cid:561)planują(cid:561)zdawać(cid:561)na(cid:561)aplikacje(cid:498)(cid:561)aplikantów(cid:561)oraz(cid:561)praktyków(cid:495) Chciałabym(cid:561)podziękować(cid:497)(cid:561)adwokat(cid:561)Karinie(cid:561)Pęcherz(cid:561)za(cid:561)pomoc(cid:561)w(cid:561)doborze(cid:561)materiału(cid:561)z(cid:561)zakresu(cid:561)Ko- deksu(cid:561)cywilnego(cid:561)(cid:558)(cid:561)części(cid:561)szczególnej(cid:561)zobowiązań(cid:496)(cid:561)a(cid:561)tak(cid:268)e(cid:561)Pracownikom(cid:561)Wydawnictwa(cid:561)C(cid:495)(cid:561)H(cid:495)(cid:561)Beck(cid:496)(cid:561)jak(cid:561) równie(cid:268)(cid:561)adwokatom(cid:561)Jakubowi(cid:561)Jacynie(cid:561)i(cid:561)Andrzejowi(cid:561)Michałowskiemu(cid:561)za(cid:561)(cid:268)yczliwość(cid:561)oraz(cid:561)cenne(cid:561)uwagi(cid:495) Warszawa(cid:496)(cid:561)styczeń(cid:561)(cid:344)(cid:342)(cid:343)(cid:343)(cid:561)r(cid:495)(cid:561) Alicja(cid:561)Świczewska A. Świczewska, Prawo prywatne VII Wykaz skrótów 1. Akty prawa krajowego KC(cid:561). . . . . . . . . . . . . .(cid:561) ustawa(cid:561)z(cid:561)(cid:344)(cid:345)(cid:495)(cid:346)(cid:495)(cid:343)(cid:351)(cid:348)(cid:346)(cid:561)r(cid:495)(cid:561)(cid:558)(cid:561)Kodeks(cid:561)cywilny(cid:561)(cid:507)Dz(cid:495)U(cid:495)(cid:561)Nr(cid:561)(cid:343)(cid:348)(cid:496)(cid:561)poz(cid:495)(cid:561)(cid:351)(cid:345)(cid:561)ze(cid:561)zm(cid:495)(cid:508) KP(cid:561) . . . . . . . . . . . . . .(cid:561) ustawa(cid:561)z(cid:561)(cid:344)(cid:348)(cid:495)(cid:348)(cid:495)(cid:343)(cid:351)(cid:349)(cid:346)(cid:561)r(cid:495)(cid:561)(cid:558)(cid:561)Kodeks(cid:561)pracy(cid:561)(cid:507)t(cid:495)j(cid:495)(cid:561)Dz(cid:495)U(cid:495)(cid:561)z(cid:561)(cid:343)(cid:351)(cid:351)(cid:350)(cid:561)r(cid:495)(cid:561)Nr(cid:561)(cid:344)(cid:343)(cid:496)(cid:561)poz(cid:495)(cid:561)(cid:351)(cid:346)(cid:561)ze(cid:561)zm(cid:495)(cid:508) KPC(cid:561) . . . . . . . . . . . .(cid:561) ustawa(cid:561)z(cid:561)(cid:343)(cid:349)(cid:495)(cid:343)(cid:343)(cid:495)(cid:343)(cid:351)(cid:348)(cid:346)(cid:561)r(cid:495)(cid:561)(cid:558)(cid:561)Kodeks(cid:561)postępowania(cid:561)cywilnego(cid:561)(cid:507)Dz(cid:495)U(cid:495)(cid:561)Nr(cid:561)(cid:346)(cid:345)(cid:496)(cid:561)poz(cid:495)(cid:561)(cid:344)(cid:351)(cid:348)(cid:561) KRO(cid:561) . . . . . . . . . . . .(cid:561) ustawa(cid:561)z(cid:561)(cid:344)(cid:347)(cid:495)(cid:344)(cid:495)(cid:343)(cid:351)(cid:348)(cid:346)(cid:561)r(cid:495)(cid:561)(cid:558)(cid:561)Kodeks(cid:561)rodzinny(cid:561)i(cid:561)opiekuńczy(cid:561)(cid:507)Dz(cid:495)U(cid:495)(cid:561)Nr(cid:561)(cid:351)(cid:496)(cid:561)poz(cid:495)(cid:561)(cid:347)(cid:351)(cid:561) KSH(cid:561) . . . . . . . . . . . .(cid:561) ustawa(cid:561)z(cid:561)(cid:343)(cid:347)(cid:495)(cid:351)(cid:495)(cid:344)(cid:342)(cid:342)(cid:342)(cid:561)r(cid:495)(cid:561)(cid:558)(cid:561)Kodeks(cid:561)spółek(cid:561)handlowych(cid:561)(cid:507)Dz(cid:495)U(cid:495)(cid:561)Nr(cid:561)(cid:351)(cid:346)(cid:496)(cid:561)poz(cid:495)(cid:561)(cid:343)(cid:342)(cid:345)(cid:349)(cid:561) ze(cid:561)zm(cid:495)(cid:508) ze(cid:561)zm(cid:495)(cid:508) ze(cid:561)zm(cid:495)(cid:508) 2. Organy, instytucje EOG . . . . . . . . . . . .(cid:561) Europejski(cid:561)Obszar(cid:561)Gospodarczy KR(cid:561) . . . . . . . . . . . . . .(cid:561) Komisa(cid:561)rewizyjna KZ(cid:561) . . . . . . . . . . . . . .(cid:561) Kapitał(cid:561)zakładowy OECD . . . . . . . . . . .(cid:561) Organizacja(cid:561)Współpracy(cid:561)Gospodarczej(cid:561)i(cid:561)Rozwoju(cid:561)(cid:507)Organisation(cid:561)for(cid:561)Economic(cid:561) Co(cid:556)Operation(cid:561)and(cid:561)Development(cid:508) RN . . . . . . . . . . . . . .(cid:561) Rada(cid:561)nadzorcza UE . . . . . . . . . . . . . .(cid:561) Unia(cid:561)Europejska WZ . . . . . . . . . . . . .(cid:561) Walne(cid:561)zgromadzenie ZW . . . . . . . . . . . . .(cid:561) Zgromadzenie(cid:561)Wspólników artykuł na(cid:561)przykład numer rok 3. Inne skróty art. . . . . . . . . . . . . . .(cid:561) Dz.U. . . . . . . . . . . .(cid:561) Dziennik(cid:561)Ustaw np(cid:495)(cid:561). . . . . . . . . . . . . .(cid:561) Nr . . . . . . . . . . . . . .(cid:561) r. . . . . . . . . . . . . . . . pkt(cid:561). . . . . . . . . . . . . .(cid:561) punkt por(cid:495)(cid:561) . . . . . . . . . . . . .(cid:561) porównaj poz(cid:495)(cid:561) . . . . . . . . . . . . .(cid:561) pozycja RP . . . . . . . . . . . . . .(cid:561) Rzeczpospolita(cid:561)Polska t.j. . . . . . . . . . . . . . .(cid:561) ust(cid:495)(cid:561) . . . . . . . . . . . . .(cid:561) ustęp w zw. . . . . . . . . . . .(cid:561) w(cid:561)związku zdanie zd. . . . . . . . . . . . . . .(cid:561) ze(cid:561)zmianami ze zm. . . . . . . . . . . .(cid:561) złoty zł(cid:561) . . . . . . . . . . . . . . .(cid:561) (cid:507)(cid:503)(cid:508) . . . . . . . . . . . . . . .(cid:561) wa(cid:268)ne tekst(cid:561)jednolity A. Świczewska, Prawo prywatne IX A i . Ś w c z e w s k a , P r a w o p r y w a t n e 1 I. Kodeks cywilny 1. Przedstawicielstwo Kryterium Przepisy(cid:561)ogólne(cid:561) o(cid:561)przedstawiciel- stwie Pełnomocnictwo Prokura Z(cid:561)zastrze(cid:268)eniem(cid:561)wyjątków(cid:561)w(cid:561)ustawie(cid:561)przewidzianych(cid:561)albo(cid:561)wynikających(cid:561)z(cid:561)właściwości(cid:561)czynności(cid:561)prawnej(cid:496)(cid:561)mo(cid:268)na(cid:561)dokonać(cid:561)czynno- ści(cid:561)prawnej(cid:561)przez(cid:561)przedstawiciela(cid:561)(cid:507)art(cid:495)(cid:561)(cid:351)(cid:347)(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)KC(cid:508)(cid:495) Czynność(cid:561)prawna(cid:561)dokonana(cid:561)przez(cid:561)przedstawiciela(cid:561)w(cid:561)granicach(cid:561)umocowania(cid:561)pociąga(cid:561)za(cid:561)sobą(cid:561)skutki(cid:561)bezpośrednio(cid:561)dla(cid:561)reprezento- wanego(cid:561)(cid:507)art(cid:495)(cid:561)(cid:351)(cid:347)(cid:561)(cid:535)(cid:561)(cid:344)(cid:561)KC(cid:508)(cid:495) Umocowanie(cid:561)do(cid:561)działania(cid:561)w(cid:561)cudzym(cid:561)imieniu(cid:561)mo(cid:268)e(cid:561)opierać(cid:561)się(cid:561)na(cid:497) (cid:442) (cid:442) (cid:507)art(cid:495)(cid:561)(cid:351)(cid:348)(cid:561)KC(cid:508) ustawie(cid:561)(cid:507)przedstawicielstwo(cid:561)ustawowe(cid:508)(cid:561)albo oświadczeniu(cid:561)reprezentowanego(cid:561)(cid:507)pełnomocnictwo(cid:508)(cid:495) Osobę(cid:561)czynną(cid:561)w(cid:561)lokalu(cid:561)przedsiębiorstwa(cid:561)przeznaczonym(cid:561)do(cid:561)obsługiwania(cid:561)publiczności(cid:561)poczytuje(cid:561)się(cid:561)w(cid:561)razie(cid:561)wątpliwości(cid:561)za(cid:561)umoco- waną(cid:561)do(cid:561)dokonywania(cid:561)czynności(cid:561)prawnych(cid:496)(cid:561)które(cid:561)zazwyczaj(cid:561)bywają(cid:561)dokonywane(cid:561)z(cid:561)osobami(cid:561)korzystającymi(cid:561)z(cid:561)usług(cid:561)tego(cid:561)przedsię- biorstwa(cid:561)(cid:507)art(cid:495)(cid:561)(cid:351)(cid:349)(cid:561)KC(cid:508)(cid:495) Rodzaje Rodzaje(cid:561)pełnomocnictwa Pełnomocnictwo(cid:561)ogólne(cid:561)obejmuje(cid:561)umocowanie (cid:442) (cid:442) do(cid:561)czynności(cid:561)zwykłego(cid:561)zarządu(cid:498) do(cid:561)czynności(cid:561)przekraczających(cid:561)zakres(cid:561)zwykłego(cid:561)zarządu(cid:497) (cid:522)(cid:561) (cid:522)(cid:561) potrzebne(cid:561)jest(cid:561)pełnomocnictwo(cid:561)określające(cid:561)ich(cid:561)rodzaj(cid:496) chyba(cid:561)(cid:268)e(cid:561)ustawa(cid:561)wymaga(cid:561)pełnomocnictwa(cid:561)do(cid:561)poszczególnej(cid:561) czynności(cid:495) (cid:507)art(cid:495)(cid:561)(cid:351)(cid:350)(cid:561)KC(cid:508) Je(cid:268)eli(cid:561)mocodawca(cid:561)ustanowił(cid:561)kilku(cid:561)pełnomocników(cid:561)z(cid:561)takim(cid:561)sa- mym(cid:561)zakresem(cid:561)umocowania(cid:561)(cid:507)odpowiednio(cid:561)do(cid:561)pełnomocników(cid:496)(cid:561) których(cid:561)pełnomocnik(cid:561)sam(cid:561)dla(cid:561)mocodawcy(cid:561)ustanowił(cid:508)(cid:497) (cid:442) (cid:442) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:349)(cid:561)KC(cid:508)(cid:495) ka(cid:268)dy(cid:561)z(cid:561)nich(cid:561)mo(cid:268)e(cid:561)działać(cid:561)samodzielnie(cid:496) chyba(cid:561)(cid:268)e(cid:561)co(cid:561)innego(cid:561)wynika(cid:561)z(cid:561)treści(cid:561)pełnomocnictwa Prokura(cid:561)jest(cid:561)pełnomocnictwem(cid:497) (cid:442) udzielonym(cid:561)przez(cid:561)przedsiębiorcę(cid:561)podlegającemu(cid:561)obowiązkowi(cid:561) wpisu(cid:561)do(cid:561)rejestru(cid:561)przedsiębiorców(cid:496) które(cid:561)obejmuje(cid:561)umocowanie(cid:561)do(cid:561)czynności(cid:561)sądowych(cid:561)i(cid:561)pozasą- dowych(cid:496)(cid:561)jakie(cid:561)są(cid:561)związane(cid:561)z(cid:561)prowadzeniem(cid:561)przedsiębiorstwa(cid:495) (cid:442) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)1(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)KC(cid:508) Nie(cid:561)mo(cid:268)na(cid:561)ograniczyć(cid:561)prokury(cid:561)ze(cid:561)skutkiem(cid:561)wobec(cid:561)osób(cid:561)trzecich(cid:496)(cid:561) chyba(cid:561)(cid:268)e(cid:561)przepis(cid:561)szczególny(cid:561)stanowi(cid:561)inaczej(cid:561)(cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)1(cid:561)(cid:535)(cid:561)(cid:344)(cid:561)KC(cid:508)(cid:495) Jest(cid:561)wymagane(cid:561)pełnomocnictwo(cid:561)do(cid:561)poszczególnej(cid:561)czynności(cid:561) w(cid:561)przypadku(cid:497) (cid:442) (cid:442) zbycia(cid:561)przedsiębiorstwa(cid:496) dokonania(cid:561)czynności(cid:561)prawnej(cid:496)(cid:561)na(cid:561)podstawie(cid:561)której(cid:561)następuje(cid:561) oddanie(cid:561)go(cid:561)do(cid:561)czasowego(cid:561)korzystania(cid:496)(cid:561)oraz zbywania(cid:561)i(cid:561)obcią(cid:268)ania(cid:561)nieruchomości (cid:442) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)3(cid:561)KC(cid:508)(cid:495) 1 . P r z e d s t a w c e l s t w o i i I . K o d e k s c y w i l n y 2 Kryterium Pełnomocnictwo Prokura Prokura(cid:561)mo(cid:268)e(cid:561)być(cid:561)udzielona(cid:561)kilku(cid:561)osobom(cid:497) (cid:442) (cid:442) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)4(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)KC(cid:508) łącznie(cid:561)(cid:507)prokura(cid:561)łączna(cid:508)(cid:561)lub oddzielnie(cid:495) Kierowane(cid:561)do(cid:561)przedsiębiorcy(cid:561)oświadczenia(cid:561)lub(cid:561)doręczenia(cid:561)pism(cid:561) mogą(cid:561)być(cid:561)dokonywane(cid:561)wobec(cid:561)jednej(cid:561)z(cid:561)osób(cid:496)(cid:561)którym(cid:561)udzielono(cid:561) prokury(cid:561)łącznie(cid:561)(cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)4(cid:561)(cid:535)(cid:561)(cid:344)(cid:561)KC(cid:508)(cid:495) Prokurę(cid:561)mo(cid:268)na(cid:561)ograniczyć(cid:561)do(cid:561)zakresu(cid:561)spraw(cid:561)wpisanych(cid:561)do(cid:561)reje- stru(cid:561)oddziału(cid:561)przedsiębiorstwa(cid:561)(cid:558)(cid:561)prokura(cid:561)oddziałowa(cid:561)(cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)5 KC(cid:508)(cid:495) Prokura(cid:561)powinna(cid:561)być(cid:561)pod(cid:561)rygorem(cid:561)niewa(cid:268)ności(cid:561)udzielona(cid:561)na(cid:561) piśmie(cid:495)(cid:561)Przepisu(cid:561)art(cid:495)(cid:561)(cid:351)(cid:351)(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)KC(cid:561)nie(cid:561)stosuje(cid:561)się(cid:561)(cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)2(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)KC(cid:508)(cid:495) Forma Forma(cid:561)udzielenia(cid:561)pełnomocnictwa(cid:497) (cid:442) je(cid:268)eli(cid:561)do(cid:561)wa(cid:268)ności(cid:561)czynności(cid:561)prawnej(cid:561)potrzebna(cid:561)jest(cid:561)szczególna(cid:561) forma(cid:496)(cid:561)pełnomocnictwo(cid:561)do(cid:561)dokonania(cid:561)tej(cid:561)czynności(cid:561)powinno(cid:561) być(cid:561)udzielone(cid:561)w(cid:561)tej(cid:561)samej(cid:561)formie(cid:498) pełnomocnictwo(cid:561)ogólne(cid:561)powinno(cid:561)być(cid:561)pod(cid:561)rygorem(cid:561)niewa(cid:268)no- ści(cid:561)udzielone(cid:561)na(cid:561)piśmie(cid:495) (cid:442) (cid:507)art(cid:495)(cid:561)(cid:351)(cid:351)(cid:561)KC(cid:508) Zdolność(cid:561)do(cid:561)bycia(cid:561) pełnomocnikiem(cid:561) lub(cid:561)prokurentem Okoliczność(cid:496)(cid:561)(cid:268)e(cid:561)pełnomocnik(cid:561)jest(cid:561)ograniczony(cid:561)w(cid:561)zdolności(cid:561)do(cid:561) czynności(cid:561)prawnych(cid:496)(cid:561)nie(cid:561)ma(cid:561)wpływu(cid:561)na(cid:561)wa(cid:268)ność(cid:561)czynności(cid:561)do- konanej(cid:561)przez(cid:561)niego(cid:561)w(cid:561)imieniu(cid:561)mocodawcy(cid:561)(cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:342)(cid:561)KC(cid:508)(cid:495) Prokurentem(cid:561)mo(cid:268)e(cid:561)być(cid:561)osoba(cid:561)(cid:281)zyczna(cid:561)mająca(cid:561)pełną(cid:561)zdolność(cid:561)do(cid:561) czynności(cid:561)prawnych(cid:561)(cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)2(cid:561)(cid:535)(cid:561)(cid:344)(cid:561)KC(cid:508)(cid:495) Rejestracja Podpis A i . Ś w c z e w s k a , P r a w o p r y w a t n e Zgłoszenie(cid:561)do(cid:561)rejestru(cid:561)przedsiębiorców(cid:497) (cid:442) (cid:442) (cid:442) udzielenia(cid:561)i(cid:561)wygaśnięcia(cid:561)prokury(cid:496) obowiązkowo(cid:561)przez(cid:561)przedsiębiorcę(cid:496) o(cid:561)udzieleniu(cid:561)prokury(cid:561)powinno(cid:561)określać(cid:497) (cid:522)(cid:561) (cid:522)(cid:561) jej(cid:561)rodzaj(cid:496) w(cid:561)przypadku(cid:561)prokury(cid:561)łącznej(cid:561)tak(cid:268)e(cid:561)sposób(cid:561)jej(cid:561)wykonywania(cid:495) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)8(cid:561)KC(cid:508) Prokurent(cid:561)składa(cid:561)własnoręczny(cid:561)podpis(cid:497) (cid:442) zgodnie(cid:561)ze(cid:561)znajdującym(cid:561)się(cid:561)w(cid:561)aktach(cid:561)rejestrowych(cid:561)wzorem(cid:561) podpisu(cid:496) wraz(cid:561)z(cid:561)dopiskiem(cid:561)wskazującym(cid:561)na(cid:561)prokurę(cid:496)(cid:561)chyba(cid:561)(cid:268)e(cid:561)z(cid:561)treści(cid:561) dokumentu(cid:561)wynika(cid:496)(cid:561)(cid:268)e(cid:561)działa(cid:561)jako(cid:561)prokurent (cid:442) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)9(cid:561)KC(cid:508)(cid:495) A i . Ś w c z e w s k a , P r a w o p r y w a t n e 3 Kryterium Odwołanie(cid:496)(cid:561)wyga- śnięcie Pełnomocnictwo Prokura Odwołanie(cid:561)pełnomocnictwa(cid:497) (cid:442) mo(cid:268)liwe(cid:561)w(cid:561)ka(cid:268)dym(cid:561)czasie(cid:496) chyba(cid:561)(cid:268)e(cid:561)mocodawca(cid:561)zrzekł(cid:561)się(cid:561)odwołania(cid:561)pełnomocnictwa(cid:561) (cid:442) z(cid:561)przyczyn(cid:561)uzasadnionych(cid:561)treścią(cid:561)stosunku(cid:561)prawnego(cid:561)będące- go(cid:561)podstawą(cid:561)pełnomocnictwa (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:343)(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)KC(cid:508)(cid:495) Wygaśnięcie(cid:561)umocowania(cid:497) (cid:442) mocodawcy(cid:561)lub pełnomocnika(cid:496) ze(cid:561)śmiercią(cid:497) (cid:522)(cid:561) (cid:522)(cid:561) chyba(cid:561)(cid:268)e(cid:561)w(cid:561)pełnomocnictwie(cid:561)inaczej(cid:561)zastrze(cid:268)ono(cid:561)z(cid:561)przyczyn(cid:561) uzasadnionych(cid:561)treścią(cid:561)stosunku(cid:561)prawnego(cid:561)będącego(cid:561)podstawą(cid:561) pełnomocnictwa (cid:442) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:343)(cid:561)(cid:535)(cid:561)(cid:344)(cid:561)KC(cid:508)(cid:495) Prokura(cid:561)mo(cid:268)e(cid:561)być(cid:561)w(cid:561)ka(cid:268)dym(cid:561)czasie(cid:561)odwołana(cid:561)(cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)7(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)KC(cid:508)(cid:495) Prokura(cid:561)wygasa(cid:497) (cid:442) wskutek(cid:497) (cid:522)(cid:561) (cid:522)(cid:561) (cid:522)(cid:561) (cid:522)(cid:561) ze(cid:561)śmiercią(cid:561)prokurenta wykreślenia(cid:561)przedsiębiorcy(cid:561)z(cid:561)rejestru(cid:496)(cid:561)a(cid:561)tak(cid:268)e ogłoszenia(cid:561)upadłości(cid:496) otwarcia likwidacji oraz przekształcenia(cid:561)przedsiębiorcy(cid:498) (cid:442) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)7(cid:561)(cid:535)(cid:561)(cid:344)(cid:561)i(cid:561)(cid:345)(cid:561)KC(cid:508)(cid:495) Po(cid:561)wygaśnięciu(cid:561)umocowania(cid:561)pełnomocnik(cid:497) (cid:442) obowiązany(cid:561)jest(cid:561)zwrócić(cid:561)mocodawcy(cid:561)dokument(cid:561)pełnomocnic- twa(cid:498) mo(cid:268)e(cid:561)(cid:268)ądać(cid:561)poświadczonego(cid:561)odpisu(cid:561)tego(cid:561)dokumentu(cid:498)(cid:561)wyga- śnięcie(cid:561)umocowania(cid:561)powinno(cid:561)być(cid:561)na(cid:561)odpisie(cid:561)zaznaczone (cid:442) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:344)(cid:561)KC(cid:508)(cid:495) Nie(cid:561)powoduje(cid:561)wygaśnięcia(cid:561)prokury(cid:497) (cid:442) (cid:442) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)7(cid:561)(cid:535)(cid:561)(cid:346)(cid:561)KC(cid:508)(cid:495) śmierć(cid:561)przedsiębiorcy(cid:561)ani utrata(cid:561)przez(cid:561)niego(cid:561)zdolności(cid:561)do(cid:561)czynności(cid:561)prawnych Substytucja Pełnomocnik(cid:561)mo(cid:268)e(cid:561)ustanowić(cid:561)dla(cid:561)mocodawcy(cid:561)innych(cid:561)pełnomoc- ników(cid:561)↔(cid:561)umocowanie(cid:561)takie(cid:561)wynika(cid:561)z(cid:497) (cid:442) (cid:442) (cid:442) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:348)(cid:561)KC(cid:508)(cid:495) treści(cid:561)pełnomocnictwa(cid:496) ustawy(cid:561)lub stosunku(cid:561)prawnego(cid:561)będącego(cid:561)podstawą(cid:561)pełnomocnictwa Prokura(cid:561)nie(cid:561)mo(cid:268)e(cid:561)być(cid:561)przeniesiona(cid:561)(cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)6(cid:561)zd(cid:495)(cid:561)(cid:343)(cid:561)KC(cid:508)(cid:495) Prokurent(cid:561)mo(cid:268)e(cid:561)ustanowić(cid:561)pełnomocnika(cid:561)do(cid:561)poszczególnej(cid:561)czyn- ności(cid:561)lub(cid:561)pewnego(cid:561)rodzaju(cid:561)czynności(cid:561)(cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:351)6(cid:561)zd(cid:495)(cid:561)(cid:344)(cid:561)KC(cid:508)(cid:495) 1 . P r z e d s t a w c e l s t w o i i I . K o d e k s c y w i l n y 4 2. Niewa(cid:285)no(cid:258)ć; bezskuteczno(cid:258)ć czynno(cid:258)ci prawnych Kryterium Niewa(cid:268)ność Bezskuteczność(cid:561)zawieszona Bezskuteczność(cid:561)względna Brak(cid:561)zdolności(cid:561)do(cid:561) czynności(cid:561)prawnej Czynność(cid:561)prawna(cid:561)dokonana(cid:561)przez(cid:561)osobę(cid:496)(cid:561) która(cid:561)nie(cid:561)ma(cid:561)zdolności(cid:561)do(cid:561)czynności(cid:561)praw- nych(cid:497) (cid:442) (cid:442) jest(cid:561)niewa(cid:268)na(cid:498) jednak(cid:268)e(cid:561)gdy(cid:561)osoba(cid:561)niezdolna(cid:561)do(cid:561)czyn- ności(cid:561)prawnych(cid:561)zawarła(cid:561)umowę(cid:497) (cid:522)(cid:561) nale(cid:268)ącą(cid:561)do(cid:561)umów(cid:561)powszechnie(cid:561) zawieranych(cid:561)w(cid:561)drobnych(cid:561)bie(cid:268)ących(cid:561) sprawach(cid:561)(cid:268)ycia(cid:561)codziennego(cid:496) z(cid:561)chwilą(cid:561)jej(cid:561)wykonania(cid:497) a(cid:508)(cid:561) staje(cid:561)się(cid:561)ona(cid:561)wa(cid:268)na(cid:496) b(cid:508)(cid:561)chyba(cid:561)(cid:268)e(cid:561)pociąga(cid:561)za(cid:561)sobą(cid:561)ra(cid:268)ące(cid:561) (cid:522)(cid:561) pokrzywdzenie(cid:561)osoby(cid:561)niezdolnej(cid:561)do(cid:561) czynności(cid:561)prawnych (cid:507)art(cid:495)(cid:561)(cid:343)(cid:346)(cid:561)KC(cid:508)(cid:495) Czynność(cid:561)oso- by(cid:561)ograniczonej(cid:561) w(cid:561)zdolności(cid:561)do(cid:561) czynności(cid:561)praw- nych Je(cid:268)eli(cid:561)osoba(cid:561)ograniczona(cid:561)w(cid:561)zdolności(cid:561) do(cid:561)czynności(cid:561)prawnych(cid:561)dokonała(cid:561)sama(cid:561) jednostronnej(cid:561)czynności(cid:561)prawnej(cid:496)(cid:561)do(cid:561)której(cid:561) ustawa(cid:561)wymaga(cid:561)zgody(cid:561)przedstawiciela(cid:561) ustawowego(cid:496)(cid:561)czynność(cid:561)jest(cid:561)niewa(cid:268)na(cid:561) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:351)(cid:561)KC(cid:508)(cid:495) A i . Ś w c z e w s k a , P r a w o p r y w a t n e Wa(cid:268)ność(cid:561)umowy(cid:496)(cid:561)która(cid:561)została(cid:561)zawarta(cid:561) przez(cid:561)osobę(cid:561)ograniczoną(cid:561)w(cid:561)zdolności(cid:561)do(cid:561) czynności(cid:561)prawnych(cid:561)bez(cid:561)wymaganej(cid:561)zgo- dy(cid:561)przedstawiciela(cid:561)ustawowego(cid:496)(cid:561)zale(cid:268)y(cid:561)od(cid:561) potwierdzenia(cid:561)umowy(cid:561)przez(cid:497) (cid:442) (cid:442) tego(cid:561)przedstawiciela(cid:498) osobę(cid:496)(cid:561)która(cid:561)była(cid:561)ograniczona(cid:561)w(cid:561)zdol- ności(cid:561)do(cid:561)czynności(cid:561)prawnych(cid:561)(cid:558)(cid:561)po(cid:561) uzyskaniu(cid:561)pełnej(cid:561)zdolności(cid:561)do(cid:561)czynności(cid:561) prawnych (cid:507)art(cid:495)(cid:561)(cid:343)(cid:350)(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)i(cid:561)(cid:344)(cid:561)KC(cid:508)(cid:495) Strona(cid:496)(cid:561)która(cid:561)zawarła(cid:561)umowę(cid:561)z(cid:561)osobą(cid:561) ograniczoną(cid:561)w(cid:561)zdolności(cid:561)do(cid:561)czynności(cid:561) prawnych(cid:497) (cid:442) nie(cid:561)mo(cid:268)e(cid:561)powoływać(cid:561)się(cid:561)na(cid:561)brak(cid:561)zgody(cid:561) jej(cid:561)przedstawiciela(cid:561)ustawowego(cid:498) mo(cid:268)e(cid:561)jednak(cid:561)wyznaczyć(cid:561)temu(cid:561)przed- stawicielowi(cid:561)odpowiedni(cid:561)termin(cid:561)do(cid:561) potwierdzenia(cid:561)umowy(cid:498)(cid:561)staje(cid:561)się(cid:561)wolna(cid:495)(cid:561) (cid:442) Kryterium Niewa(cid:268)ność Bezskuteczność(cid:561)zawieszona Bezskuteczność(cid:561)względna po(cid:561)bezskutecznym(cid:561)upływie(cid:561)wyznaczone- go(cid:561)terminu (cid:507)art(cid:495)(cid:561)(cid:343)(cid:350)(cid:561)(cid:535)(cid:561)(cid:345)(cid:561)KC(cid:508)(cid:495) Czynność(cid:561)prawna(cid:561) sprzeczna(cid:561)z(cid:561)ustawą(cid:561) albo(cid:561)mająca(cid:561)na(cid:561)celu(cid:561) obejście(cid:561)ustawy Forma Niewa(cid:268)na(cid:561)jest(cid:561)czynność(cid:561)prawna(cid:497) (cid:442) sprzeczna(cid:561)z(cid:561)ustawą(cid:561)albo(cid:561)mająca(cid:561)na(cid:561)celu(cid:561) obejście(cid:561)ustawy(cid:496)(cid:561)chyba(cid:561)(cid:268)e(cid:561)właściwy(cid:561) przepis(cid:561)przewiduje(cid:561)inny(cid:561)skutek(cid:496)(cid:561)w(cid:561)szcze- gólności(cid:561)ten(cid:496)(cid:561)i(cid:268)(cid:561)na(cid:561)miejsce(cid:561)niewa(cid:268)nych(cid:561) postanowień(cid:561)czynności(cid:561)prawnej(cid:561)wcho- dzą(cid:561)odpowiednie(cid:561)przepisy(cid:561)ustawy(cid:498) sprzeczna(cid:561)z(cid:561)zasadami(cid:561)współ(cid:268)ycia(cid:561)spo- łecznego (cid:442) (cid:507)art(cid:495)(cid:561)(cid:347)(cid:350)(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)i(cid:561)(cid:344)(cid:561)KC(cid:508)(cid:495) Je(cid:268)eli(cid:561)niewa(cid:268)nością(cid:561)jest(cid:561)dotknięta(cid:561)tylko(cid:561) część(cid:561)czynności(cid:561)prawnej(cid:497) (cid:442) czynność(cid:561)pozostaje(cid:561)w(cid:561)mocy(cid:561)co(cid:561)do(cid:561)pozo- stałych(cid:561)części(cid:496) chyba(cid:561)(cid:268)e(cid:561)z(cid:561)okoliczności(cid:561)wynika(cid:496)(cid:561)i(cid:268)(cid:561)bez(cid:561) postanowień(cid:561)dotkniętych(cid:561)niewa(cid:268)nością(cid:561) czynność(cid:561)nie(cid:561)zostałaby(cid:561)dokonana (cid:442) (cid:507)art(cid:495)(cid:561)(cid:347)(cid:350)(cid:561)(cid:535)(cid:561)(cid:345)(cid:561)KC(cid:508)(cid:495) Je(cid:268)eli(cid:561)ustawa(cid:561)zastrzega(cid:561)dla(cid:561)czynności(cid:561) prawnej(cid:561)formę(cid:497) (cid:442) pisemną(cid:496)(cid:561)czynność(cid:561)dokonana(cid:561)bez(cid:561)zacho- wania(cid:561)zastrze(cid:268)onej(cid:561)formy(cid:561)jest(cid:561)niewa(cid:268)na(cid:561) ↔(cid:561)ustawa(cid:561)przewiduje(cid:561)rygor(cid:561)niewa(cid:268)no- ści(cid:498) inną(cid:561)formę(cid:561)szczególną(cid:497) (cid:522)(cid:561) czynność(cid:561)dokonana(cid:561)bez(cid:561)zachowania(cid:561)tej(cid:561) formy(cid:561)jest(cid:561)niewa(cid:268)na(cid:496) nie(cid:561)dotyczy(cid:561)to(cid:561)jednak(cid:561)wypadków(cid:496)(cid:561)gdy(cid:561) zachowanie(cid:561)formy(cid:561)szczególnej(cid:561)jest(cid:561)za- strze(cid:268)one(cid:561)jedynie(cid:561)dla(cid:561)wywołania(cid:561)okre- ślonych(cid:561)skutków(cid:561)czynności(cid:561)prawnej (cid:522)(cid:561) (cid:442) (cid:507)art(cid:495)(cid:561)(cid:349)(cid:345)(cid:561)KC(cid:508)(cid:495) A i . Ś w c z e w s k a , P r a w o p r y w a t n e 5 2 . i N e w a (cid:285) n o (cid:258) ć ; b e z s k u t e c z n o (cid:258) ć c z y n n o (cid:258) c i p r a w n y c h Kryterium Niewa(cid:268)ność Bezskuteczność(cid:561)zawieszona Bezskuteczność(cid:561)względna Ius(cid:561)ad(cid:561)rem Actio(cid:561)Pauliana 6 A i . Ś w c z e w s k a , P r a w o p r y w a t n e I . K o d e k s c y w i l n y W(cid:561)razie(cid:561)zawarcia(cid:561)umowy(cid:496)(cid:561)której(cid:561)wykona- nie(cid:561)czyni(cid:561)całkowicie(cid:561)lub(cid:561)częściowo(cid:561)niemo(cid:268)- liwym(cid:561)zadośćuczynienie(cid:561)roszczeniu(cid:561)osoby(cid:561) trzeciej(cid:496)(cid:561)osoba(cid:561)ta(cid:561)mo(cid:268)e(cid:561)(cid:268)ądać(cid:561)uznania(cid:561)umo- wy(cid:561)za(cid:561)bezskuteczną(cid:561)w(cid:561)stosunku(cid:561)do(cid:561)niej(cid:497) (cid:442) je(cid:268)eli(cid:497) (cid:522)(cid:561) (cid:522)(cid:561) przed(cid:561)upływem(cid:561)roku(cid:561)od(cid:561)jej(cid:561)zawarcia strony(cid:561)o(cid:561)jej(cid:561)roszczeniu(cid:561)wiedziały(cid:561)albo umowa(cid:561)była(cid:561)nieodpłatna(cid:498) (cid:442) (cid:507)art(cid:495)(cid:561)(cid:347)(cid:351)(cid:561)KC(cid:508)(cid:495) Ka(cid:268)dy(cid:561)z(cid:561)wierzycieli(cid:561)mo(cid:268)e(cid:561)(cid:268)ądać(cid:561)uznania(cid:561) czynności(cid:561)prawnej(cid:561)za(cid:561)bezskuteczną(cid:561)w(cid:561)sto- sunku(cid:561)do(cid:561)niego(cid:496)(cid:561)je(cid:268)eli(cid:561)(cid:507)kumulatywnie(cid:508) (cid:442) wskutek(cid:561)czynności(cid:561)prawnej(cid:561)dłu(cid:268)nika(cid:561)do- konanej(cid:561)z(cid:561)pokrzywdzeniem(cid:561)wierzycieli(cid:497) (cid:522)(cid:561) dłu(cid:268)nik(cid:561)stał(cid:561)się(cid:497) a(cid:508)(cid:561) niewypłacalny(cid:561)albo b(cid:508)(cid:561)niewypłacalny(cid:561)w(cid:561)wy(cid:268)szym(cid:561)stopniu(cid:496)(cid:561) (cid:442) ni(cid:268)(cid:561)był(cid:561)przed(cid:561)dokonaniem(cid:561)czynno- ści(cid:498) (cid:522)(cid:561) osoba(cid:561)trzecia(cid:561)uzyskała(cid:561)korzyść(cid:561)mająt- kową(cid:498) dłu(cid:268)nik(cid:561)działał(cid:561)ze(cid:561)świadomością(cid:561)po- krzywdzenia(cid:561)wierzycieli(cid:496)(cid:561)przy(cid:561)czym(cid:497) domniemywa(cid:561)się(cid:496)(cid:561)i(cid:268)(cid:561)działał(cid:561)ze(cid:561)świa- (cid:522)(cid:561) domością(cid:561)pokrzywdzenia(cid:561)wierzycieli(cid:496)(cid:561) gdy(cid:497) a(cid:508)(cid:561) w(cid:561)chwili(cid:561)darowizny(cid:561)dłu(cid:268)nik(cid:561)był(cid:561) niewypłacalny(cid:561)albo b(cid:508)(cid:561)dłu(cid:268)nik(cid:561)stał(cid:561)się(cid:561)niewypłacalny(cid:561) wskutek(cid:561)dokonania(cid:561)darowizny(cid:498) c(cid:508)(cid:561) osoba(cid:561)trzecia(cid:561)wiedziała(cid:561)o(cid:561)dokona- niu(cid:561)tej(cid:561)czynności(cid:561)z(cid:561)pokrzywdze- niem(cid:561)wierzycieli(cid:561)lub(cid:561)przy(cid:561)zachowa- niu(cid:561)nale(cid:268)ytej(cid:561)staranności(cid:561)mogła(cid:561)się(cid:561) dowiedzieć(cid:496)(cid:561)przy(cid:561)czym(cid:497) (cid:522)(cid:561) stosuje(cid:561)się(cid:561)domniemanie(cid:496)(cid:561)(cid:268)e(cid:561)osoba(cid:561)ta(cid:561) wiedziała(cid:496)(cid:561)gdy(cid:561)wskutek(cid:561)czynności(cid:561) prawnej(cid:561)dłu(cid:268)nika(cid:561)dokonanej(cid:561)z(cid:561)po- A i . Ś w c z e w s k a , P r a w o p r y w a t n e 7 Kryterium Niewa(cid:268)ność Bezskuteczność(cid:561)zawieszona Bezskuteczność(cid:561)względna krzywdzeniem(cid:561)wierzycieli(cid:561)korzyść(cid:561) majątkową(cid:497) a(cid:508)(cid:561) uzyskała(cid:561)osoba(cid:561)będąca(cid:561)w(cid:561)bliskim(cid:561) z(cid:561)nim(cid:561)stosunku(cid:496) (cid:522)(cid:561) b(cid:508)(cid:561)uzyskał(cid:561)przedsiębiorca(cid:561)pozostający(cid:561) z(cid:561)dłu(cid:268)nikiem(cid:561)w(cid:561)stałych(cid:561)stosunkach(cid:561) gospodarczych(cid:496) je(cid:268)eli(cid:561)wskutek(cid:561)czynności(cid:561)prawnej(cid:561) dokonanej(cid:561)przez(cid:561)dłu(cid:268)nika(cid:561)z(cid:561)pokrzyw- dzeniem(cid:561)wierzycieli(cid:561)osoba(cid:561)trzecia(cid:561) uzyskała(cid:561)korzyść(cid:561)majątkową(cid:561)bezpłat- nie(cid:496)(cid:561)wierzyciel(cid:561)mo(cid:268)e(cid:561)(cid:268)ądać(cid:561)uznania(cid:561) czynności(cid:561)za(cid:561)bezskuteczną(cid:496)(cid:561)chocia(cid:268)by(cid:561) osoba(cid:561)ta(cid:497) a(cid:508)(cid:561) nie(cid:561)wiedziała(cid:561)i b(cid:508)(cid:561)nawet(cid:561)przy(cid:561)zachowaniu(cid:561)nale(cid:268)ytej(cid:561) staranności(cid:561)nie(cid:561)mogła(cid:561)się(cid:561)dowie- dzieć(cid:496)(cid:561)(cid:268)e(cid:561)dłu(cid:268)nik(cid:561)działał(cid:561)ze(cid:561)świado- mością(cid:561)pokrzywdzenia(cid:561)wierzycieli (cid:507)art(cid:495)(cid:561)(cid:347)(cid:344)(cid:349)(cid:558)(cid:347)(cid:344)(cid:351)(cid:561)KC(cid:508)(cid:495) Uznanie(cid:561)za(cid:561)bezskuteczną(cid:561)czynności(cid:561)praw- nej(cid:561)dłu(cid:268)nika(cid:561)dokonanej(cid:561)z(cid:561)pokrzywdzeniem(cid:561) wierzycieli(cid:497) (cid:442) następuje(cid:561)w(cid:561)drodze(cid:561)powództwa(cid:561)lub(cid:561) zarzutu(cid:561)przeciwko(cid:561)osobie(cid:561)trzeciej(cid:496)(cid:561)która(cid:561) wskutek(cid:561)tej(cid:561)czynności(cid:561)uzyskała(cid:561)korzyść(cid:561) majątkową(cid:498) nie(cid:561)mo(cid:268)na(cid:561)go(cid:561)(cid:268)ądać(cid:561)po(cid:561)upływie(cid:561)(cid:347)(cid:561)lat(cid:561)od(cid:561) daty(cid:561)tej(cid:561)czynności (cid:442) (cid:507)art(cid:495)(cid:561)(cid:347)(cid:345)(cid:343)(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)i(cid:561)art(cid:495)(cid:561)(cid:347)(cid:345)(cid:346)(cid:561)KC(cid:508)(cid:495) W(cid:561)wypadku(cid:561)gdy(cid:561)osoba(cid:561)trzecia(cid:561)rozporzą- dziła(cid:561)uzyskaną(cid:561)korzyścią(cid:496)(cid:561)wierzyciel(cid:561)mo(cid:268)e(cid:561) wystąpić(cid:561)bezpośrednio(cid:561)przeciwko(cid:561)osobie(cid:496)(cid:561) na(cid:561)której(cid:561)rzecz(cid:561)rozporządzenie(cid:561)nastąpiło(cid:496)(cid:561) je(cid:268)eli(cid:497) (cid:442) osoba(cid:561)ta(cid:561)wiedziała(cid:561)o(cid:561)okolicznościach(cid:561) uzasadniających(cid:561)uznanie(cid:561)czynności(cid:561)dłu(cid:268)- nika(cid:561)za(cid:561)bezskuteczną(cid:561)albo 2 . i N e w a (cid:285) n o (cid:258) ć ; b e z s k u t e c z n o (cid:258) ć c z y n n o (cid:258) c i p r a w n y c h I . K o d e k s c y w i l n y Kryterium Niewa(cid:268)ność Bezskuteczność(cid:561)zawieszona Bezskuteczność(cid:561)względna rozporządzenie(cid:561)było(cid:561)nieodpłatne (cid:442) (cid:507)art(cid:495)(cid:561)(cid:347)(cid:345)(cid:343)(cid:561)(cid:535)(cid:561)(cid:344)(cid:561)KC(cid:508)(cid:495) Bezskuteczność(cid:561) względna(cid:561)do(cid:268)y- wocia Odrzucenie(cid:561)spadku(cid:561) z(cid:561)pokrzywdzeniem(cid:561) wierzycieli (cid:442) Osoba(cid:496)(cid:561)względem(cid:561)której(cid:561)cią(cid:268)y(cid:561)na(cid:561)do(cid:268)ywot- niku(cid:561)ustawowy(cid:561)obowiązek(cid:561)alimentacyjny(cid:496)(cid:561) mo(cid:268)e(cid:561)(cid:268)ądać(cid:561)uznania(cid:561)umowy(cid:561)o(cid:561)do(cid:268)ywocie(cid:561) za(cid:561)bezskuteczną(cid:561)w(cid:561)stosunku(cid:561)do(cid:561)niej(cid:497) (cid:442) je(cid:268)eli(cid:561)wskutek(cid:561)tej(cid:561)umowy(cid:561)do(cid:268)ywotnik(cid:561) stał(cid:561)się(cid:561)niewypłacalny(cid:498) uprawnienie(cid:561)to(cid:561)przysługuje(cid:561)bez(cid:561)względu(cid:561) na(cid:497) (cid:522)(cid:561) to(cid:496)(cid:561)czy(cid:561)do(cid:268)ywotnik(cid:561)działał(cid:561)ze(cid:561)świado- mością(cid:561)pokrzywdzenia(cid:561)wierzycieli(cid:496)(cid:561) oraz czas(cid:561)zawarcia(cid:561)umowy(cid:498) (cid:522)(cid:561) przed(cid:561)upływem(cid:561)(cid:347)(cid:561)lat(cid:561)od(cid:561)daty(cid:561)tej(cid:561)umowy (cid:442) (cid:507)art(cid:495)(cid:561)(cid:351)(cid:343)(cid:348)(cid:561)KC(cid:508)(cid:495) (cid:442) Je(cid:268)eli(cid:561)spadkobierca(cid:561)odrzucił(cid:561)spadek(cid:561)z(cid:561)po- krzywdzeniem(cid:561)wierzycieli(cid:496)(cid:561)ka(cid:268)dy(cid:561)z(cid:561)wie- rzycieli(cid:497) (cid:442) którego(cid:561)wierzytelność(cid:561)istniała(cid:561)w(cid:561)chwili(cid:561) odrzucenia(cid:561)spadku mo(cid:268)e(cid:561)(cid:268)ądać(cid:561)uznania(cid:561)odrzucenia(cid:561)spadku(cid:561) za(cid:561)bezskuteczne(cid:561)w(cid:561)stosunku(cid:561)do(cid:561)niego(cid:561) według(cid:561)przepisów(cid:561)o(cid:561)ochronie(cid:561)wierzycieli(cid:561) w(cid:561)razie(cid:561)niewypłacalności(cid:561)dłu(cid:268)nika(cid:497) (cid:522)(cid:561) w(cid:561)ciągu(cid:561)(cid:348)(cid:561)miesięcy(cid:561)od(cid:561)chwili(cid:561)powzię- cia(cid:561)wiadomości(cid:561)o(cid:561)odrzuceniu(cid:561)spadku(cid:496)(cid:561) lecz nie(cid:561)pó(cid:266)niej(cid:561)ni(cid:268)(cid:561)przed(cid:561)upływem(cid:561)(cid:345)(cid:561)lat(cid:561)od(cid:561) odrzucenia(cid:561)spadku (cid:522)(cid:561) (cid:507)art(cid:495)(cid:561)(cid:343)(cid:342)(cid:344)(cid:346)(cid:561)KC(cid:508)(cid:495) 8 A i . Ś w c z e w s k a , P r a w o p r y w a t n e A i . Ś w c z e w s k a , P r a w o p r y w a t n e 9 3. Forma uzupełnienia, zmiany, rozwiązania albo wypowiedzenia umowy; forma odstąpienia Forma(cid:561)zawarcia(cid:561)umowy Uzupełnienie(cid:561)lub(cid:561)zmiana Rozwiązanie(cid:561)za(cid:561)zgodą(cid:561)obu(cid:561) stron Odstąpienie Wypowiedzenie Pisemna Inna(cid:561)forma(cid:561)szczególna Taka(cid:561)forma(cid:496)(cid:561)jaką(cid:561)ustawa(cid:561)lub(cid:561) strony(cid:561)przewidziały(cid:561)w(cid:561)celu(cid:561) jej(cid:561)zawarcia(cid:561)(cid:507)art(cid:495)(cid:561)(cid:349)(cid:349)(cid:561)(cid:535)(cid:561)(cid:343)(cid:561)KC(cid:508)(cid:495) Powinno(cid:561)być(cid:561)stwierdzone(cid:561)pismem(cid:561)(cid:507)art(cid:495)(cid:561)(cid:349)(cid:349)(cid:561)(cid:535)(cid:561)(cid:344)(cid:561)KC(cid:508)(cid:495) Taka(cid:561)forma(cid:496)(cid:561)jaką(cid:561)ustawa(cid:561)lub(cid:561) strony(cid:561)przewidziały(cid:561)w(cid:561)celu(cid:561) jej(cid:561)zawarcia(cid:561)(cid:507)art(cid:495)(cid:561)(cid:349)(cid:349)(cid:561)(cid:535)(cid:561)(cid:345)(cid:561)KC(cid:508)(cid:495) Powinno(cid:561)być(cid:561)stwierdzone(cid:561)pismem(cid:561)(cid:507)art(cid:495)(cid:561)(cid:349)(cid:349)(cid:561)(cid:535)(cid:561)(cid:345)(cid:561)KC(cid:508)(cid:495) 4. Forma pisemna dla celów dowodowych Kodeks cywilny Kodeks(cid:561)postępowania(cid:561)cywilnego na(cid:561)fakt(cid:561)jej(cid:561)dokonania(cid:497) (cid:522)(cid:561) Dowód(cid:561)ze(cid:561)świadków(cid:561)lub(cid:561)przesłuchania(cid:561)stron(cid:561)w(cid:561)sprawie(cid:561)między(cid:561)uczestnika- mi(cid:561)czynności(cid:497) (cid:442) je(cid:268)eli(cid:561)ustawa(cid:561)lub(cid:561)umowa(cid:561)stron(cid:561)wymaga(cid:561)dla(cid:561)czynności(cid:561)prawnej(cid:561)zacho- wania(cid:561)formy(cid:561)pisemnej(cid:496) jest(cid:561)dopuszczalny(cid:497) a(cid:508)(cid:561) gdy(cid:561)dokument(cid:561)obejmujący(cid:561)czynność(cid:561)został(cid:497) (cid:522)(cid:561) Skutki(cid:561)zastrze(cid:268)enia(cid:561)formy(cid:561)pisemnej(cid:561)bez(cid:561)rygoru(cid:561)niewa(cid:268)ności(cid:497) (cid:442) w(cid:561)razie(cid:561)niezachowania(cid:561)zastrze(cid:268)onej(cid:561)formy(cid:497) (cid:522)(cid:561) dowód(cid:497) a(cid:508)(cid:561) ze(cid:561)świadków(cid:561)albo b(cid:508)(cid:561)z(cid:561)przesłuchania(cid:561)stron(cid:561)na(cid:561)fakt(cid:561)dokonania(cid:561)czynności(cid:496) co(cid:561)do(cid:561)zasady(cid:561)nie(cid:561)jest(cid:561)w(cid:561)sporze(cid:561)dopuszczalny(cid:496) jest(cid:561)dopuszczalny(cid:497) a(cid:508)(cid:561) gdy(cid:561)zachowanie(cid:561)formy(cid:561)pisemnej(cid:561)jest(cid:561)zastrze(cid:268)one(cid:561)jedynie(cid:561)dla(cid:561)wywo- (cid:522)(cid:561) (cid:522)(cid:561) łania(cid:561)określonych(cid:561)skutków(cid:561)czynności(cid:561)prawnej(cid:498)(cid:561)jak(cid:561)równie(cid:268) b(cid:508)(cid:561)je(cid:268)eli(cid:497) (cid:544) (cid:544) (cid:544) obie(cid:561)strony(cid:561)wyra(cid:268)ą(cid:561)na(cid:561)to(cid:561)zgodę(cid:561)albo (cid:268)ąda(cid:561)tego(cid:561)konsument(cid:561)w(cid:561)sporze(cid:561)z(cid:561)przedsiębiorcą(cid:561)albo fakt(cid:561)dokonania(cid:561)czynności(cid:561)prawnej(cid:561)będzie(cid:561)uprawdopodobniony(cid:561)za(cid:561) pomocą(cid:561)pisma(cid:498) (cid:442) (cid:442) przepisów(cid:561)o(cid:561)formie(cid:561)pisemnej(cid:561)przewidzianej(cid:561)dla(cid:561)celów(cid:561)dowodowych(cid:561)nie(cid:561) stosuje(cid:561)się(cid:561)do(cid:561)czynności(cid:561)prawnych(cid:561)w(cid:561)stosunkach(cid:561)między(cid:561)przedsiębiorca- mi (cid:507)art(cid:495)(cid:561)(cid:349)(cid:346)(cid:561)KC(cid:508)(cid:495) (cid:544) (cid:544) (cid:544) zagubiony(cid:496) zniszczony(cid:561)lub zabrany(cid:561)przez(cid:561)osobę(cid:561)trzecią(cid:496)(cid:561)natomiast b(cid:508)(cid:561)je(cid:268)eli(cid:561)forma(cid:561)pisemna(cid:561)była(cid:561)zastrze(cid:268)ona(cid:561)tylko(cid:561)dla(cid:561)celów(cid:561)dowodowych(cid:561) (cid:558)(cid:561)tak(cid:268)e(cid:561)w(cid:561)wypadkach(cid:561)określonych(cid:561)w(cid:561)KC(cid:498) tak(cid:268)e(cid:561)przeciwko(cid:561)osnowie(cid:561)lub(cid:561)ponad(cid:561)osnowę(cid:561)dokumentu(cid:561)obejmującego(cid:561) czynność(cid:561)prawną(cid:561)mo(cid:268)e(cid:561)być(cid:561)dopuszczony(cid:561)między(cid:561)uczestnikami(cid:561)tej(cid:561)czyn- ności(cid:561)(cid:316) (cid:522)(cid:561) nie(cid:561)doprowadzi(cid:561)to(cid:561)do(cid:561)obejścia(cid:561)przepisów(cid:561)o(cid:561)formie(cid:561)zastrze(cid:268)onej(cid:561)pod(cid:561) rygorem(cid:561)niewa(cid:268)ności(cid:561)i(cid:561)gdy ze(cid:561)względu(cid:561)na(cid:561)szczególne(cid:561)okoliczności(cid:561)sprawy(cid:561)sąd(cid:561)uzna(cid:561)to(cid:561)za(cid:561)koniecz- ne (cid:522)(cid:561) (cid:507)art(cid:495)(cid:561)(cid:344)(cid:346)(cid:348)(cid:558)(cid:344)(cid:346)(cid:349)(cid:561)KPC(cid:508)(cid:495) 4 l . F o r m a p i s e m n a d a c e ó w d o w o d o w y c h l
Pobierz darmowy fragment (pdf)

Gdzie kupić całą publikację:

Prawo prywatne

Opinie na temat publikacji:

Inne popularne pozycje z tej kategorii:

Czytaj również:

Prowadzisz stronę lub blog? Wstaw link do fragmentu tej książki i współpracuj z Cyfroteką: